Merge master into libhac-save
This commit is contained in:
commit
c18a7fe8bd
66 changed files with 2566 additions and 954 deletions
27
.github/workflows/build.yml
vendored
Normal file
27
.github/workflows/build.yml
vendored
Normal file
|
@ -0,0 +1,27 @@
|
||||||
|
name: "Build job"
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- master
|
||||||
|
pull_request:
|
||||||
|
branches:
|
||||||
|
- '*'
|
||||||
|
jobs:
|
||||||
|
build:
|
||||||
|
runs-on: ${{ matrix.os }}
|
||||||
|
strategy:
|
||||||
|
matrix:
|
||||||
|
os: [ubuntu-latest, macOS-latest, windows-latest]
|
||||||
|
dotnet: ['3.1.100']
|
||||||
|
environment: ['Debug', 'Release', 'Profile Debug', 'Profile Release']
|
||||||
|
name: ${{ matrix.environment }} build (Dotnet ${{ matrix.dotnet }}, OS ${{ matrix.os }})
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@master
|
||||||
|
- name: Setup dotnet
|
||||||
|
uses: actions/setup-dotnet@v1
|
||||||
|
with:
|
||||||
|
dotnet-version: ${{ matrix.dotnet }}
|
||||||
|
- name: Build
|
||||||
|
run: dotnet build -c "${{ matrix.environment }}"
|
||||||
|
- name: Test
|
||||||
|
run: dotnet test -c "${{ matrix.environment }}"
|
|
@ -75,6 +75,10 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
Add(X86Instruction.And, new InstructionInfo(0x00000021, 0x04000083, 0x04000081, BadOp, 0x00000023, InstructionFlags.None));
|
Add(X86Instruction.And, new InstructionInfo(0x00000021, 0x04000083, 0x04000081, BadOp, 0x00000023, InstructionFlags.None));
|
||||||
Add(X86Instruction.Andnpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f55, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
Add(X86Instruction.Andnpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f55, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
||||||
Add(X86Instruction.Andnps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f55, InstructionFlags.Vex));
|
Add(X86Instruction.Andnps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f55, InstructionFlags.Vex));
|
||||||
|
Add(X86Instruction.Andpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f54, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
||||||
|
Add(X86Instruction.Andps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f54, InstructionFlags.Vex));
|
||||||
|
Add(X86Instruction.Blendvpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x000f3815, InstructionFlags.Prefix66));
|
||||||
|
Add(X86Instruction.Blendvps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x000f3814, InstructionFlags.Prefix66));
|
||||||
Add(X86Instruction.Bsr, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000fbd, InstructionFlags.None));
|
Add(X86Instruction.Bsr, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000fbd, InstructionFlags.None));
|
||||||
Add(X86Instruction.Bswap, new InstructionInfo(0x00000fc8, BadOp, BadOp, BadOp, BadOp, InstructionFlags.RegOnly));
|
Add(X86Instruction.Bswap, new InstructionInfo(0x00000fc8, BadOp, BadOp, BadOp, BadOp, InstructionFlags.RegOnly));
|
||||||
Add(X86Instruction.Call, new InstructionInfo(0x020000ff, BadOp, BadOp, BadOp, BadOp, InstructionFlags.None));
|
Add(X86Instruction.Call, new InstructionInfo(0x020000ff, BadOp, BadOp, BadOp, BadOp, InstructionFlags.None));
|
||||||
|
@ -245,6 +249,8 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
Add(X86Instruction.Unpckhps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f15, InstructionFlags.Vex));
|
Add(X86Instruction.Unpckhps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f15, InstructionFlags.Vex));
|
||||||
Add(X86Instruction.Unpcklpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f14, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
Add(X86Instruction.Unpcklpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f14, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
||||||
Add(X86Instruction.Unpcklps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f14, InstructionFlags.Vex));
|
Add(X86Instruction.Unpcklps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f14, InstructionFlags.Vex));
|
||||||
|
Add(X86Instruction.Vblendvpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x000f3a4b, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
||||||
|
Add(X86Instruction.Vblendvps, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x000f3a4a, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
||||||
Add(X86Instruction.Vpblendvb, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x000f3a4c, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
Add(X86Instruction.Vpblendvb, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x000f3a4c, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
||||||
Add(X86Instruction.Xor, new InstructionInfo(0x00000031, 0x06000083, 0x06000081, BadOp, 0x00000033, InstructionFlags.None));
|
Add(X86Instruction.Xor, new InstructionInfo(0x00000031, 0x06000083, 0x06000081, BadOp, 0x00000033, InstructionFlags.None));
|
||||||
Add(X86Instruction.Xorpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f57, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
Add(X86Instruction.Xorpd, new InstructionInfo(BadOp, BadOp, BadOp, BadOp, 0x00000f57, InstructionFlags.Vex | InstructionFlags.Prefix66));
|
||||||
|
|
|
@ -336,7 +336,15 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
|
|
||||||
Debug.Assert(!dest.Type.IsInteger());
|
Debug.Assert(!dest.Type.IsInteger());
|
||||||
|
|
||||||
if (info.Inst == X86Instruction.Pblendvb && HardwareCapabilities.SupportsVexEncoding)
|
if (info.Inst == X86Instruction.Blendvpd && HardwareCapabilities.SupportsVexEncoding)
|
||||||
|
{
|
||||||
|
context.Assembler.WriteInstruction(X86Instruction.Vblendvpd, dest, src1, src2, src3);
|
||||||
|
}
|
||||||
|
else if (info.Inst == X86Instruction.Blendvps && HardwareCapabilities.SupportsVexEncoding)
|
||||||
|
{
|
||||||
|
context.Assembler.WriteInstruction(X86Instruction.Vblendvps, dest, src1, src2, src3);
|
||||||
|
}
|
||||||
|
else if (info.Inst == X86Instruction.Pblendvb && HardwareCapabilities.SupportsVexEncoding)
|
||||||
{
|
{
|
||||||
context.Assembler.WriteInstruction(X86Instruction.Vpblendvb, dest, src1, src2, src3);
|
context.Assembler.WriteInstruction(X86Instruction.Vpblendvb, dest, src1, src2, src3);
|
||||||
}
|
}
|
||||||
|
@ -1646,7 +1654,7 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
|
|
||||||
for (int offset = PageSize; offset < size; offset += PageSize)
|
for (int offset = PageSize; offset < size; offset += PageSize)
|
||||||
{
|
{
|
||||||
Operand memOp = new MemoryOperand(OperandType.I32, rsp, null, Multiplier.x1, -offset);;
|
Operand memOp = new MemoryOperand(OperandType.I32, rsp, null, Multiplier.x1, -offset);
|
||||||
|
|
||||||
context.Assembler.Mov(temp, memOp, OperandType.I32);
|
context.Assembler.Mov(temp, memOp, OperandType.I32);
|
||||||
}
|
}
|
||||||
|
|
|
@ -19,6 +19,10 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
Add(Intrinsic.X86Addss, new IntrinsicInfo(X86Instruction.Addss, IntrinsicType.Binary));
|
Add(Intrinsic.X86Addss, new IntrinsicInfo(X86Instruction.Addss, IntrinsicType.Binary));
|
||||||
Add(Intrinsic.X86Andnpd, new IntrinsicInfo(X86Instruction.Andnpd, IntrinsicType.Binary));
|
Add(Intrinsic.X86Andnpd, new IntrinsicInfo(X86Instruction.Andnpd, IntrinsicType.Binary));
|
||||||
Add(Intrinsic.X86Andnps, new IntrinsicInfo(X86Instruction.Andnps, IntrinsicType.Binary));
|
Add(Intrinsic.X86Andnps, new IntrinsicInfo(X86Instruction.Andnps, IntrinsicType.Binary));
|
||||||
|
Add(Intrinsic.X86Andpd, new IntrinsicInfo(X86Instruction.Andpd, IntrinsicType.Binary));
|
||||||
|
Add(Intrinsic.X86Andps, new IntrinsicInfo(X86Instruction.Andps, IntrinsicType.Binary));
|
||||||
|
Add(Intrinsic.X86Blendvpd, new IntrinsicInfo(X86Instruction.Blendvpd, IntrinsicType.Ternary));
|
||||||
|
Add(Intrinsic.X86Blendvps, new IntrinsicInfo(X86Instruction.Blendvps, IntrinsicType.Ternary));
|
||||||
Add(Intrinsic.X86Cmppd, new IntrinsicInfo(X86Instruction.Cmppd, IntrinsicType.TernaryImm));
|
Add(Intrinsic.X86Cmppd, new IntrinsicInfo(X86Instruction.Cmppd, IntrinsicType.TernaryImm));
|
||||||
Add(Intrinsic.X86Cmpps, new IntrinsicInfo(X86Instruction.Cmpps, IntrinsicType.TernaryImm));
|
Add(Intrinsic.X86Cmpps, new IntrinsicInfo(X86Instruction.Cmpps, IntrinsicType.TernaryImm));
|
||||||
Add(Intrinsic.X86Cmpsd, new IntrinsicInfo(X86Instruction.Cmpsd, IntrinsicType.TernaryImm));
|
Add(Intrinsic.X86Cmpsd, new IntrinsicInfo(X86Instruction.Cmpsd, IntrinsicType.TernaryImm));
|
||||||
|
|
|
@ -298,8 +298,11 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
{
|
{
|
||||||
IntrinsicOperation intrinOp = (IntrinsicOperation)operation;
|
IntrinsicOperation intrinOp = (IntrinsicOperation)operation;
|
||||||
|
|
||||||
// PBLENDVB last operand is always implied to be XMM0 when VEX is not supported.
|
// BLENDVPD, BLENDVPS, PBLENDVB last operand is always implied to be XMM0 when VEX is not supported.
|
||||||
if (intrinOp.Intrinsic == Intrinsic.X86Pblendvb && !HardwareCapabilities.SupportsVexEncoding)
|
if ((intrinOp.Intrinsic == Intrinsic.X86Blendvpd ||
|
||||||
|
intrinOp.Intrinsic == Intrinsic.X86Blendvps ||
|
||||||
|
intrinOp.Intrinsic == Intrinsic.X86Pblendvb) &&
|
||||||
|
!HardwareCapabilities.SupportsVexEncoding)
|
||||||
{
|
{
|
||||||
Operand xmm0 = Xmm(X86Register.Xmm0, OperandType.V128);
|
Operand xmm0 = Xmm(X86Register.Xmm0, OperandType.V128);
|
||||||
|
|
||||||
|
|
|
@ -10,6 +10,10 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
And,
|
And,
|
||||||
Andnpd,
|
Andnpd,
|
||||||
Andnps,
|
Andnps,
|
||||||
|
Andpd,
|
||||||
|
Andps,
|
||||||
|
Blendvpd,
|
||||||
|
Blendvps,
|
||||||
Bsr,
|
Bsr,
|
||||||
Bswap,
|
Bswap,
|
||||||
Call,
|
Call,
|
||||||
|
@ -180,6 +184,8 @@ namespace ARMeilleure.CodeGen.X86
|
||||||
Unpckhps,
|
Unpckhps,
|
||||||
Unpcklpd,
|
Unpcklpd,
|
||||||
Unpcklps,
|
Unpcklps,
|
||||||
|
Vblendvpd,
|
||||||
|
Vblendvps,
|
||||||
Vpblendvb,
|
Vpblendvb,
|
||||||
Xor,
|
Xor,
|
||||||
Xorpd,
|
Xorpd,
|
||||||
|
|
|
@ -1,12 +1,12 @@
|
||||||
using System.Runtime.CompilerServices;
|
|
||||||
|
|
||||||
namespace ARMeilleure.Common
|
namespace ARMeilleure.Common
|
||||||
{
|
{
|
||||||
static class BitUtils
|
static class BitUtils
|
||||||
{
|
{
|
||||||
private const int DeBrujinSequence = 0x77cb531;
|
private const int DeBrujinSequence = 0x77cb531;
|
||||||
|
|
||||||
private static int[] DeBrujinLbsLut;
|
private static readonly int[] DeBrujinLbsLut;
|
||||||
|
|
||||||
|
private static readonly sbyte[] HbsNibbleLut;
|
||||||
|
|
||||||
static BitUtils()
|
static BitUtils()
|
||||||
{
|
{
|
||||||
|
@ -18,19 +18,27 @@ namespace ARMeilleure.Common
|
||||||
|
|
||||||
DeBrujinLbsLut[lutIndex] = index;
|
DeBrujinLbsLut[lutIndex] = index;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
HbsNibbleLut = new sbyte[] { -1, 0, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 3, 3, 3, 3 };
|
||||||
}
|
}
|
||||||
|
|
||||||
[MethodImpl(MethodImplOptions.AggressiveInlining)]
|
public static int CountBits(int value)
|
||||||
public static int LowestBitSet(int value)
|
|
||||||
{
|
{
|
||||||
if (value == 0)
|
int count = 0;
|
||||||
|
|
||||||
|
while (value != 0)
|
||||||
{
|
{
|
||||||
return -1;
|
value &= ~(value & -value);
|
||||||
|
|
||||||
|
count++;
|
||||||
}
|
}
|
||||||
|
|
||||||
int lsb = value & -value;
|
return count;
|
||||||
|
}
|
||||||
|
|
||||||
return DeBrujinLbsLut[(uint)(DeBrujinSequence * lsb) >> 27];
|
public static long FillWithOnes(int bits)
|
||||||
|
{
|
||||||
|
return bits == 64 ? -1L : (1L << bits) - 1;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static int HighestBitSet(int value)
|
public static int HighestBitSet(int value)
|
||||||
|
@ -51,9 +59,22 @@ namespace ARMeilleure.Common
|
||||||
return -1;
|
return -1;
|
||||||
}
|
}
|
||||||
|
|
||||||
private static readonly sbyte[] HbsNibbleLut = { -1, 0, 1, 1, 2, 2, 2, 2, 3, 3, 3, 3, 3, 3, 3, 3 };
|
public static int HighestBitSetNibble(int value)
|
||||||
|
{
|
||||||
|
return HbsNibbleLut[value];
|
||||||
|
}
|
||||||
|
|
||||||
public static int HighestBitSetNibble(int value) => HbsNibbleLut[value & 0b1111];
|
public static int LowestBitSet(int value)
|
||||||
|
{
|
||||||
|
if (value == 0)
|
||||||
|
{
|
||||||
|
return -1;
|
||||||
|
}
|
||||||
|
|
||||||
|
int lsb = value & -value;
|
||||||
|
|
||||||
|
return DeBrujinLbsLut[(uint)(DeBrujinSequence * lsb) >> 27];
|
||||||
|
}
|
||||||
|
|
||||||
public static long Replicate(long bits, int size)
|
public static long Replicate(long bits, int size)
|
||||||
{
|
{
|
||||||
|
@ -67,25 +88,6 @@ namespace ARMeilleure.Common
|
||||||
return output;
|
return output;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static int CountBits(int value)
|
|
||||||
{
|
|
||||||
int count = 0;
|
|
||||||
|
|
||||||
while (value != 0)
|
|
||||||
{
|
|
||||||
value &= ~(value & -value);
|
|
||||||
|
|
||||||
count++;
|
|
||||||
}
|
|
||||||
|
|
||||||
return count;
|
|
||||||
}
|
|
||||||
|
|
||||||
public static long FillWithOnes(int bits)
|
|
||||||
{
|
|
||||||
return bits == 64 ? -1L : (1L << bits) - 1;
|
|
||||||
}
|
|
||||||
|
|
||||||
public static int RotateRight(int bits, int shift, int size)
|
public static int RotateRight(int bits, int shift, int size)
|
||||||
{
|
{
|
||||||
return (int)RotateRight((uint)bits, shift, size);
|
return (int)RotateRight((uint)bits, shift, size);
|
||||||
|
|
|
@ -10,6 +10,11 @@ namespace ARMeilleure.Decoders
|
||||||
{
|
{
|
||||||
static class Decoder
|
static class Decoder
|
||||||
{
|
{
|
||||||
|
// We define a limit on the number of instructions that a function may have,
|
||||||
|
// this prevents functions being potentially too large, which would
|
||||||
|
// take too long to compile and use too much memory.
|
||||||
|
private const int MaxInstsPerFunction = 5000;
|
||||||
|
|
||||||
private delegate object MakeOp(InstDescriptor inst, ulong address, int opCode);
|
private delegate object MakeOp(InstDescriptor inst, ulong address, int opCode);
|
||||||
|
|
||||||
private static ConcurrentDictionary<Type, MakeOp> _opActivators;
|
private static ConcurrentDictionary<Type, MakeOp> _opActivators;
|
||||||
|
@ -36,10 +41,17 @@ namespace ARMeilleure.Decoders
|
||||||
|
|
||||||
Dictionary<ulong, Block> visited = new Dictionary<ulong, Block>();
|
Dictionary<ulong, Block> visited = new Dictionary<ulong, Block>();
|
||||||
|
|
||||||
|
int opsCount = 0;
|
||||||
|
|
||||||
Block GetBlock(ulong blkAddress)
|
Block GetBlock(ulong blkAddress)
|
||||||
{
|
{
|
||||||
if (!visited.TryGetValue(blkAddress, out Block block))
|
if (!visited.TryGetValue(blkAddress, out Block block))
|
||||||
{
|
{
|
||||||
|
if (opsCount > MaxInstsPerFunction)
|
||||||
|
{
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
block = new Block(blkAddress);
|
block = new Block(blkAddress);
|
||||||
|
|
||||||
workQueue.Enqueue(block);
|
workQueue.Enqueue(block);
|
||||||
|
@ -92,6 +104,8 @@ namespace ARMeilleure.Decoders
|
||||||
|
|
||||||
FillBlock(memory, mode, currBlock, limitAddress);
|
FillBlock(memory, mode, currBlock, limitAddress);
|
||||||
|
|
||||||
|
opsCount += currBlock.OpCodes.Count;
|
||||||
|
|
||||||
if (currBlock.OpCodes.Count != 0)
|
if (currBlock.OpCodes.Count != 0)
|
||||||
{
|
{
|
||||||
// Set child blocks. "Branch" is the block the branch instruction
|
// Set child blocks. "Branch" is the block the branch instruction
|
||||||
|
|
|
@ -1,10 +1,77 @@
|
||||||
using ARMeilleure.Common;
|
using ARMeilleure.Common;
|
||||||
using System;
|
|
||||||
|
|
||||||
namespace ARMeilleure.Decoders
|
namespace ARMeilleure.Decoders
|
||||||
{
|
{
|
||||||
static class DecoderHelper
|
static class DecoderHelper
|
||||||
{
|
{
|
||||||
|
static DecoderHelper()
|
||||||
|
{
|
||||||
|
Imm8ToFP32Table = BuildImm8ToFP32Table();
|
||||||
|
Imm8ToFP64Table = BuildImm8ToFP64Table();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static readonly uint[] Imm8ToFP32Table;
|
||||||
|
public static readonly ulong[] Imm8ToFP64Table;
|
||||||
|
|
||||||
|
private static uint[] BuildImm8ToFP32Table()
|
||||||
|
{
|
||||||
|
uint[] tbl = new uint[256];
|
||||||
|
|
||||||
|
for (int idx = 0; idx < 256; idx++)
|
||||||
|
{
|
||||||
|
tbl[idx] = ExpandImm8ToFP32((uint)idx);
|
||||||
|
}
|
||||||
|
|
||||||
|
return tbl;
|
||||||
|
}
|
||||||
|
|
||||||
|
private static ulong[] BuildImm8ToFP64Table()
|
||||||
|
{
|
||||||
|
ulong[] tbl = new ulong[256];
|
||||||
|
|
||||||
|
for (int idx = 0; idx < 256; idx++)
|
||||||
|
{
|
||||||
|
tbl[idx] = ExpandImm8ToFP64((ulong)idx);
|
||||||
|
}
|
||||||
|
|
||||||
|
return tbl;
|
||||||
|
}
|
||||||
|
|
||||||
|
// abcdefgh -> aBbbbbbc defgh000 00000000 00000000 (B = ~b)
|
||||||
|
private static uint ExpandImm8ToFP32(uint imm)
|
||||||
|
{
|
||||||
|
uint MoveBit(uint bits, int from, int to)
|
||||||
|
{
|
||||||
|
return ((bits >> from) & 1U) << to;
|
||||||
|
}
|
||||||
|
|
||||||
|
return MoveBit(imm, 7, 31) | MoveBit(~imm, 6, 30) |
|
||||||
|
MoveBit(imm, 6, 29) | MoveBit( imm, 6, 28) |
|
||||||
|
MoveBit(imm, 6, 27) | MoveBit( imm, 6, 26) |
|
||||||
|
MoveBit(imm, 6, 25) | MoveBit( imm, 5, 24) |
|
||||||
|
MoveBit(imm, 4, 23) | MoveBit( imm, 3, 22) |
|
||||||
|
MoveBit(imm, 2, 21) | MoveBit( imm, 1, 20) |
|
||||||
|
MoveBit(imm, 0, 19);
|
||||||
|
}
|
||||||
|
|
||||||
|
// abcdefgh -> aBbbbbbb bbcdefgh 00000000 00000000 00000000 00000000 00000000 00000000 (B = ~b)
|
||||||
|
private static ulong ExpandImm8ToFP64(ulong imm)
|
||||||
|
{
|
||||||
|
ulong MoveBit(ulong bits, int from, int to)
|
||||||
|
{
|
||||||
|
return ((bits >> from) & 1UL) << to;
|
||||||
|
}
|
||||||
|
|
||||||
|
return MoveBit(imm, 7, 63) | MoveBit(~imm, 6, 62) |
|
||||||
|
MoveBit(imm, 6, 61) | MoveBit( imm, 6, 60) |
|
||||||
|
MoveBit(imm, 6, 59) | MoveBit( imm, 6, 58) |
|
||||||
|
MoveBit(imm, 6, 57) | MoveBit( imm, 6, 56) |
|
||||||
|
MoveBit(imm, 6, 55) | MoveBit( imm, 6, 54) |
|
||||||
|
MoveBit(imm, 5, 53) | MoveBit( imm, 4, 52) |
|
||||||
|
MoveBit(imm, 3, 51) | MoveBit( imm, 2, 50) |
|
||||||
|
MoveBit(imm, 1, 49) | MoveBit( imm, 0, 48);
|
||||||
|
}
|
||||||
|
|
||||||
public struct BitMask
|
public struct BitMask
|
||||||
{
|
{
|
||||||
public long WMask;
|
public long WMask;
|
||||||
|
@ -62,34 +129,6 @@ namespace ARMeilleure.Decoders
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
public static long DecodeImm8Float(long imm, int size)
|
|
||||||
{
|
|
||||||
int e = 0, f = 0;
|
|
||||||
|
|
||||||
switch (size)
|
|
||||||
{
|
|
||||||
case 0: e = 8; f = 23; break;
|
|
||||||
case 1: e = 11; f = 52; break;
|
|
||||||
|
|
||||||
default: throw new ArgumentOutOfRangeException(nameof(size));
|
|
||||||
}
|
|
||||||
|
|
||||||
long value = (imm & 0x3f) << f - 4;
|
|
||||||
|
|
||||||
long eBit = (imm >> 6) & 1;
|
|
||||||
long sBit = (imm >> 7) & 1;
|
|
||||||
|
|
||||||
if (eBit != 0)
|
|
||||||
{
|
|
||||||
value |= (1L << e - 3) - 1 << f + 2;
|
|
||||||
}
|
|
||||||
|
|
||||||
value |= (eBit ^ 1) << f + e - 1;
|
|
||||||
value |= sBit << f + e;
|
|
||||||
|
|
||||||
return value;
|
|
||||||
}
|
|
||||||
|
|
||||||
public static long DecodeImm24_2(int opCode)
|
public static long DecodeImm24_2(int opCode)
|
||||||
{
|
{
|
||||||
return ((long)opCode << 40) >> 38;
|
return ((long)opCode << 40) >> 38;
|
||||||
|
|
|
@ -8,16 +8,8 @@ namespace ARMeilleure.Decoders
|
||||||
|
|
||||||
public OpCodeSimdFmov(InstDescriptor inst, ulong address, int opCode) : base(inst, address, opCode)
|
public OpCodeSimdFmov(InstDescriptor inst, ulong address, int opCode) : base(inst, address, opCode)
|
||||||
{
|
{
|
||||||
int imm5 = (opCode >> 5) & 0x1f;
|
|
||||||
int type = (opCode >> 22) & 0x3;
|
int type = (opCode >> 22) & 0x3;
|
||||||
|
|
||||||
if (imm5 != 0b00000 || type > 1)
|
|
||||||
{
|
|
||||||
Instruction = InstDescriptor.Undefined;
|
|
||||||
|
|
||||||
return;
|
|
||||||
}
|
|
||||||
|
|
||||||
Size = type;
|
Size = type;
|
||||||
|
|
||||||
long imm;
|
long imm;
|
||||||
|
@ -25,7 +17,14 @@ namespace ARMeilleure.Decoders
|
||||||
Rd = (opCode >> 0) & 0x1f;
|
Rd = (opCode >> 0) & 0x1f;
|
||||||
imm = (opCode >> 13) & 0xff;
|
imm = (opCode >> 13) & 0xff;
|
||||||
|
|
||||||
Immediate = DecoderHelper.DecodeImm8Float(imm, type);
|
if (type == 0)
|
||||||
|
{
|
||||||
|
Immediate = (long)DecoderHelper.Imm8ToFP32Table[(int)imm];
|
||||||
|
}
|
||||||
|
else /* if (type == 1) */
|
||||||
|
{
|
||||||
|
Immediate = (long)DecoderHelper.Imm8ToFP64Table[(int)imm];
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
|
@ -23,19 +23,19 @@ namespace ARMeilleure.Decoders
|
||||||
|
|
||||||
if (modeHigh == 0b111)
|
if (modeHigh == 0b111)
|
||||||
{
|
{
|
||||||
Size = modeLow != 0 ? op : 3;
|
|
||||||
|
|
||||||
switch (op | (modeLow << 1))
|
switch (op | (modeLow << 1))
|
||||||
{
|
{
|
||||||
case 0:
|
case 0:
|
||||||
// 64-bits Immediate.
|
// 64-bits Immediate.
|
||||||
// Transform abcd efgh into abcd efgh abcd efgh ...
|
// Transform abcd efgh into abcd efgh abcd efgh ...
|
||||||
|
Size = 3;
|
||||||
imm = (long)((ulong)imm * 0x0101010101010101);
|
imm = (long)((ulong)imm * 0x0101010101010101);
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case 1:
|
case 1:
|
||||||
// 64-bits Immediate.
|
// 64-bits Immediate.
|
||||||
// Transform abcd efgh into aaaa aaaa bbbb bbbb ...
|
// Transform abcd efgh into aaaa aaaa bbbb bbbb ...
|
||||||
|
Size = 3;
|
||||||
imm = (imm & 0xf0) >> 4 | (imm & 0x0f) << 4;
|
imm = (imm & 0xf0) >> 4 | (imm & 0x0f) << 4;
|
||||||
imm = (imm & 0xcc) >> 2 | (imm & 0x33) << 2;
|
imm = (imm & 0xcc) >> 2 | (imm & 0x33) << 2;
|
||||||
imm = (imm & 0xaa) >> 1 | (imm & 0x55) << 1;
|
imm = (imm & 0xaa) >> 1 | (imm & 0x55) << 1;
|
||||||
|
@ -49,9 +49,16 @@ namespace ARMeilleure.Decoders
|
||||||
break;
|
break;
|
||||||
|
|
||||||
case 2:
|
case 2:
|
||||||
|
// 2 x 32-bits floating point Immediate.
|
||||||
|
Size = 0;
|
||||||
|
imm = (long)DecoderHelper.Imm8ToFP32Table[(int)imm];
|
||||||
|
imm |= imm << 32;
|
||||||
|
break;
|
||||||
|
|
||||||
case 3:
|
case 3:
|
||||||
// Floating point Immediate.
|
// 64-bits floating point Immediate.
|
||||||
imm = DecoderHelper.DecodeImm8Float(imm, Size);
|
Size = 1;
|
||||||
|
imm = (long)DecoderHelper.Imm8ToFP64Table[(int)imm];
|
||||||
break;
|
break;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
@ -72,7 +79,7 @@ namespace ARMeilleure.Decoders
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
// 8 bits without shift.
|
// 8-bits without shift.
|
||||||
Size = 0;
|
Size = 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|
|
@ -268,7 +268,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (setCarry)
|
if (setCarry)
|
||||||
{
|
{
|
||||||
SetFlag(context, PState.CFlag, Const(0));;
|
SetFlag(context, PState.CFlag, Const(0));
|
||||||
}
|
}
|
||||||
|
|
||||||
return Const(0);
|
return Const(0);
|
||||||
|
|
|
@ -384,8 +384,7 @@ namespace ARMeilleure.Instructions
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
OperandType type = sizeF != 0 ? OperandType.FP64
|
OperandType type = sizeF != 0 ? OperandType.FP64 : OperandType.FP32;
|
||||||
: OperandType.FP32;
|
|
||||||
|
|
||||||
Operand ne0 = context.VectorExtract(type, GetVec(op.Rn), 0);
|
Operand ne0 = context.VectorExtract(type, GetVec(op.Rn), 0);
|
||||||
Operand ne1 = context.VectorExtract(type, GetVec(op.Rn), 1);
|
Operand ne1 = context.VectorExtract(type, GetVec(op.Rn), 1);
|
||||||
|
@ -455,6 +454,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
||||||
|
|
||||||
|
Operand d = GetVec(op.Rd);
|
||||||
Operand a = GetVec(op.Ra);
|
Operand a = GetVec(op.Ra);
|
||||||
Operand n = GetVec(op.Rn);
|
Operand n = GetVec(op.Rn);
|
||||||
Operand m = GetVec(op.Rm);
|
Operand m = GetVec(op.Rm);
|
||||||
|
@ -462,18 +462,16 @@ namespace ARMeilleure.Instructions
|
||||||
if (op.Size == 0)
|
if (op.Size == 0)
|
||||||
{
|
{
|
||||||
Operand res = context.AddIntrinsic(Intrinsic.X86Mulss, n, m);
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulss, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Addss, a, res);
|
||||||
|
|
||||||
res = context.AddIntrinsic(Intrinsic.X86Addss, a, res);
|
context.Copy(d, context.VectorZeroUpper96(res));
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), context.VectorZeroUpper96(res));
|
|
||||||
}
|
}
|
||||||
else /* if (op.Size == 1) */
|
else /* if (op.Size == 1) */
|
||||||
{
|
{
|
||||||
Operand res = context.AddIntrinsic(Intrinsic.X86Mulsd, n, m);
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulsd, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Addsd, a, res);
|
||||||
|
|
||||||
res = context.AddIntrinsic(Intrinsic.X86Addsd, a, res);
|
context.Copy(d, context.VectorZeroUpper64(res));
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), context.VectorZeroUpper64(res));
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
|
@ -517,18 +515,32 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
public static void Fmaxnm_S(ArmEmitterContext context)
|
public static void Fmaxnm_S(ArmEmitterContext context)
|
||||||
{
|
{
|
||||||
EmitScalarBinaryOpF(context, (op1, op2) =>
|
if (Optimizations.FastFP && Optimizations.UseSse41)
|
||||||
{
|
{
|
||||||
return EmitSoftFloatCall(context, SoftFloat32.FPMaxNum, SoftFloat64.FPMaxNum, op1, op2);
|
EmitSse41MaxMinNumOpF(context, isMaxNum: true, scalar: true);
|
||||||
});
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
EmitScalarBinaryOpF(context, (op1, op2) =>
|
||||||
|
{
|
||||||
|
return EmitSoftFloatCall(context, SoftFloat32.FPMaxNum, SoftFloat64.FPMaxNum, op1, op2);
|
||||||
|
});
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Fmaxnm_V(ArmEmitterContext context)
|
public static void Fmaxnm_V(ArmEmitterContext context)
|
||||||
{
|
{
|
||||||
EmitVectorBinaryOpF(context, (op1, op2) =>
|
if (Optimizations.FastFP && Optimizations.UseSse41)
|
||||||
{
|
{
|
||||||
return EmitSoftFloatCall(context, SoftFloat32.FPMaxNum, SoftFloat64.FPMaxNum, op1, op2);
|
EmitSse41MaxMinNumOpF(context, isMaxNum: true, scalar: false);
|
||||||
});
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
EmitVectorBinaryOpF(context, (op1, op2) =>
|
||||||
|
{
|
||||||
|
return EmitSoftFloatCall(context, SoftFloat32.FPMaxNum, SoftFloat64.FPMaxNum, op1, op2);
|
||||||
|
});
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Fmaxp_V(ArmEmitterContext context)
|
public static void Fmaxp_V(ArmEmitterContext context)
|
||||||
|
@ -578,18 +590,32 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
public static void Fminnm_S(ArmEmitterContext context)
|
public static void Fminnm_S(ArmEmitterContext context)
|
||||||
{
|
{
|
||||||
EmitScalarBinaryOpF(context, (op1, op2) =>
|
if (Optimizations.FastFP && Optimizations.UseSse41)
|
||||||
{
|
{
|
||||||
return EmitSoftFloatCall(context, SoftFloat32.FPMinNum, SoftFloat64.FPMinNum, op1, op2);
|
EmitSse41MaxMinNumOpF(context, isMaxNum: false, scalar: true);
|
||||||
});
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
EmitScalarBinaryOpF(context, (op1, op2) =>
|
||||||
|
{
|
||||||
|
return EmitSoftFloatCall(context, SoftFloat32.FPMinNum, SoftFloat64.FPMinNum, op1, op2);
|
||||||
|
});
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Fminnm_V(ArmEmitterContext context)
|
public static void Fminnm_V(ArmEmitterContext context)
|
||||||
{
|
{
|
||||||
EmitVectorBinaryOpF(context, (op1, op2) =>
|
if (Optimizations.FastFP && Optimizations.UseSse41)
|
||||||
{
|
{
|
||||||
return EmitSoftFloatCall(context, SoftFloat32.FPMinNum, SoftFloat64.FPMinNum, op1, op2);
|
EmitSse41MaxMinNumOpF(context, isMaxNum: false, scalar: false);
|
||||||
});
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
EmitVectorBinaryOpF(context, (op1, op2) =>
|
||||||
|
{
|
||||||
|
return EmitSoftFloatCall(context, SoftFloat32.FPMinNum, SoftFloat64.FPMinNum, op1, op2);
|
||||||
|
});
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Fminp_V(ArmEmitterContext context)
|
public static void Fminp_V(ArmEmitterContext context)
|
||||||
|
@ -813,6 +839,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
||||||
|
|
||||||
|
Operand d = GetVec(op.Rd);
|
||||||
Operand a = GetVec(op.Ra);
|
Operand a = GetVec(op.Ra);
|
||||||
Operand n = GetVec(op.Rn);
|
Operand n = GetVec(op.Rn);
|
||||||
Operand m = GetVec(op.Rm);
|
Operand m = GetVec(op.Rm);
|
||||||
|
@ -820,18 +847,16 @@ namespace ARMeilleure.Instructions
|
||||||
if (op.Size == 0)
|
if (op.Size == 0)
|
||||||
{
|
{
|
||||||
Operand res = context.AddIntrinsic(Intrinsic.X86Mulss, n, m);
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulss, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Subss, a, res);
|
||||||
|
|
||||||
res = context.AddIntrinsic(Intrinsic.X86Subss, a, res);
|
context.Copy(d, context.VectorZeroUpper96(res));
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), context.VectorZeroUpper96(res));
|
|
||||||
}
|
}
|
||||||
else /* if (op.Size == 1) */
|
else /* if (op.Size == 1) */
|
||||||
{
|
{
|
||||||
Operand res = context.AddIntrinsic(Intrinsic.X86Mulsd, n, m);
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulsd, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Subsd, a, res);
|
||||||
|
|
||||||
res = context.AddIntrinsic(Intrinsic.X86Subsd, a, res);
|
context.Copy(d, context.VectorZeroUpper64(res));
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), context.VectorZeroUpper64(res));
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
|
@ -1035,36 +1060,88 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
public static void Fnmadd_S(ArmEmitterContext context) // Fused.
|
public static void Fnmadd_S(ArmEmitterContext context) // Fused.
|
||||||
{
|
{
|
||||||
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
|
{
|
||||||
|
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
||||||
|
|
||||||
int sizeF = op.Size & 1;
|
Operand d = GetVec(op.Rd);
|
||||||
|
Operand a = GetVec(op.Ra);
|
||||||
|
Operand n = GetVec(op.Rn);
|
||||||
|
Operand m = GetVec(op.Rm);
|
||||||
|
|
||||||
OperandType type = sizeF != 0 ? OperandType.FP64 : OperandType.FP32;
|
if (op.Size == 0)
|
||||||
|
{
|
||||||
|
Operand mask = X86GetScalar(context, -0f);
|
||||||
|
|
||||||
Operand ne = context.VectorExtract(type, GetVec(op.Rn), 0);
|
Operand aNeg = context.AddIntrinsic(Intrinsic.X86Xorps, mask, a);
|
||||||
Operand me = context.VectorExtract(type, GetVec(op.Rm), 0);
|
|
||||||
Operand ae = context.VectorExtract(type, GetVec(op.Ra), 0);
|
|
||||||
|
|
||||||
Operand res = context.Subtract(context.Multiply(context.Negate(ne), me), ae);
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulss, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Subss, aNeg, res);
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), context.VectorInsert(context.VectorZero(), res, 0));
|
context.Copy(d, context.VectorZeroUpper96(res));
|
||||||
|
}
|
||||||
|
else /* if (op.Size == 1) */
|
||||||
|
{
|
||||||
|
Operand mask = X86GetScalar(context, -0d);
|
||||||
|
|
||||||
|
Operand aNeg = context.AddIntrinsic(Intrinsic.X86Xorpd, mask, a);
|
||||||
|
|
||||||
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulsd, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Subsd, aNeg, res);
|
||||||
|
|
||||||
|
context.Copy(d, context.VectorZeroUpper64(res));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
EmitScalarTernaryRaOpF(context, (op1, op2, op3) =>
|
||||||
|
{
|
||||||
|
return EmitSoftFloatCall(context, SoftFloat32.FPNegMulAdd, SoftFloat64.FPNegMulAdd, op1, op2, op3);
|
||||||
|
});
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Fnmsub_S(ArmEmitterContext context) // Fused.
|
public static void Fnmsub_S(ArmEmitterContext context) // Fused.
|
||||||
{
|
{
|
||||||
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
|
{
|
||||||
|
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
||||||
|
|
||||||
int sizeF = op.Size & 1;
|
Operand d = GetVec(op.Rd);
|
||||||
|
Operand a = GetVec(op.Ra);
|
||||||
|
Operand n = GetVec(op.Rn);
|
||||||
|
Operand m = GetVec(op.Rm);
|
||||||
|
|
||||||
OperandType type = sizeF != 0 ? OperandType.FP64 : OperandType.FP32;
|
if (op.Size == 0)
|
||||||
|
{
|
||||||
|
Operand mask = X86GetScalar(context, -0f);
|
||||||
|
|
||||||
Operand ne = context.VectorExtract(type, GetVec(op.Rn), 0);
|
Operand aNeg = context.AddIntrinsic(Intrinsic.X86Xorps, mask, a);
|
||||||
Operand me = context.VectorExtract(type, GetVec(op.Rm), 0);
|
|
||||||
Operand ae = context.VectorExtract(type, GetVec(op.Ra), 0);
|
|
||||||
|
|
||||||
Operand res = context.Subtract(context.Multiply(ne, me), ae);
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulss, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Addss, aNeg, res);
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), context.VectorInsert(context.VectorZero(), res, 0));
|
context.Copy(d, context.VectorZeroUpper96(res));
|
||||||
|
}
|
||||||
|
else /* if (op.Size == 1) */
|
||||||
|
{
|
||||||
|
Operand mask = X86GetScalar(context, -0d);
|
||||||
|
|
||||||
|
Operand aNeg = context.AddIntrinsic(Intrinsic.X86Xorpd, mask, a);
|
||||||
|
|
||||||
|
Operand res = context.AddIntrinsic(Intrinsic.X86Mulsd, n, m);
|
||||||
|
res = context.AddIntrinsic(Intrinsic.X86Addsd, aNeg, res);
|
||||||
|
|
||||||
|
context.Copy(d, context.VectorZeroUpper64(res));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
EmitScalarTernaryRaOpF(context, (op1, op2, op3) =>
|
||||||
|
{
|
||||||
|
return EmitSoftFloatCall(context, SoftFloat32.FPNegMulSub, SoftFloat64.FPNegMulSub, op1, op2, op3);
|
||||||
|
});
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Fnmul_S(ArmEmitterContext context)
|
public static void Fnmul_S(ArmEmitterContext context)
|
||||||
|
@ -2067,9 +2144,7 @@ namespace ARMeilleure.Instructions
|
||||||
m = context.AddIntrinsic(Intrinsic.X86Psrldq, m, Const(8));
|
m = context.AddIntrinsic(Intrinsic.X86Psrldq, m, Const(8));
|
||||||
}
|
}
|
||||||
|
|
||||||
Intrinsic movInst = op.Size == 0
|
Intrinsic movInst = op.Size == 0 ? Intrinsic.X86Pmovsxbw : Intrinsic.X86Pmovsxwd;
|
||||||
? Intrinsic.X86Pmovsxbw
|
|
||||||
: Intrinsic.X86Pmovsxwd;
|
|
||||||
|
|
||||||
n = context.AddIntrinsic(movInst, n);
|
n = context.AddIntrinsic(movInst, n);
|
||||||
m = context.AddIntrinsic(movInst, m);
|
m = context.AddIntrinsic(movInst, m);
|
||||||
|
@ -2694,9 +2769,7 @@ namespace ARMeilleure.Instructions
|
||||||
m = context.AddIntrinsic(Intrinsic.X86Psrldq, m, Const(8));
|
m = context.AddIntrinsic(Intrinsic.X86Psrldq, m, Const(8));
|
||||||
}
|
}
|
||||||
|
|
||||||
Intrinsic movInst = op.Size == 0
|
Intrinsic movInst = op.Size == 0 ? Intrinsic.X86Pmovzxbw : Intrinsic.X86Pmovzxwd;
|
||||||
? Intrinsic.X86Pmovzxbw
|
|
||||||
: Intrinsic.X86Pmovzxwd;
|
|
||||||
|
|
||||||
n = context.AddIntrinsic(movInst, n);
|
n = context.AddIntrinsic(movInst, n);
|
||||||
m = context.AddIntrinsic(movInst, m);
|
m = context.AddIntrinsic(movInst, m);
|
||||||
|
@ -3011,6 +3084,98 @@ namespace ARMeilleure.Instructions
|
||||||
context.Copy(GetVec(op.Rd), res);
|
context.Copy(GetVec(op.Rd), res);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private static Operand EmitSse2VectorIsQNaNOpF(ArmEmitterContext context, Operand opF)
|
||||||
|
{
|
||||||
|
IOpCodeSimd op = (IOpCodeSimd)context.CurrOp;
|
||||||
|
|
||||||
|
if ((op.Size & 1) == 0)
|
||||||
|
{
|
||||||
|
const int QBit = 22;
|
||||||
|
|
||||||
|
Operand qMask = X86GetAllElements(context, 1 << QBit);
|
||||||
|
|
||||||
|
Operand mask1 = context.AddIntrinsic(Intrinsic.X86Cmpps, opF, opF, Const((int)CmpCondition.UnorderedQ));
|
||||||
|
|
||||||
|
Operand mask2 = context.AddIntrinsic(Intrinsic.X86Pand, opF, qMask);
|
||||||
|
mask2 = context.AddIntrinsic(Intrinsic.X86Cmpps, mask2, qMask, Const((int)CmpCondition.Equal));
|
||||||
|
|
||||||
|
return context.AddIntrinsic(Intrinsic.X86Andps, mask1, mask2);
|
||||||
|
}
|
||||||
|
else /* if ((op.Size & 1) == 1) */
|
||||||
|
{
|
||||||
|
const int QBit = 51;
|
||||||
|
|
||||||
|
Operand qMask = X86GetAllElements(context, 1L << QBit);
|
||||||
|
|
||||||
|
Operand mask1 = context.AddIntrinsic(Intrinsic.X86Cmppd, opF, opF, Const((int)CmpCondition.UnorderedQ));
|
||||||
|
|
||||||
|
Operand mask2 = context.AddIntrinsic(Intrinsic.X86Pand, opF, qMask);
|
||||||
|
mask2 = context.AddIntrinsic(Intrinsic.X86Cmppd, mask2, qMask, Const((int)CmpCondition.Equal));
|
||||||
|
|
||||||
|
return context.AddIntrinsic(Intrinsic.X86Andpd, mask1, mask2);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void EmitSse41MaxMinNumOpF(ArmEmitterContext context, bool isMaxNum, bool scalar)
|
||||||
|
{
|
||||||
|
OpCodeSimdReg op = (OpCodeSimdReg)context.CurrOp;
|
||||||
|
|
||||||
|
Operand d = GetVec(op.Rd);
|
||||||
|
Operand n = GetVec(op.Rn);
|
||||||
|
Operand m = GetVec(op.Rm);
|
||||||
|
|
||||||
|
Operand nQNaNMask = EmitSse2VectorIsQNaNOpF(context, n);
|
||||||
|
Operand mQNaNMask = EmitSse2VectorIsQNaNOpF(context, m);
|
||||||
|
|
||||||
|
Operand nNum = context.Copy(n);
|
||||||
|
Operand mNum = context.Copy(m);
|
||||||
|
|
||||||
|
int sizeF = op.Size & 1;
|
||||||
|
|
||||||
|
if (sizeF == 0)
|
||||||
|
{
|
||||||
|
Operand negInfMask = X86GetAllElements(context, isMaxNum ? float.NegativeInfinity : float.PositiveInfinity);
|
||||||
|
|
||||||
|
Operand nMask = context.AddIntrinsic(Intrinsic.X86Andnps, mQNaNMask, nQNaNMask);
|
||||||
|
Operand mMask = context.AddIntrinsic(Intrinsic.X86Andnps, nQNaNMask, mQNaNMask);
|
||||||
|
|
||||||
|
nNum = context.AddIntrinsic(Intrinsic.X86Blendvps, nNum, negInfMask, nMask);
|
||||||
|
mNum = context.AddIntrinsic(Intrinsic.X86Blendvps, mNum, negInfMask, mMask);
|
||||||
|
|
||||||
|
Operand res = context.AddIntrinsic(isMaxNum ? Intrinsic.X86Maxps : Intrinsic.X86Minps, nNum, mNum);
|
||||||
|
|
||||||
|
if (scalar)
|
||||||
|
{
|
||||||
|
res = context.VectorZeroUpper96(res);
|
||||||
|
}
|
||||||
|
else if (op.RegisterSize == RegisterSize.Simd64)
|
||||||
|
{
|
||||||
|
res = context.VectorZeroUpper64(res);
|
||||||
|
}
|
||||||
|
|
||||||
|
context.Copy(d, res);
|
||||||
|
}
|
||||||
|
else /* if (sizeF == 1) */
|
||||||
|
{
|
||||||
|
Operand negInfMask = X86GetAllElements(context, isMaxNum ? double.NegativeInfinity : double.PositiveInfinity);
|
||||||
|
|
||||||
|
Operand nMask = context.AddIntrinsic(Intrinsic.X86Andnpd, mQNaNMask, nQNaNMask);
|
||||||
|
Operand mMask = context.AddIntrinsic(Intrinsic.X86Andnpd, nQNaNMask, mQNaNMask);
|
||||||
|
|
||||||
|
nNum = context.AddIntrinsic(Intrinsic.X86Blendvpd, nNum, negInfMask, nMask);
|
||||||
|
mNum = context.AddIntrinsic(Intrinsic.X86Blendvpd, mNum, negInfMask, mMask);
|
||||||
|
|
||||||
|
Operand res = context.AddIntrinsic(isMaxNum ? Intrinsic.X86Maxpd : Intrinsic.X86Minpd, nNum, mNum);
|
||||||
|
|
||||||
|
if (scalar)
|
||||||
|
{
|
||||||
|
res = context.VectorZeroUpper64(res);
|
||||||
|
}
|
||||||
|
|
||||||
|
context.Copy(d, res);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
private enum AddSub
|
private enum AddSub
|
||||||
{
|
{
|
||||||
None,
|
None,
|
||||||
|
|
|
@ -300,7 +300,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseSse2)
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.Equal, scalar: true);
|
EmitSse2CmpOpF(context, CmpCondition.Equal, scalar: true);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -312,7 +312,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseSse2)
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.Equal, scalar: false);
|
EmitSse2CmpOpF(context, CmpCondition.Equal, scalar: false);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -324,7 +324,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseAvx)
|
if (Optimizations.FastFP && Optimizations.UseAvx)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.GreaterThanOrEqual, scalar: true);
|
EmitSse2CmpOpF(context, CmpCondition.GreaterThanOrEqual, scalar: true);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -336,7 +336,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseAvx)
|
if (Optimizations.FastFP && Optimizations.UseAvx)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.GreaterThanOrEqual, scalar: false);
|
EmitSse2CmpOpF(context, CmpCondition.GreaterThanOrEqual, scalar: false);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -348,7 +348,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseAvx)
|
if (Optimizations.FastFP && Optimizations.UseAvx)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.GreaterThan, scalar: true);
|
EmitSse2CmpOpF(context, CmpCondition.GreaterThan, scalar: true);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -360,7 +360,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseAvx)
|
if (Optimizations.FastFP && Optimizations.UseAvx)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.GreaterThan, scalar: false);
|
EmitSse2CmpOpF(context, CmpCondition.GreaterThan, scalar: false);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -372,7 +372,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseSse2)
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.LessThanOrEqual, scalar: true);
|
EmitSse2CmpOpF(context, CmpCondition.LessThanOrEqual, scalar: true);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -384,7 +384,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseSse2)
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.LessThanOrEqual, scalar: false);
|
EmitSse2CmpOpF(context, CmpCondition.LessThanOrEqual, scalar: false);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -396,7 +396,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseSse2)
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.LessThan, scalar: true);
|
EmitSse2CmpOpF(context, CmpCondition.LessThan, scalar: true);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -408,7 +408,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.FastFP && Optimizations.UseSse2)
|
if (Optimizations.FastFP && Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitCmpSseOrSse2OpF(context, CmpCondition.LessThan, scalar: false);
|
EmitSse2CmpOpF(context, CmpCondition.LessThan, scalar: false);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -673,7 +673,7 @@ namespace ARMeilleure.Instructions
|
||||||
context.Copy(GetVec(op.Rd), res);
|
context.Copy(GetVec(op.Rd), res);
|
||||||
}
|
}
|
||||||
|
|
||||||
private static void EmitCmpSseOrSse2OpF(ArmEmitterContext context, CmpCondition cond, bool scalar)
|
private static void EmitSse2CmpOpF(ArmEmitterContext context, CmpCondition cond, bool scalar)
|
||||||
{
|
{
|
||||||
OpCodeSimd op = (OpCodeSimd)context.CurrOp;
|
OpCodeSimd op = (OpCodeSimd)context.CurrOp;
|
||||||
|
|
||||||
|
|
|
@ -907,7 +907,7 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
Operand res = context.VectorZero();
|
Operand res = context.VectorZero();
|
||||||
|
|
||||||
Operand me = EmitVectorExtract(context, op.Rm, op.Index, op.Size, signed);;
|
Operand me = EmitVectorExtract(context, op.Rm, op.Index, op.Size, signed);
|
||||||
|
|
||||||
int elems = 8 >> op.Size;
|
int elems = 8 >> op.Size;
|
||||||
|
|
||||||
|
@ -939,7 +939,7 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
Operand res = context.VectorZero();
|
Operand res = context.VectorZero();
|
||||||
|
|
||||||
Operand me = EmitVectorExtract(context, op.Rm, op.Index, op.Size, signed);;
|
Operand me = EmitVectorExtract(context, op.Rm, op.Index, op.Size, signed);
|
||||||
|
|
||||||
int elems = 8 >> op.Size;
|
int elems = 8 >> op.Size;
|
||||||
|
|
||||||
|
@ -1114,6 +1114,7 @@ namespace ARMeilleure.Instructions
|
||||||
Equal = 0, // Ordered, non-signaling.
|
Equal = 0, // Ordered, non-signaling.
|
||||||
LessThan = 1, // Ordered, signaling.
|
LessThan = 1, // Ordered, signaling.
|
||||||
LessThanOrEqual = 2, // Ordered, signaling.
|
LessThanOrEqual = 2, // Ordered, signaling.
|
||||||
|
UnorderedQ = 3, // Non-signaling.
|
||||||
NotLessThan = 5, // Unordered, signaling.
|
NotLessThan = 5, // Unordered, signaling.
|
||||||
NotLessThanOrEqual = 6, // Unordered, signaling.
|
NotLessThanOrEqual = 6, // Unordered, signaling.
|
||||||
OrderedQ = 7, // Non-signaling.
|
OrderedQ = 7, // Non-signaling.
|
||||||
|
|
|
@ -177,7 +177,7 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
if (op.RegisterSize == RegisterSize.Simd64)
|
if (op.RegisterSize == RegisterSize.Simd64)
|
||||||
{
|
{
|
||||||
nShifted = context.AddIntrinsic(Intrinsic.X86Movlhps, nShifted, context.VectorZero());
|
nShifted = context.VectorZeroUpper64(nShifted);
|
||||||
}
|
}
|
||||||
|
|
||||||
nShifted = context.AddIntrinsic(Intrinsic.X86Psrldq, nShifted, Const(op.Imm4));
|
nShifted = context.AddIntrinsic(Intrinsic.X86Psrldq, nShifted, Const(op.Imm4));
|
||||||
|
@ -188,7 +188,7 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
if (op.RegisterSize == RegisterSize.Simd64)
|
if (op.RegisterSize == RegisterSize.Simd64)
|
||||||
{
|
{
|
||||||
mShifted = context.AddIntrinsic(Intrinsic.X86Movlhps, mShifted, context.VectorZero());
|
mShifted = context.VectorZeroUpper64(mShifted);
|
||||||
}
|
}
|
||||||
|
|
||||||
Operand res = context.AddIntrinsic(Intrinsic.X86Por, nShifted, mShifted);
|
Operand res = context.AddIntrinsic(Intrinsic.X86Por, nShifted, mShifted);
|
||||||
|
@ -277,9 +277,10 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
OpCodeSimd op = (OpCodeSimd)context.CurrOp;
|
OpCodeSimd op = (OpCodeSimd)context.CurrOp;
|
||||||
|
|
||||||
|
Operand d = GetVec(op.Rd);
|
||||||
Operand n = GetIntOrZR(context, op.Rn);
|
Operand n = GetIntOrZR(context, op.Rn);
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), EmitVectorInsert(context, GetVec(op.Rd), n, 1, 3));
|
context.Copy(d, EmitVectorInsert(context, d, n, 1, 3));
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Fmov_S(ArmEmitterContext context)
|
public static void Fmov_S(ArmEmitterContext context)
|
||||||
|
@ -311,18 +312,32 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
OpCodeSimdImm op = (OpCodeSimdImm)context.CurrOp;
|
OpCodeSimdImm op = (OpCodeSimdImm)context.CurrOp;
|
||||||
|
|
||||||
Operand e = Const(op.Immediate);
|
if (Optimizations.UseSse2)
|
||||||
|
|
||||||
Operand res = context.VectorZero();
|
|
||||||
|
|
||||||
int elems = op.RegisterSize == RegisterSize.Simd128 ? 4 : 2;
|
|
||||||
|
|
||||||
for (int index = 0; index < (elems >> op.Size); index++)
|
|
||||||
{
|
{
|
||||||
res = EmitVectorInsert(context, res, e, index, op.Size + 2);
|
if (op.RegisterSize == RegisterSize.Simd128)
|
||||||
|
{
|
||||||
|
context.Copy(GetVec(op.Rd), X86GetAllElements(context, op.Immediate));
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
context.Copy(GetVec(op.Rd), X86GetScalar(context, op.Immediate));
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
Operand e = Const(op.Immediate);
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), res);
|
Operand res = context.VectorZero();
|
||||||
|
|
||||||
|
int elems = op.RegisterSize == RegisterSize.Simd128 ? 2 : 1;
|
||||||
|
|
||||||
|
for (int index = 0; index < elems; index++)
|
||||||
|
{
|
||||||
|
res = EmitVectorInsert(context, res, e, index, 3);
|
||||||
|
}
|
||||||
|
|
||||||
|
context.Copy(GetVec(op.Rd), res);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void Ins_Gp(ArmEmitterContext context)
|
public static void Ins_Gp(ArmEmitterContext context)
|
||||||
|
@ -349,7 +364,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.UseSse2)
|
if (Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitMoviMvni(context, not: false);
|
EmitSse2MoviMvni(context, not: false);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -361,7 +376,7 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
if (Optimizations.UseSse2)
|
if (Optimizations.UseSse2)
|
||||||
{
|
{
|
||||||
EmitMoviMvni(context, not: true);
|
EmitSse2MoviMvni(context, not: true);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -430,13 +445,11 @@ namespace ARMeilleure.Instructions
|
||||||
{
|
{
|
||||||
Operand d = GetVec(op.Rd);
|
Operand d = GetVec(op.Rd);
|
||||||
|
|
||||||
Operand res = context.AddIntrinsic(Intrinsic.X86Movlhps, d, context.VectorZero());
|
Operand res = context.VectorZeroUpper64(d);
|
||||||
|
|
||||||
Operand n = GetVec(op.Rn);
|
|
||||||
|
|
||||||
Operand mask = X86GetAllElements(context, _masksE0_TrnUzpXtn[op.Size]);
|
Operand mask = X86GetAllElements(context, _masksE0_TrnUzpXtn[op.Size]);
|
||||||
|
|
||||||
Operand res2 = context.AddIntrinsic(Intrinsic.X86Pshufb, n, mask);
|
Operand res2 = context.AddIntrinsic(Intrinsic.X86Pshufb, GetVec(op.Rn), mask);
|
||||||
|
|
||||||
Intrinsic movInst = op.RegisterSize == RegisterSize.Simd128
|
Intrinsic movInst = op.RegisterSize == RegisterSize.Simd128
|
||||||
? Intrinsic.X86Movlhps
|
? Intrinsic.X86Movlhps
|
||||||
|
@ -444,7 +457,7 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
res = context.AddIntrinsic(movInst, res, res2);
|
res = context.AddIntrinsic(movInst, res, res2);
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), res);
|
context.Copy(d, res);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
|
@ -452,7 +465,9 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
int part = op.RegisterSize == RegisterSize.Simd128 ? elems : 0;
|
int part = op.RegisterSize == RegisterSize.Simd128 ? elems : 0;
|
||||||
|
|
||||||
Operand res = part == 0 ? context.VectorZero() : context.Copy(GetVec(op.Rd));
|
Operand d = GetVec(op.Rd);
|
||||||
|
|
||||||
|
Operand res = part == 0 ? context.VectorZero() : context.Copy(d);
|
||||||
|
|
||||||
for (int index = 0; index < elems; index++)
|
for (int index = 0; index < elems; index++)
|
||||||
{
|
{
|
||||||
|
@ -461,7 +476,7 @@ namespace ARMeilleure.Instructions
|
||||||
res = EmitVectorInsert(context, res, ne, part + index, op.Size);
|
res = EmitVectorInsert(context, res, ne, part + index, op.Size);
|
||||||
}
|
}
|
||||||
|
|
||||||
context.Copy(GetVec(op.Rd), res);
|
context.Copy(d, res);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -475,7 +490,7 @@ namespace ARMeilleure.Instructions
|
||||||
EmitVectorZip(context, part: 1);
|
EmitVectorZip(context, part: 1);
|
||||||
}
|
}
|
||||||
|
|
||||||
private static void EmitMoviMvni(ArmEmitterContext context, bool not)
|
private static void EmitSse2MoviMvni(ArmEmitterContext context, bool not)
|
||||||
{
|
{
|
||||||
OpCodeSimdImm op = (OpCodeSimdImm)context.CurrOp;
|
OpCodeSimdImm op = (OpCodeSimdImm)context.CurrOp;
|
||||||
|
|
||||||
|
|
|
@ -1089,8 +1089,6 @@ namespace ARMeilleure.Instructions
|
||||||
|
|
||||||
public static float FPMulSub(float valueA, float value1, float value2)
|
public static float FPMulSub(float valueA, float value1, float value2)
|
||||||
{
|
{
|
||||||
ExecutionContext context = NativeInterface.GetContext();
|
|
||||||
|
|
||||||
value1 = value1.FPNeg();
|
value1 = value1.FPNeg();
|
||||||
|
|
||||||
return FPMulAdd(valueA, value1, value2);
|
return FPMulAdd(valueA, value1, value2);
|
||||||
|
@ -1138,6 +1136,21 @@ namespace ARMeilleure.Instructions
|
||||||
return result;
|
return result;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public static float FPNegMulAdd(float valueA, float value1, float value2)
|
||||||
|
{
|
||||||
|
valueA = valueA.FPNeg();
|
||||||
|
value1 = value1.FPNeg();
|
||||||
|
|
||||||
|
return FPMulAdd(valueA, value1, value2);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static float FPNegMulSub(float valueA, float value1, float value2)
|
||||||
|
{
|
||||||
|
valueA = valueA.FPNeg();
|
||||||
|
|
||||||
|
return FPMulAdd(valueA, value1, value2);
|
||||||
|
}
|
||||||
|
|
||||||
public static float FPRecipEstimate(float value)
|
public static float FPRecipEstimate(float value)
|
||||||
{
|
{
|
||||||
ExecutionContext context = NativeInterface.GetContext();
|
ExecutionContext context = NativeInterface.GetContext();
|
||||||
|
@ -2196,6 +2209,21 @@ namespace ARMeilleure.Instructions
|
||||||
return result;
|
return result;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public static double FPNegMulAdd(double valueA, double value1, double value2)
|
||||||
|
{
|
||||||
|
valueA = valueA.FPNeg();
|
||||||
|
value1 = value1.FPNeg();
|
||||||
|
|
||||||
|
return FPMulAdd(valueA, value1, value2);
|
||||||
|
}
|
||||||
|
|
||||||
|
public static double FPNegMulSub(double valueA, double value1, double value2)
|
||||||
|
{
|
||||||
|
valueA = valueA.FPNeg();
|
||||||
|
|
||||||
|
return FPMulAdd(valueA, value1, value2);
|
||||||
|
}
|
||||||
|
|
||||||
public static double FPRecipEstimate(double value)
|
public static double FPRecipEstimate(double value)
|
||||||
{
|
{
|
||||||
ExecutionContext context = NativeInterface.GetContext();
|
ExecutionContext context = NativeInterface.GetContext();
|
||||||
|
|
|
@ -8,6 +8,10 @@ namespace ARMeilleure.IntermediateRepresentation
|
||||||
X86Addss,
|
X86Addss,
|
||||||
X86Andnpd,
|
X86Andnpd,
|
||||||
X86Andnps,
|
X86Andnps,
|
||||||
|
X86Andpd,
|
||||||
|
X86Andps,
|
||||||
|
X86Blendvpd,
|
||||||
|
X86Blendvps,
|
||||||
X86Cmppd,
|
X86Cmppd,
|
||||||
X86Cmpps,
|
X86Cmpps,
|
||||||
X86Cmpsd,
|
X86Cmpsd,
|
||||||
|
|
|
@ -1,30 +1,22 @@
|
||||||
using JsonPrettyPrinterPlus;
|
using JsonPrettyPrinterPlus;
|
||||||
using LibHac.FsSystem;
|
|
||||||
using OpenTK.Input;
|
|
||||||
using Ryujinx.Common;
|
|
||||||
using Ryujinx.Common.Logging;
|
using Ryujinx.Common.Logging;
|
||||||
using Ryujinx.HLE;
|
|
||||||
using Ryujinx.HLE.HOS.SystemState;
|
|
||||||
using Ryujinx.HLE.HOS.Services;
|
|
||||||
using Ryujinx.HLE.Input;
|
|
||||||
using Ryujinx.Ui;
|
|
||||||
using Ryujinx.Ui.Input;
|
|
||||||
using System;
|
using System;
|
||||||
using System.Collections.Generic;
|
using System.Collections.Generic;
|
||||||
using System.IO;
|
using System.IO;
|
||||||
using System.Text;
|
using System.Text;
|
||||||
using System.Threading.Tasks;
|
|
||||||
using Utf8Json;
|
using Utf8Json;
|
||||||
using Utf8Json.Resolvers;
|
using Utf8Json.Resolvers;
|
||||||
|
using Ryujinx.Configuration.System;
|
||||||
|
using Ryujinx.Configuration.Hid;
|
||||||
|
using Ryujinx.Common.Configuration.Hid;
|
||||||
|
using Ryujinx.UI.Input;
|
||||||
|
using Ryujinx.Configuration.Ui;
|
||||||
|
|
||||||
namespace Ryujinx
|
namespace Ryujinx.Configuration
|
||||||
{
|
{
|
||||||
public class Configuration
|
public class ConfigurationFileFormat
|
||||||
{
|
{
|
||||||
/// <summary>
|
public int Version { get; set; }
|
||||||
/// The default configuration instance
|
|
||||||
/// </summary>
|
|
||||||
public static Configuration Instance { get; private set; }
|
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// Dumps shaders in this local directory
|
/// Dumps shaders in this local directory
|
||||||
|
@ -79,7 +71,7 @@ namespace Ryujinx
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// Change System Language
|
/// Change System Language
|
||||||
/// </summary>
|
/// </summary>
|
||||||
public SystemLanguage SystemLanguage { get; set; }
|
public Language SystemLanguage { get; set; }
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// Enables or disables Docked Mode
|
/// Enables or disables Docked Mode
|
||||||
|
@ -119,7 +111,7 @@ namespace Ryujinx
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// The primary controller's type
|
/// The primary controller's type
|
||||||
/// </summary>
|
/// </summary>
|
||||||
public ControllerStatus ControllerType { get; set; }
|
public ControllerType ControllerType { get; set; }
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// Used to toggle columns in the GUI
|
/// Used to toggle columns in the GUI
|
||||||
|
@ -154,13 +146,13 @@ namespace Ryujinx
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// Controller control bindings
|
/// Controller control bindings
|
||||||
/// </summary>
|
/// </summary>
|
||||||
public Ui.Input.NpadController JoystickControls { get; private set; }
|
public NpadController JoystickControls { get; set; }
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// Loads a configuration file from disk
|
/// Loads a configuration file from disk
|
||||||
/// </summary>
|
/// </summary>
|
||||||
/// <param name="path">The path to the JSON configuration file</param>
|
/// <param name="path">The path to the JSON configuration file</param>
|
||||||
public static void Load(string path)
|
public static ConfigurationFileFormat Load(string path)
|
||||||
{
|
{
|
||||||
var resolver = CompositeResolver.Create(
|
var resolver = CompositeResolver.Create(
|
||||||
new[] { new ConfigurationEnumFormatter<Key>() },
|
new[] { new ConfigurationEnumFormatter<Key>() },
|
||||||
|
@ -169,24 +161,7 @@ namespace Ryujinx
|
||||||
|
|
||||||
using (Stream stream = File.OpenRead(path))
|
using (Stream stream = File.OpenRead(path))
|
||||||
{
|
{
|
||||||
Instance = JsonSerializer.Deserialize<Configuration>(stream, resolver);
|
return JsonSerializer.Deserialize<ConfigurationFileFormat>(stream, resolver);
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Loads a configuration file asynchronously from disk
|
|
||||||
/// </summary>
|
|
||||||
/// <param name="path">The path to the JSON configuration file</param>
|
|
||||||
public static async Task LoadAsync(string path)
|
|
||||||
{
|
|
||||||
IJsonFormatterResolver resolver = CompositeResolver.Create(
|
|
||||||
new[] { new ConfigurationEnumFormatter<Key>() },
|
|
||||||
new[] { StandardResolver.AllowPrivateSnakeCase }
|
|
||||||
);
|
|
||||||
|
|
||||||
using (Stream stream = File.OpenRead(path))
|
|
||||||
{
|
|
||||||
Instance = await JsonSerializer.DeserializeAsync<Configuration>(stream, resolver);
|
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -194,108 +169,17 @@ namespace Ryujinx
|
||||||
/// Save a configuration file to disk
|
/// Save a configuration file to disk
|
||||||
/// </summary>
|
/// </summary>
|
||||||
/// <param name="path">The path to the JSON configuration file</param>
|
/// <param name="path">The path to the JSON configuration file</param>
|
||||||
public static void SaveConfig(Configuration config, string path)
|
public void SaveConfig(string path)
|
||||||
{
|
{
|
||||||
IJsonFormatterResolver resolver = CompositeResolver.Create(
|
IJsonFormatterResolver resolver = CompositeResolver.Create(
|
||||||
new[] { new ConfigurationEnumFormatter<Key>() },
|
new[] { new ConfigurationEnumFormatter<Key>() },
|
||||||
new[] { StandardResolver.AllowPrivateSnakeCase }
|
new[] { StandardResolver.AllowPrivateSnakeCase }
|
||||||
);
|
);
|
||||||
|
|
||||||
byte[] data = JsonSerializer.Serialize(config, resolver);
|
byte[] data = JsonSerializer.Serialize(this, resolver);
|
||||||
File.WriteAllText(path, Encoding.UTF8.GetString(data, 0, data.Length).PrettyPrintJson());
|
File.WriteAllText(path, Encoding.UTF8.GetString(data, 0, data.Length).PrettyPrintJson());
|
||||||
}
|
}
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Configures a <see cref="Switch"/> instance
|
|
||||||
/// </summary>
|
|
||||||
/// <param name="device">The instance to configure</param>
|
|
||||||
public static void InitialConfigure(Switch device)
|
|
||||||
{
|
|
||||||
if (Instance == null)
|
|
||||||
{
|
|
||||||
throw new InvalidOperationException("Configuration has not been loaded yet.");
|
|
||||||
}
|
|
||||||
|
|
||||||
SwitchSettings.ConfigureSettings(Instance);
|
|
||||||
|
|
||||||
Logger.AddTarget(new AsyncLogTargetWrapper(
|
|
||||||
new ConsoleLogTarget(),
|
|
||||||
1000,
|
|
||||||
AsyncLogTargetOverflowAction.Block
|
|
||||||
));
|
|
||||||
|
|
||||||
if (Instance.EnableFileLog)
|
|
||||||
{
|
|
||||||
Logger.AddTarget(new AsyncLogTargetWrapper(
|
|
||||||
new FileLogTarget(Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Ryujinx.log")),
|
|
||||||
1000,
|
|
||||||
AsyncLogTargetOverflowAction.Block
|
|
||||||
));
|
|
||||||
}
|
|
||||||
|
|
||||||
Configure(device, Instance);
|
|
||||||
}
|
|
||||||
|
|
||||||
public static void Configure(Switch device, Configuration SwitchConfig)
|
|
||||||
{
|
|
||||||
GraphicsConfig.ShadersDumpPath = SwitchConfig.GraphicsShadersDumpPath;
|
|
||||||
|
|
||||||
Logger.SetEnable(LogLevel.Debug, SwitchConfig.LoggingEnableDebug );
|
|
||||||
Logger.SetEnable(LogLevel.Stub, SwitchConfig.LoggingEnableStub );
|
|
||||||
Logger.SetEnable(LogLevel.Info, SwitchConfig.LoggingEnableInfo );
|
|
||||||
Logger.SetEnable(LogLevel.Warning, SwitchConfig.LoggingEnableWarn );
|
|
||||||
Logger.SetEnable(LogLevel.Error, SwitchConfig.LoggingEnableError );
|
|
||||||
Logger.SetEnable(LogLevel.Guest, SwitchConfig.LoggingEnableGuest );
|
|
||||||
Logger.SetEnable(LogLevel.AccessLog, SwitchConfig.LoggingEnableFsAccessLog);
|
|
||||||
|
|
||||||
if (SwitchConfig.LoggingFilteredClasses.Length > 0)
|
|
||||||
{
|
|
||||||
foreach (var logClass in EnumExtensions.GetValues<LogClass>())
|
|
||||||
{
|
|
||||||
Logger.SetEnable(logClass, false);
|
|
||||||
}
|
|
||||||
|
|
||||||
foreach (var logClass in SwitchConfig.LoggingFilteredClasses)
|
|
||||||
{
|
|
||||||
Logger.SetEnable(logClass, true);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
MainWindow.DiscordIntegrationEnabled = SwitchConfig.EnableDiscordIntegration;
|
|
||||||
|
|
||||||
device.EnableDeviceVsync = SwitchConfig.EnableVsync;
|
|
||||||
|
|
||||||
device.System.State.DockedMode = SwitchConfig.DockedMode;
|
|
||||||
|
|
||||||
device.System.State.SetLanguage(SwitchConfig.SystemLanguage);
|
|
||||||
|
|
||||||
if (SwitchConfig.EnableMulticoreScheduling)
|
|
||||||
{
|
|
||||||
device.System.EnableMultiCoreScheduling();
|
|
||||||
}
|
|
||||||
|
|
||||||
device.System.FsIntegrityCheckLevel = SwitchConfig.EnableFsIntegrityChecks
|
|
||||||
? IntegrityCheckLevel.ErrorOnInvalid
|
|
||||||
: IntegrityCheckLevel.None;
|
|
||||||
|
|
||||||
device.System.GlobalAccessLogMode = SwitchConfig.FsGlobalAccessLogMode;
|
|
||||||
|
|
||||||
ServiceConfiguration.IgnoreMissingServices = SwitchConfig.IgnoreMissingServices;
|
|
||||||
}
|
|
||||||
|
|
||||||
public static void ConfigureHid(Switch device, Configuration SwitchConfig)
|
|
||||||
{
|
|
||||||
if (SwitchConfig.JoystickControls.Enabled)
|
|
||||||
{
|
|
||||||
if (!Joystick.GetState(SwitchConfig.JoystickControls.Index).IsConnected)
|
|
||||||
{
|
|
||||||
SwitchConfig.JoystickControls.SetEnabled(false);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
device.Hid.InitializePrimaryController(SwitchConfig.ControllerType);
|
|
||||||
device.Hid.InitializeKeyboard();
|
|
||||||
}
|
|
||||||
|
|
||||||
private class ConfigurationEnumFormatter<T> : IJsonFormatter<T>
|
private class ConfigurationEnumFormatter<T> : IJsonFormatter<T>
|
||||||
where T : struct
|
where T : struct
|
||||||
{
|
{
|
502
Ryujinx.Common/Configuration/ConfigurationState.cs
Normal file
502
Ryujinx.Common/Configuration/ConfigurationState.cs
Normal file
|
@ -0,0 +1,502 @@
|
||||||
|
using Ryujinx.Common;
|
||||||
|
using Ryujinx.Common.Configuration.Hid;
|
||||||
|
using Ryujinx.Common.Logging;
|
||||||
|
using Ryujinx.Configuration.Hid;
|
||||||
|
using Ryujinx.Configuration.System;
|
||||||
|
using Ryujinx.Configuration.Ui;
|
||||||
|
using Ryujinx.UI.Input;
|
||||||
|
using System;
|
||||||
|
using System.Collections.Generic;
|
||||||
|
|
||||||
|
namespace Ryujinx.Configuration
|
||||||
|
{
|
||||||
|
public class ConfigurationState
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// UI configuration section
|
||||||
|
/// </summary>
|
||||||
|
public class UiSection
|
||||||
|
{
|
||||||
|
public class Columns
|
||||||
|
{
|
||||||
|
public ReactiveObject<bool> FavColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> IconColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> AppColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> DevColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> VersionColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> TimePlayedColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> LastPlayedColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> FileExtColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> FileSizeColumn { get; private set; }
|
||||||
|
public ReactiveObject<bool> PathColumn { get; private set; }
|
||||||
|
|
||||||
|
public Columns()
|
||||||
|
{
|
||||||
|
FavColumn = new ReactiveObject<bool>();
|
||||||
|
IconColumn = new ReactiveObject<bool>();
|
||||||
|
AppColumn = new ReactiveObject<bool>();
|
||||||
|
DevColumn = new ReactiveObject<bool>();
|
||||||
|
VersionColumn = new ReactiveObject<bool>();
|
||||||
|
TimePlayedColumn = new ReactiveObject<bool>();
|
||||||
|
LastPlayedColumn = new ReactiveObject<bool>();
|
||||||
|
FileExtColumn = new ReactiveObject<bool>();
|
||||||
|
FileSizeColumn = new ReactiveObject<bool>();
|
||||||
|
PathColumn = new ReactiveObject<bool>();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Used to toggle columns in the GUI
|
||||||
|
/// </summary>
|
||||||
|
public Columns GuiColumns { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// A list of directories containing games to be used to load games into the games list
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<List<string>> GameDirs { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enable or disable custom themes in the GUI
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableCustomTheme { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Path to custom GUI theme
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<string> CustomThemePath { get; private set; }
|
||||||
|
|
||||||
|
public UiSection()
|
||||||
|
{
|
||||||
|
GuiColumns = new Columns();
|
||||||
|
GameDirs = new ReactiveObject<List<string>>();
|
||||||
|
EnableCustomTheme = new ReactiveObject<bool>();
|
||||||
|
CustomThemePath = new ReactiveObject<string>();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Logger configuration section
|
||||||
|
/// </summary>
|
||||||
|
public class LoggerSection
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Enables printing debug log messages
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableDebug { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables printing stub log messages
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableStub { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables printing info log messages
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableInfo { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables printing warning log messages
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableWarn { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables printing error log messages
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableError { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables printing guest log messages
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableGuest { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables printing FS access log messages
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableFsAccessLog { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Controls which log messages are written to the log targets
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<LogClass[]> FilteredClasses { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables or disables logging to a file on disk
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableFileLog { get; private set; }
|
||||||
|
|
||||||
|
public LoggerSection()
|
||||||
|
{
|
||||||
|
EnableDebug = new ReactiveObject<bool>();
|
||||||
|
EnableStub = new ReactiveObject<bool>();
|
||||||
|
EnableInfo = new ReactiveObject<bool>();
|
||||||
|
EnableWarn = new ReactiveObject<bool>();
|
||||||
|
EnableError = new ReactiveObject<bool>();
|
||||||
|
EnableGuest = new ReactiveObject<bool>();
|
||||||
|
EnableFsAccessLog = new ReactiveObject<bool>();
|
||||||
|
FilteredClasses = new ReactiveObject<LogClass[]>();
|
||||||
|
EnableFileLog = new ReactiveObject<bool>();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// System configuration section
|
||||||
|
/// </summary>
|
||||||
|
public class SystemSection
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Change System Language
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<Language> Language { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables or disables Docked Mode
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableDockedMode { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables or disables multi-core scheduling of threads
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableMulticoreScheduling { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables integrity checks on Game content files
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableFsIntegrityChecks { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables FS access log output to the console. Possible modes are 0-3
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<int> FsGlobalAccessLogMode { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enable or disable ignoring missing services
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> IgnoreMissingServices { get; private set; }
|
||||||
|
|
||||||
|
public SystemSection()
|
||||||
|
{
|
||||||
|
Language = new ReactiveObject<Language>();
|
||||||
|
EnableDockedMode = new ReactiveObject<bool>();
|
||||||
|
EnableMulticoreScheduling = new ReactiveObject<bool>();
|
||||||
|
EnableFsIntegrityChecks = new ReactiveObject<bool>();
|
||||||
|
FsGlobalAccessLogMode = new ReactiveObject<int>();
|
||||||
|
IgnoreMissingServices = new ReactiveObject<bool>();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Hid configuration section
|
||||||
|
/// </summary>
|
||||||
|
public class HidSection
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// The primary controller's type
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<ControllerType> ControllerType { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enable or disable keyboard support (Independent from controllers binding)
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableKeyboard { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Keyboard control bindings
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<NpadKeyboard> KeyboardControls { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Controller control bindings
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<NpadController> JoystickControls { get; private set; }
|
||||||
|
|
||||||
|
public HidSection()
|
||||||
|
{
|
||||||
|
ControllerType = new ReactiveObject<ControllerType>();
|
||||||
|
EnableKeyboard = new ReactiveObject<bool>();
|
||||||
|
KeyboardControls = new ReactiveObject<NpadKeyboard>();
|
||||||
|
JoystickControls = new ReactiveObject<NpadController>();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Graphics configuration section
|
||||||
|
/// </summary>
|
||||||
|
public class GraphicsSection
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Dumps shaders in this local directory
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<string> ShadersDumpPath { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables or disables Vertical Sync
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableVsync { get; private set; }
|
||||||
|
|
||||||
|
public GraphicsSection()
|
||||||
|
{
|
||||||
|
ShadersDumpPath = new ReactiveObject<string>();
|
||||||
|
EnableVsync = new ReactiveObject<bool>();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The default configuration instance
|
||||||
|
/// </summary>
|
||||||
|
public static ConfigurationState Instance { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The Ui section
|
||||||
|
/// </summary>
|
||||||
|
public UiSection Ui { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The Logger section
|
||||||
|
/// </summary>
|
||||||
|
public LoggerSection Logger { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The System section
|
||||||
|
/// </summary>
|
||||||
|
public SystemSection System { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The Graphics section
|
||||||
|
/// </summary>
|
||||||
|
public GraphicsSection Graphics { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The Hid section
|
||||||
|
/// </summary>
|
||||||
|
public HidSection Hid { get; private set; }
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Enables or disables Discord Rich Presence
|
||||||
|
/// </summary>
|
||||||
|
public ReactiveObject<bool> EnableDiscordIntegration { get; private set; }
|
||||||
|
|
||||||
|
private ConfigurationState()
|
||||||
|
{
|
||||||
|
Ui = new UiSection();
|
||||||
|
Logger = new LoggerSection();
|
||||||
|
System = new SystemSection();
|
||||||
|
Graphics = new GraphicsSection();
|
||||||
|
Hid = new HidSection();
|
||||||
|
EnableDiscordIntegration = new ReactiveObject<bool>();
|
||||||
|
}
|
||||||
|
|
||||||
|
public ConfigurationFileFormat ToFileFormat()
|
||||||
|
{
|
||||||
|
ConfigurationFileFormat configurationFile = new ConfigurationFileFormat
|
||||||
|
{
|
||||||
|
Version = 1,
|
||||||
|
GraphicsShadersDumpPath = Graphics.ShadersDumpPath,
|
||||||
|
LoggingEnableDebug = Logger.EnableDebug,
|
||||||
|
LoggingEnableStub = Logger.EnableStub,
|
||||||
|
LoggingEnableInfo = Logger.EnableInfo,
|
||||||
|
LoggingEnableWarn = Logger.EnableWarn,
|
||||||
|
LoggingEnableError = Logger.EnableError,
|
||||||
|
LoggingEnableGuest = Logger.EnableGuest,
|
||||||
|
LoggingEnableFsAccessLog = Logger.EnableFsAccessLog,
|
||||||
|
LoggingFilteredClasses = Logger.FilteredClasses,
|
||||||
|
EnableFileLog = Logger.EnableFileLog,
|
||||||
|
SystemLanguage = System.Language,
|
||||||
|
DockedMode = System.EnableDockedMode,
|
||||||
|
EnableDiscordIntegration = EnableDiscordIntegration,
|
||||||
|
EnableVsync = Graphics.EnableVsync,
|
||||||
|
EnableMulticoreScheduling = System.EnableMulticoreScheduling,
|
||||||
|
EnableFsIntegrityChecks = System.EnableFsIntegrityChecks,
|
||||||
|
FsGlobalAccessLogMode = System.FsGlobalAccessLogMode,
|
||||||
|
IgnoreMissingServices = System.IgnoreMissingServices,
|
||||||
|
ControllerType = Hid.ControllerType,
|
||||||
|
GuiColumns = new GuiColumns()
|
||||||
|
{
|
||||||
|
FavColumn = Ui.GuiColumns.FavColumn,
|
||||||
|
IconColumn = Ui.GuiColumns.IconColumn,
|
||||||
|
AppColumn = Ui.GuiColumns.AppColumn,
|
||||||
|
DevColumn = Ui.GuiColumns.DevColumn,
|
||||||
|
VersionColumn = Ui.GuiColumns.VersionColumn,
|
||||||
|
TimePlayedColumn = Ui.GuiColumns.TimePlayedColumn,
|
||||||
|
LastPlayedColumn = Ui.GuiColumns.LastPlayedColumn,
|
||||||
|
FileExtColumn = Ui.GuiColumns.FileExtColumn,
|
||||||
|
FileSizeColumn = Ui.GuiColumns.FileSizeColumn,
|
||||||
|
PathColumn = Ui.GuiColumns.PathColumn,
|
||||||
|
},
|
||||||
|
GameDirs = Ui.GameDirs,
|
||||||
|
EnableCustomTheme = Ui.EnableCustomTheme,
|
||||||
|
CustomThemePath = Ui.CustomThemePath,
|
||||||
|
EnableKeyboard = Hid.EnableKeyboard,
|
||||||
|
KeyboardControls = Hid.KeyboardControls,
|
||||||
|
JoystickControls = Hid.JoystickControls
|
||||||
|
};
|
||||||
|
|
||||||
|
return configurationFile;
|
||||||
|
}
|
||||||
|
|
||||||
|
public void LoadDefault()
|
||||||
|
{
|
||||||
|
Graphics.ShadersDumpPath.Value = "";
|
||||||
|
Logger.EnableDebug.Value = false;
|
||||||
|
Logger.EnableStub.Value = true;
|
||||||
|
Logger.EnableInfo.Value = true;
|
||||||
|
Logger.EnableWarn.Value = true;
|
||||||
|
Logger.EnableError.Value = true;
|
||||||
|
Logger.EnableGuest.Value = true;
|
||||||
|
Logger.EnableFsAccessLog.Value = false;
|
||||||
|
Logger.FilteredClasses.Value = new LogClass[] { };
|
||||||
|
Logger.EnableFileLog.Value = true;
|
||||||
|
System.Language.Value = Language.AmericanEnglish;
|
||||||
|
System.EnableDockedMode.Value = false;
|
||||||
|
EnableDiscordIntegration.Value = true;
|
||||||
|
Graphics.EnableVsync.Value = true;
|
||||||
|
System.EnableMulticoreScheduling.Value = true;
|
||||||
|
System.EnableFsIntegrityChecks.Value = true;
|
||||||
|
System.FsGlobalAccessLogMode.Value = 0;
|
||||||
|
System.IgnoreMissingServices.Value = false;
|
||||||
|
Hid.ControllerType.Value = ControllerType.Handheld;
|
||||||
|
Ui.GuiColumns.FavColumn.Value = true;
|
||||||
|
Ui.GuiColumns.IconColumn.Value = true;
|
||||||
|
Ui.GuiColumns.AppColumn.Value = true;
|
||||||
|
Ui.GuiColumns.DevColumn.Value = true;
|
||||||
|
Ui.GuiColumns.VersionColumn.Value = true;
|
||||||
|
Ui.GuiColumns.TimePlayedColumn.Value = true;
|
||||||
|
Ui.GuiColumns.LastPlayedColumn.Value = true;
|
||||||
|
Ui.GuiColumns.FileExtColumn.Value = true;
|
||||||
|
Ui.GuiColumns.FileSizeColumn.Value = true;
|
||||||
|
Ui.GuiColumns.PathColumn.Value = true;
|
||||||
|
Ui.GameDirs.Value = new List<string>();
|
||||||
|
Ui.EnableCustomTheme.Value = false;
|
||||||
|
Ui.CustomThemePath.Value = "";
|
||||||
|
Hid.EnableKeyboard.Value = false;
|
||||||
|
|
||||||
|
Hid.KeyboardControls.Value = new NpadKeyboard
|
||||||
|
{
|
||||||
|
LeftJoycon = new NpadKeyboardLeft
|
||||||
|
{
|
||||||
|
StickUp = Key.W,
|
||||||
|
StickDown = Key.S,
|
||||||
|
StickLeft = Key.A,
|
||||||
|
StickRight = Key.D,
|
||||||
|
StickButton = Key.F,
|
||||||
|
DPadUp = Key.Up,
|
||||||
|
DPadDown = Key.Down,
|
||||||
|
DPadLeft = Key.Left,
|
||||||
|
DPadRight = Key.Right,
|
||||||
|
ButtonMinus = Key.Minus,
|
||||||
|
ButtonL = Key.E,
|
||||||
|
ButtonZl = Key.Q,
|
||||||
|
},
|
||||||
|
RightJoycon = new NpadKeyboardRight
|
||||||
|
{
|
||||||
|
StickUp = Key.I,
|
||||||
|
StickDown = Key.K,
|
||||||
|
StickLeft = Key.J,
|
||||||
|
StickRight = Key.L,
|
||||||
|
StickButton = Key.H,
|
||||||
|
ButtonA = Key.Z,
|
||||||
|
ButtonB = Key.X,
|
||||||
|
ButtonX = Key.C,
|
||||||
|
ButtonY = Key.V,
|
||||||
|
ButtonPlus = Key.Plus,
|
||||||
|
ButtonR = Key.U,
|
||||||
|
ButtonZr = Key.O,
|
||||||
|
},
|
||||||
|
Hotkeys = new KeyboardHotkeys
|
||||||
|
{
|
||||||
|
ToggleVsync = Key.Tab
|
||||||
|
}
|
||||||
|
};
|
||||||
|
|
||||||
|
Hid.JoystickControls.Value = new NpadController
|
||||||
|
{
|
||||||
|
Enabled = true,
|
||||||
|
Index = 0,
|
||||||
|
Deadzone = 0.05f,
|
||||||
|
TriggerThreshold = 0.5f,
|
||||||
|
LeftJoycon = new NpadControllerLeft
|
||||||
|
{
|
||||||
|
Stick = ControllerInputId.Axis0,
|
||||||
|
StickButton = ControllerInputId.Button8,
|
||||||
|
DPadUp = ControllerInputId.Hat0Up,
|
||||||
|
DPadDown = ControllerInputId.Hat0Down,
|
||||||
|
DPadLeft = ControllerInputId.Hat0Left,
|
||||||
|
DPadRight = ControllerInputId.Hat0Right,
|
||||||
|
ButtonMinus = ControllerInputId.Button6,
|
||||||
|
ButtonL = ControllerInputId.Button4,
|
||||||
|
ButtonZl = ControllerInputId.Axis2,
|
||||||
|
},
|
||||||
|
RightJoycon = new NpadControllerRight
|
||||||
|
{
|
||||||
|
Stick = ControllerInputId.Axis3,
|
||||||
|
StickButton = ControllerInputId.Button9,
|
||||||
|
ButtonA = ControllerInputId.Button1,
|
||||||
|
ButtonB = ControllerInputId.Button0,
|
||||||
|
ButtonX = ControllerInputId.Button3,
|
||||||
|
ButtonY = ControllerInputId.Button2,
|
||||||
|
ButtonPlus = ControllerInputId.Button7,
|
||||||
|
ButtonR = ControllerInputId.Button5,
|
||||||
|
ButtonZr = ControllerInputId.Axis5,
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
|
||||||
|
public void Load(ConfigurationFileFormat configurationFileFormat)
|
||||||
|
{
|
||||||
|
if (configurationFileFormat.Version != 1 && configurationFileFormat.Version != 0)
|
||||||
|
{
|
||||||
|
Common.Logging.Logger.PrintWarning(LogClass.Application, $"Unsupported configuration version {configurationFileFormat.Version}, loading default.");
|
||||||
|
|
||||||
|
LoadDefault();
|
||||||
|
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
Graphics.ShadersDumpPath.Value = configurationFileFormat.GraphicsShadersDumpPath;
|
||||||
|
Logger.EnableDebug.Value = configurationFileFormat.LoggingEnableDebug;
|
||||||
|
Logger.EnableStub.Value = configurationFileFormat.LoggingEnableStub;
|
||||||
|
Logger.EnableInfo.Value = configurationFileFormat.LoggingEnableInfo;
|
||||||
|
Logger.EnableWarn.Value = configurationFileFormat.LoggingEnableWarn;
|
||||||
|
Logger.EnableError.Value = configurationFileFormat.LoggingEnableError;
|
||||||
|
Logger.EnableGuest.Value = configurationFileFormat.LoggingEnableGuest;
|
||||||
|
Logger.EnableFsAccessLog.Value = configurationFileFormat.LoggingEnableFsAccessLog;
|
||||||
|
Logger.FilteredClasses.Value = configurationFileFormat.LoggingFilteredClasses;
|
||||||
|
Logger.EnableFileLog.Value = configurationFileFormat.EnableFileLog;
|
||||||
|
System.Language.Value = configurationFileFormat.SystemLanguage;
|
||||||
|
System.EnableDockedMode.Value = configurationFileFormat.DockedMode;
|
||||||
|
System.EnableDockedMode.Value = configurationFileFormat.DockedMode;
|
||||||
|
EnableDiscordIntegration.Value = configurationFileFormat.EnableDiscordIntegration;
|
||||||
|
Graphics.EnableVsync.Value = configurationFileFormat.EnableVsync;
|
||||||
|
System.EnableMulticoreScheduling.Value = configurationFileFormat.EnableMulticoreScheduling;
|
||||||
|
System.EnableFsIntegrityChecks.Value = configurationFileFormat.EnableFsIntegrityChecks;
|
||||||
|
System.FsGlobalAccessLogMode.Value = configurationFileFormat.FsGlobalAccessLogMode;
|
||||||
|
System.IgnoreMissingServices.Value = configurationFileFormat.IgnoreMissingServices;
|
||||||
|
Hid.ControllerType.Value = configurationFileFormat.ControllerType;
|
||||||
|
Ui.GuiColumns.FavColumn.Value = configurationFileFormat.GuiColumns.FavColumn;
|
||||||
|
Ui.GuiColumns.IconColumn.Value = configurationFileFormat.GuiColumns.IconColumn;
|
||||||
|
Ui.GuiColumns.AppColumn.Value = configurationFileFormat.GuiColumns.AppColumn;
|
||||||
|
Ui.GuiColumns.DevColumn.Value = configurationFileFormat.GuiColumns.DevColumn;
|
||||||
|
Ui.GuiColumns.VersionColumn.Value = configurationFileFormat.GuiColumns.VersionColumn;
|
||||||
|
Ui.GuiColumns.TimePlayedColumn.Value = configurationFileFormat.GuiColumns.TimePlayedColumn;
|
||||||
|
Ui.GuiColumns.LastPlayedColumn.Value = configurationFileFormat.GuiColumns.LastPlayedColumn;
|
||||||
|
Ui.GuiColumns.FileExtColumn.Value = configurationFileFormat.GuiColumns.FileExtColumn;
|
||||||
|
Ui.GuiColumns.FileSizeColumn.Value = configurationFileFormat.GuiColumns.FileSizeColumn;
|
||||||
|
Ui.GuiColumns.PathColumn.Value = configurationFileFormat.GuiColumns.PathColumn;
|
||||||
|
Ui.GameDirs.Value = configurationFileFormat.GameDirs;
|
||||||
|
Ui.EnableCustomTheme.Value = configurationFileFormat.EnableCustomTheme;
|
||||||
|
Ui.CustomThemePath.Value = configurationFileFormat.CustomThemePath;
|
||||||
|
Hid.EnableKeyboard.Value = configurationFileFormat.EnableKeyboard;
|
||||||
|
Hid.KeyboardControls.Value = configurationFileFormat.KeyboardControls;
|
||||||
|
Hid.JoystickControls.Value = configurationFileFormat.JoystickControls;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static void Initialize()
|
||||||
|
{
|
||||||
|
if (Instance != null)
|
||||||
|
{
|
||||||
|
throw new InvalidOperationException("Configuration is already initialized");
|
||||||
|
}
|
||||||
|
|
||||||
|
Instance = new ConfigurationState();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
45
Ryujinx.Common/Configuration/Hid/ControllerInputId.cs
Normal file
45
Ryujinx.Common/Configuration/Hid/ControllerInputId.cs
Normal file
|
@ -0,0 +1,45 @@
|
||||||
|
namespace Ryujinx.Common.Configuration.Hid
|
||||||
|
{
|
||||||
|
public enum ControllerInputId
|
||||||
|
{
|
||||||
|
Button0,
|
||||||
|
Button1,
|
||||||
|
Button2,
|
||||||
|
Button3,
|
||||||
|
Button4,
|
||||||
|
Button5,
|
||||||
|
Button6,
|
||||||
|
Button7,
|
||||||
|
Button8,
|
||||||
|
Button9,
|
||||||
|
Button10,
|
||||||
|
Button11,
|
||||||
|
Button12,
|
||||||
|
Button13,
|
||||||
|
Button14,
|
||||||
|
Button15,
|
||||||
|
Button16,
|
||||||
|
Button17,
|
||||||
|
Button18,
|
||||||
|
Button19,
|
||||||
|
Button20,
|
||||||
|
Axis0,
|
||||||
|
Axis1,
|
||||||
|
Axis2,
|
||||||
|
Axis3,
|
||||||
|
Axis4,
|
||||||
|
Axis5,
|
||||||
|
Hat0Up,
|
||||||
|
Hat0Down,
|
||||||
|
Hat0Left,
|
||||||
|
Hat0Right,
|
||||||
|
Hat1Up,
|
||||||
|
Hat1Down,
|
||||||
|
Hat1Left,
|
||||||
|
Hat1Right,
|
||||||
|
Hat2Up,
|
||||||
|
Hat2Down,
|
||||||
|
Hat2Left,
|
||||||
|
Hat2Right
|
||||||
|
}
|
||||||
|
}
|
11
Ryujinx.Common/Configuration/Hid/ControllerType.cs
Normal file
11
Ryujinx.Common/Configuration/Hid/ControllerType.cs
Normal file
|
@ -0,0 +1,11 @@
|
||||||
|
namespace Ryujinx.Configuration.Hid
|
||||||
|
{
|
||||||
|
public enum ControllerType
|
||||||
|
{
|
||||||
|
ProController,
|
||||||
|
Handheld,
|
||||||
|
NpadPair,
|
||||||
|
NpadLeft,
|
||||||
|
NpadRight
|
||||||
|
}
|
||||||
|
}
|
153
Ryujinx.Common/Configuration/Hid/Key.cs
Normal file
153
Ryujinx.Common/Configuration/Hid/Key.cs
Normal file
|
@ -0,0 +1,153 @@
|
||||||
|
namespace Ryujinx.Configuration.Hid
|
||||||
|
{
|
||||||
|
public enum Key
|
||||||
|
{
|
||||||
|
Unknown = 0,
|
||||||
|
ShiftLeft = 1,
|
||||||
|
LShift = 1,
|
||||||
|
ShiftRight = 2,
|
||||||
|
RShift = 2,
|
||||||
|
ControlLeft = 3,
|
||||||
|
LControl = 3,
|
||||||
|
ControlRight = 4,
|
||||||
|
RControl = 4,
|
||||||
|
AltLeft = 5,
|
||||||
|
LAlt = 5,
|
||||||
|
AltRight = 6,
|
||||||
|
RAlt = 6,
|
||||||
|
WinLeft = 7,
|
||||||
|
LWin = 7,
|
||||||
|
WinRight = 8,
|
||||||
|
RWin = 8,
|
||||||
|
Menu = 9,
|
||||||
|
F1 = 10,
|
||||||
|
F2 = 11,
|
||||||
|
F3 = 12,
|
||||||
|
F4 = 13,
|
||||||
|
F5 = 14,
|
||||||
|
F6 = 15,
|
||||||
|
F7 = 16,
|
||||||
|
F8 = 17,
|
||||||
|
F9 = 18,
|
||||||
|
F10 = 19,
|
||||||
|
F11 = 20,
|
||||||
|
F12 = 21,
|
||||||
|
F13 = 22,
|
||||||
|
F14 = 23,
|
||||||
|
F15 = 24,
|
||||||
|
F16 = 25,
|
||||||
|
F17 = 26,
|
||||||
|
F18 = 27,
|
||||||
|
F19 = 28,
|
||||||
|
F20 = 29,
|
||||||
|
F21 = 30,
|
||||||
|
F22 = 31,
|
||||||
|
F23 = 32,
|
||||||
|
F24 = 33,
|
||||||
|
F25 = 34,
|
||||||
|
F26 = 35,
|
||||||
|
F27 = 36,
|
||||||
|
F28 = 37,
|
||||||
|
F29 = 38,
|
||||||
|
F30 = 39,
|
||||||
|
F31 = 40,
|
||||||
|
F32 = 41,
|
||||||
|
F33 = 42,
|
||||||
|
F34 = 43,
|
||||||
|
F35 = 44,
|
||||||
|
Up = 45,
|
||||||
|
Down = 46,
|
||||||
|
Left = 47,
|
||||||
|
Right = 48,
|
||||||
|
Enter = 49,
|
||||||
|
Escape = 50,
|
||||||
|
Space = 51,
|
||||||
|
Tab = 52,
|
||||||
|
BackSpace = 53,
|
||||||
|
Back = 53,
|
||||||
|
Insert = 54,
|
||||||
|
Delete = 55,
|
||||||
|
PageUp = 56,
|
||||||
|
PageDown = 57,
|
||||||
|
Home = 58,
|
||||||
|
End = 59,
|
||||||
|
CapsLock = 60,
|
||||||
|
ScrollLock = 61,
|
||||||
|
PrintScreen = 62,
|
||||||
|
Pause = 63,
|
||||||
|
NumLock = 64,
|
||||||
|
Clear = 65,
|
||||||
|
Sleep = 66,
|
||||||
|
Keypad0 = 67,
|
||||||
|
Keypad1 = 68,
|
||||||
|
Keypad2 = 69,
|
||||||
|
Keypad3 = 70,
|
||||||
|
Keypad4 = 71,
|
||||||
|
Keypad5 = 72,
|
||||||
|
Keypad6 = 73,
|
||||||
|
Keypad7 = 74,
|
||||||
|
Keypad8 = 75,
|
||||||
|
Keypad9 = 76,
|
||||||
|
KeypadDivide = 77,
|
||||||
|
KeypadMultiply = 78,
|
||||||
|
KeypadSubtract = 79,
|
||||||
|
KeypadMinus = 79,
|
||||||
|
KeypadAdd = 80,
|
||||||
|
KeypadPlus = 80,
|
||||||
|
KeypadDecimal = 81,
|
||||||
|
KeypadPeriod = 81,
|
||||||
|
KeypadEnter = 82,
|
||||||
|
A = 83,
|
||||||
|
B = 84,
|
||||||
|
C = 85,
|
||||||
|
D = 86,
|
||||||
|
E = 87,
|
||||||
|
F = 88,
|
||||||
|
G = 89,
|
||||||
|
H = 90,
|
||||||
|
I = 91,
|
||||||
|
J = 92,
|
||||||
|
K = 93,
|
||||||
|
L = 94,
|
||||||
|
M = 95,
|
||||||
|
N = 96,
|
||||||
|
O = 97,
|
||||||
|
P = 98,
|
||||||
|
Q = 99,
|
||||||
|
R = 100,
|
||||||
|
S = 101,
|
||||||
|
T = 102,
|
||||||
|
U = 103,
|
||||||
|
V = 104,
|
||||||
|
W = 105,
|
||||||
|
X = 106,
|
||||||
|
Y = 107,
|
||||||
|
Z = 108,
|
||||||
|
Number0 = 109,
|
||||||
|
Number1 = 110,
|
||||||
|
Number2 = 111,
|
||||||
|
Number3 = 112,
|
||||||
|
Number4 = 113,
|
||||||
|
Number5 = 114,
|
||||||
|
Number6 = 115,
|
||||||
|
Number7 = 116,
|
||||||
|
Number8 = 117,
|
||||||
|
Number9 = 118,
|
||||||
|
Tilde = 119,
|
||||||
|
Grave = 119,
|
||||||
|
Minus = 120,
|
||||||
|
Plus = 121,
|
||||||
|
BracketLeft = 122,
|
||||||
|
LBracket = 122,
|
||||||
|
BracketRight = 123,
|
||||||
|
RBracket = 123,
|
||||||
|
Semicolon = 124,
|
||||||
|
Quote = 125,
|
||||||
|
Comma = 126,
|
||||||
|
Period = 127,
|
||||||
|
Slash = 128,
|
||||||
|
BackSlash = 129,
|
||||||
|
NonUSBackSlash = 130,
|
||||||
|
LastKey = 131
|
||||||
|
}
|
||||||
|
}
|
7
Ryujinx.Common/Configuration/Hid/KeyboardHotkeys.cs
Normal file
7
Ryujinx.Common/Configuration/Hid/KeyboardHotkeys.cs
Normal file
|
@ -0,0 +1,7 @@
|
||||||
|
namespace Ryujinx.Configuration.Hid
|
||||||
|
{
|
||||||
|
public struct KeyboardHotkeys
|
||||||
|
{
|
||||||
|
public Key ToggleVsync;
|
||||||
|
}
|
||||||
|
}
|
35
Ryujinx.Common/Configuration/Hid/NpadController.cs
Normal file
35
Ryujinx.Common/Configuration/Hid/NpadController.cs
Normal file
|
@ -0,0 +1,35 @@
|
||||||
|
namespace Ryujinx.Common.Configuration.Hid
|
||||||
|
{
|
||||||
|
public class NpadController
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Enables or disables controller support
|
||||||
|
/// </summary>
|
||||||
|
public bool Enabled;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Controller Device Index
|
||||||
|
/// </summary>
|
||||||
|
public int Index;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Controller Analog Stick Deadzone
|
||||||
|
/// </summary>
|
||||||
|
public float Deadzone;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Controller Trigger Threshold
|
||||||
|
/// </summary>
|
||||||
|
public float TriggerThreshold;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Left JoyCon Controller Bindings
|
||||||
|
/// </summary>
|
||||||
|
public NpadControllerLeft LeftJoycon;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Right JoyCon Controller Bindings
|
||||||
|
/// </summary>
|
||||||
|
public NpadControllerRight RightJoycon;
|
||||||
|
}
|
||||||
|
}
|
15
Ryujinx.Common/Configuration/Hid/NpadControllerLeft.cs
Normal file
15
Ryujinx.Common/Configuration/Hid/NpadControllerLeft.cs
Normal file
|
@ -0,0 +1,15 @@
|
||||||
|
namespace Ryujinx.Common.Configuration.Hid
|
||||||
|
{
|
||||||
|
public struct NpadControllerLeft
|
||||||
|
{
|
||||||
|
public ControllerInputId Stick;
|
||||||
|
public ControllerInputId StickButton;
|
||||||
|
public ControllerInputId ButtonMinus;
|
||||||
|
public ControllerInputId ButtonL;
|
||||||
|
public ControllerInputId ButtonZl;
|
||||||
|
public ControllerInputId DPadUp;
|
||||||
|
public ControllerInputId DPadDown;
|
||||||
|
public ControllerInputId DPadLeft;
|
||||||
|
public ControllerInputId DPadRight;
|
||||||
|
}
|
||||||
|
}
|
15
Ryujinx.Common/Configuration/Hid/NpadControllerRight.cs
Normal file
15
Ryujinx.Common/Configuration/Hid/NpadControllerRight.cs
Normal file
|
@ -0,0 +1,15 @@
|
||||||
|
namespace Ryujinx.Common.Configuration.Hid
|
||||||
|
{
|
||||||
|
public struct NpadControllerRight
|
||||||
|
{
|
||||||
|
public ControllerInputId Stick;
|
||||||
|
public ControllerInputId StickButton;
|
||||||
|
public ControllerInputId ButtonA;
|
||||||
|
public ControllerInputId ButtonB;
|
||||||
|
public ControllerInputId ButtonX;
|
||||||
|
public ControllerInputId ButtonY;
|
||||||
|
public ControllerInputId ButtonPlus;
|
||||||
|
public ControllerInputId ButtonR;
|
||||||
|
public ControllerInputId ButtonZr;
|
||||||
|
}
|
||||||
|
}
|
20
Ryujinx.Common/Configuration/Hid/NpadKeyboard.cs
Normal file
20
Ryujinx.Common/Configuration/Hid/NpadKeyboard.cs
Normal file
|
@ -0,0 +1,20 @@
|
||||||
|
namespace Ryujinx.UI.Input
|
||||||
|
{
|
||||||
|
public class NpadKeyboard
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Left JoyCon Keyboard Bindings
|
||||||
|
/// </summary>
|
||||||
|
public Configuration.Hid.NpadKeyboardLeft LeftJoycon;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Right JoyCon Keyboard Bindings
|
||||||
|
/// </summary>
|
||||||
|
public Configuration.Hid.NpadKeyboardRight RightJoycon;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Hotkey Keyboard Bindings
|
||||||
|
/// </summary>
|
||||||
|
public Configuration.Hid.KeyboardHotkeys Hotkeys;
|
||||||
|
}
|
||||||
|
}
|
18
Ryujinx.Common/Configuration/Hid/NpadKeyboardLeft.cs
Normal file
18
Ryujinx.Common/Configuration/Hid/NpadKeyboardLeft.cs
Normal file
|
@ -0,0 +1,18 @@
|
||||||
|
namespace Ryujinx.Configuration.Hid
|
||||||
|
{
|
||||||
|
public struct NpadKeyboardLeft
|
||||||
|
{
|
||||||
|
public Key StickUp;
|
||||||
|
public Key StickDown;
|
||||||
|
public Key StickLeft;
|
||||||
|
public Key StickRight;
|
||||||
|
public Key StickButton;
|
||||||
|
public Key DPadUp;
|
||||||
|
public Key DPadDown;
|
||||||
|
public Key DPadLeft;
|
||||||
|
public Key DPadRight;
|
||||||
|
public Key ButtonMinus;
|
||||||
|
public Key ButtonL;
|
||||||
|
public Key ButtonZl;
|
||||||
|
}
|
||||||
|
}
|
18
Ryujinx.Common/Configuration/Hid/NpadKeyboardRight.cs
Normal file
18
Ryujinx.Common/Configuration/Hid/NpadKeyboardRight.cs
Normal file
|
@ -0,0 +1,18 @@
|
||||||
|
namespace Ryujinx.Configuration.Hid
|
||||||
|
{
|
||||||
|
public struct NpadKeyboardRight
|
||||||
|
{
|
||||||
|
public Key StickUp;
|
||||||
|
public Key StickDown;
|
||||||
|
public Key StickLeft;
|
||||||
|
public Key StickRight;
|
||||||
|
public Key StickButton;
|
||||||
|
public Key ButtonA;
|
||||||
|
public Key ButtonB;
|
||||||
|
public Key ButtonX;
|
||||||
|
public Key ButtonY;
|
||||||
|
public Key ButtonPlus;
|
||||||
|
public Key ButtonR;
|
||||||
|
public Key ButtonZr;
|
||||||
|
}
|
||||||
|
}
|
109
Ryujinx.Common/Configuration/LoggerModule.cs
Normal file
109
Ryujinx.Common/Configuration/LoggerModule.cs
Normal file
|
@ -0,0 +1,109 @@
|
||||||
|
using Ryujinx.Common;
|
||||||
|
using Ryujinx.Common.Logging;
|
||||||
|
using System;
|
||||||
|
using System.IO;
|
||||||
|
|
||||||
|
namespace Ryujinx.Configuration
|
||||||
|
{
|
||||||
|
public static class LoggerModule
|
||||||
|
{
|
||||||
|
public static void Initialize()
|
||||||
|
{
|
||||||
|
AppDomain.CurrentDomain.UnhandledException += CurrentDomain_UnhandledException;
|
||||||
|
AppDomain.CurrentDomain.ProcessExit += CurrentDomain_ProcessExit;
|
||||||
|
|
||||||
|
ConfigurationState.Instance.Logger.EnableDebug.Event += ReloadEnableDebug;
|
||||||
|
ConfigurationState.Instance.Logger.EnableStub.Event += ReloadEnableStub;
|
||||||
|
ConfigurationState.Instance.Logger.EnableInfo.Event += ReloadEnableInfo;
|
||||||
|
ConfigurationState.Instance.Logger.EnableWarn.Event += ReloadEnableWarning;
|
||||||
|
ConfigurationState.Instance.Logger.EnableError.Event += ReloadEnableError;
|
||||||
|
ConfigurationState.Instance.Logger.EnableGuest.Event += ReloadEnableGuest;
|
||||||
|
ConfigurationState.Instance.Logger.EnableFsAccessLog.Event += ReloadEnableFsAccessLog;
|
||||||
|
ConfigurationState.Instance.Logger.FilteredClasses.Event += ReloadFilteredClasses;
|
||||||
|
ConfigurationState.Instance.Logger.EnableFileLog.Event += ReloadFileLogger;
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadEnableDebug(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(LogLevel.Debug, e.NewValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadEnableStub(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(LogLevel.Stub, e.NewValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadEnableInfo(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(LogLevel.Info, e.NewValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadEnableWarning(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(LogLevel.Warning, e.NewValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadEnableError(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(LogLevel.Error, e.NewValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadEnableGuest(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(LogLevel.Guest, e.NewValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadEnableFsAccessLog(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(LogLevel.AccessLog, e.NewValue);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadFilteredClasses(object sender, ReactiveEventArgs<LogClass[]> e)
|
||||||
|
{
|
||||||
|
bool noFilter = e.NewValue.Length == 0;
|
||||||
|
|
||||||
|
foreach (var logClass in EnumExtensions.GetValues<LogClass>())
|
||||||
|
{
|
||||||
|
Logger.SetEnable(logClass, noFilter);
|
||||||
|
}
|
||||||
|
|
||||||
|
foreach (var logClass in e.NewValue)
|
||||||
|
{
|
||||||
|
Logger.SetEnable(logClass, true);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void ReloadFileLogger(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
if (e.NewValue)
|
||||||
|
{
|
||||||
|
Logger.AddTarget(new AsyncLogTargetWrapper(
|
||||||
|
new FileLogTarget(Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Ryujinx.log"), "file"),
|
||||||
|
1000,
|
||||||
|
AsyncLogTargetOverflowAction.Block
|
||||||
|
));
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
Logger.RemoveTarget("file");
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void CurrentDomain_ProcessExit(object sender, EventArgs e)
|
||||||
|
{
|
||||||
|
Logger.Shutdown();
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void CurrentDomain_UnhandledException(object sender, UnhandledExceptionEventArgs e)
|
||||||
|
{
|
||||||
|
var exception = e.ExceptionObject as Exception;
|
||||||
|
|
||||||
|
Logger.PrintError(LogClass.Emulation, $"Unhandled exception caught: {exception}");
|
||||||
|
|
||||||
|
if (e.IsTerminating)
|
||||||
|
{
|
||||||
|
Logger.Shutdown();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
23
Ryujinx.Common/Configuration/System/Language.cs
Normal file
23
Ryujinx.Common/Configuration/System/Language.cs
Normal file
|
@ -0,0 +1,23 @@
|
||||||
|
namespace Ryujinx.Configuration.System
|
||||||
|
{
|
||||||
|
public enum Language
|
||||||
|
{
|
||||||
|
Japanese,
|
||||||
|
AmericanEnglish,
|
||||||
|
French,
|
||||||
|
German,
|
||||||
|
Italian,
|
||||||
|
Spanish,
|
||||||
|
Chinese,
|
||||||
|
Korean,
|
||||||
|
Dutch,
|
||||||
|
Portuguese,
|
||||||
|
Russian,
|
||||||
|
Taiwanese,
|
||||||
|
BritishEnglish,
|
||||||
|
CanadianFrench,
|
||||||
|
LatinAmericanSpanish,
|
||||||
|
SimplifiedChinese,
|
||||||
|
TraditionalChinese
|
||||||
|
}
|
||||||
|
}
|
|
@ -1,4 +1,4 @@
|
||||||
namespace Ryujinx.Ui
|
namespace Ryujinx.Configuration.Ui
|
||||||
{
|
{
|
||||||
public struct GuiColumns
|
public struct GuiColumns
|
||||||
{
|
{
|
|
@ -37,6 +37,12 @@ namespace Ryujinx.Common.Logging
|
||||||
m_LogTargets = new List<ILogTarget>();
|
m_LogTargets = new List<ILogTarget>();
|
||||||
|
|
||||||
m_Time = Stopwatch.StartNew();
|
m_Time = Stopwatch.StartNew();
|
||||||
|
|
||||||
|
// Logger should log to console by default
|
||||||
|
AddTarget(new AsyncLogTargetWrapper(
|
||||||
|
new ConsoleLogTarget("console"),
|
||||||
|
1000,
|
||||||
|
AsyncLogTargetOverflowAction.Block));
|
||||||
}
|
}
|
||||||
|
|
||||||
public static void RestartTime()
|
public static void RestartTime()
|
||||||
|
@ -44,6 +50,19 @@ namespace Ryujinx.Common.Logging
|
||||||
m_Time.Restart();
|
m_Time.Restart();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private static ILogTarget GetTarget(string targetName)
|
||||||
|
{
|
||||||
|
foreach (var target in m_LogTargets)
|
||||||
|
{
|
||||||
|
if (target.Name.Equals(targetName))
|
||||||
|
{
|
||||||
|
return target;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
public static void AddTarget(ILogTarget target)
|
public static void AddTarget(ILogTarget target)
|
||||||
{
|
{
|
||||||
m_LogTargets.Add(target);
|
m_LogTargets.Add(target);
|
||||||
|
@ -51,6 +70,20 @@ namespace Ryujinx.Common.Logging
|
||||||
Updated += target.Log;
|
Updated += target.Log;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public static void RemoveTarget(string target)
|
||||||
|
{
|
||||||
|
ILogTarget logTarget = GetTarget(target);
|
||||||
|
|
||||||
|
if (logTarget != null)
|
||||||
|
{
|
||||||
|
Updated -= logTarget.Log;
|
||||||
|
|
||||||
|
m_LogTargets.Remove(logTarget);
|
||||||
|
|
||||||
|
logTarget.Dispose();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
public static void Shutdown()
|
public static void Shutdown()
|
||||||
{
|
{
|
||||||
Updated = null;
|
Updated = null;
|
||||||
|
|
|
@ -27,6 +27,8 @@ namespace Ryujinx.Common.Logging
|
||||||
|
|
||||||
private readonly int _overflowTimeout;
|
private readonly int _overflowTimeout;
|
||||||
|
|
||||||
|
string ILogTarget.Name { get => _target.Name; }
|
||||||
|
|
||||||
public AsyncLogTargetWrapper(ILogTarget target)
|
public AsyncLogTargetWrapper(ILogTarget target)
|
||||||
: this(target, -1, AsyncLogTargetOverflowAction.Block)
|
: this(target, -1, AsyncLogTargetOverflowAction.Block)
|
||||||
{ }
|
{ }
|
||||||
|
|
|
@ -9,6 +9,10 @@ namespace Ryujinx.Common.Logging
|
||||||
|
|
||||||
private readonly ILogFormatter _formatter;
|
private readonly ILogFormatter _formatter;
|
||||||
|
|
||||||
|
private readonly string _name;
|
||||||
|
|
||||||
|
string ILogTarget.Name { get => _name; }
|
||||||
|
|
||||||
static ConsoleLogTarget()
|
static ConsoleLogTarget()
|
||||||
{
|
{
|
||||||
_logColors = new ConcurrentDictionary<LogLevel, ConsoleColor> {
|
_logColors = new ConcurrentDictionary<LogLevel, ConsoleColor> {
|
||||||
|
@ -19,9 +23,10 @@ namespace Ryujinx.Common.Logging
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
public ConsoleLogTarget()
|
public ConsoleLogTarget(string name)
|
||||||
{
|
{
|
||||||
_formatter = new DefaultLogFormatter();
|
_formatter = new DefaultLogFormatter();
|
||||||
|
_name = name;
|
||||||
}
|
}
|
||||||
|
|
||||||
public void Log(object sender, LogEventArgs args)
|
public void Log(object sender, LogEventArgs args)
|
||||||
|
|
|
@ -1,4 +1,5 @@
|
||||||
using System.IO;
|
using System;
|
||||||
|
using System.IO;
|
||||||
using System.Text;
|
using System.Text;
|
||||||
|
|
||||||
namespace Ryujinx.Common.Logging
|
namespace Ryujinx.Common.Logging
|
||||||
|
@ -9,13 +10,17 @@ namespace Ryujinx.Common.Logging
|
||||||
|
|
||||||
private readonly StreamWriter _logWriter;
|
private readonly StreamWriter _logWriter;
|
||||||
private readonly ILogFormatter _formatter;
|
private readonly ILogFormatter _formatter;
|
||||||
|
private readonly string _name;
|
||||||
|
|
||||||
public FileLogTarget(string path)
|
string ILogTarget.Name { get => _name; }
|
||||||
: this(path, FileShare.Read, FileMode.Append)
|
|
||||||
|
public FileLogTarget(string path, string name)
|
||||||
|
: this(path, name, FileShare.Read, FileMode.Append)
|
||||||
{ }
|
{ }
|
||||||
|
|
||||||
public FileLogTarget(string path, FileShare fileShare, FileMode fileMode)
|
public FileLogTarget(string path, string name, FileShare fileShare, FileMode fileMode)
|
||||||
{
|
{
|
||||||
|
_name = name;
|
||||||
_logWriter = new StreamWriter(File.Open(path, fileMode, FileAccess.Write, fileShare));
|
_logWriter = new StreamWriter(File.Open(path, fileMode, FileAccess.Write, fileShare));
|
||||||
_formatter = new DefaultLogFormatter();
|
_formatter = new DefaultLogFormatter();
|
||||||
}
|
}
|
||||||
|
|
|
@ -5,5 +5,7 @@ namespace Ryujinx.Common.Logging
|
||||||
public interface ILogTarget : IDisposable
|
public interface ILogTarget : IDisposable
|
||||||
{
|
{
|
||||||
void Log(object sender, LogEventArgs args);
|
void Log(object sender, LogEventArgs args);
|
||||||
|
|
||||||
|
string Name { get; }
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,4 +1,5 @@
|
||||||
using System.IO;
|
using System;
|
||||||
|
using System.IO;
|
||||||
using Utf8Json;
|
using Utf8Json;
|
||||||
|
|
||||||
namespace Ryujinx.Common.Logging
|
namespace Ryujinx.Common.Logging
|
||||||
|
@ -7,10 +8,14 @@ namespace Ryujinx.Common.Logging
|
||||||
{
|
{
|
||||||
private Stream _stream;
|
private Stream _stream;
|
||||||
private bool _leaveOpen;
|
private bool _leaveOpen;
|
||||||
|
private string _name;
|
||||||
|
|
||||||
public JsonLogTarget(Stream stream)
|
string ILogTarget.Name { get => _name; }
|
||||||
|
|
||||||
|
public JsonLogTarget(Stream stream, string name)
|
||||||
{
|
{
|
||||||
_stream = stream;
|
_stream = stream;
|
||||||
|
_name = name;
|
||||||
}
|
}
|
||||||
|
|
||||||
public JsonLogTarget(Stream stream, bool leaveOpen)
|
public JsonLogTarget(Stream stream, bool leaveOpen)
|
||||||
|
|
57
Ryujinx.Common/ReactiveObject.cs
Normal file
57
Ryujinx.Common/ReactiveObject.cs
Normal file
|
@ -0,0 +1,57 @@
|
||||||
|
using System;
|
||||||
|
using System.Threading;
|
||||||
|
|
||||||
|
namespace Ryujinx.Common
|
||||||
|
{
|
||||||
|
public class ReactiveObject<T>
|
||||||
|
{
|
||||||
|
private ReaderWriterLock _readerWriterLock = new ReaderWriterLock();
|
||||||
|
private T _value;
|
||||||
|
|
||||||
|
public event EventHandler<ReactiveEventArgs<T>> Event;
|
||||||
|
|
||||||
|
public T Value
|
||||||
|
{
|
||||||
|
get
|
||||||
|
{
|
||||||
|
_readerWriterLock.AcquireReaderLock(Timeout.Infinite);
|
||||||
|
T value = _value;
|
||||||
|
_readerWriterLock.ReleaseReaderLock();
|
||||||
|
|
||||||
|
return value;
|
||||||
|
}
|
||||||
|
set
|
||||||
|
{
|
||||||
|
_readerWriterLock.AcquireWriterLock(Timeout.Infinite);
|
||||||
|
|
||||||
|
T oldValue = _value;
|
||||||
|
|
||||||
|
_value = value;
|
||||||
|
|
||||||
|
_readerWriterLock.ReleaseWriterLock();
|
||||||
|
|
||||||
|
if (oldValue == null || !oldValue.Equals(_value))
|
||||||
|
{
|
||||||
|
Event?.Invoke(this, new ReactiveEventArgs<T>(oldValue, value));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static implicit operator T(ReactiveObject<T> obj)
|
||||||
|
{
|
||||||
|
return obj.Value;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public class ReactiveEventArgs<T>
|
||||||
|
{
|
||||||
|
public T OldValue { get; }
|
||||||
|
public T NewValue { get; }
|
||||||
|
|
||||||
|
public ReactiveEventArgs(T oldValue, T newValue)
|
||||||
|
{
|
||||||
|
OldValue = oldValue;
|
||||||
|
NewValue = newValue;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
|
@ -27,6 +27,7 @@
|
||||||
</PropertyGroup>
|
</PropertyGroup>
|
||||||
|
|
||||||
<ItemGroup>
|
<ItemGroup>
|
||||||
|
<PackageReference Include="JsonPrettyPrinter" Version="1.0.1.1" />
|
||||||
<PackageReference Include="Utf8Json" Version="1.3.7" />
|
<PackageReference Include="Utf8Json" Version="1.3.7" />
|
||||||
</ItemGroup>
|
</ItemGroup>
|
||||||
|
|
||||||
|
|
|
@ -0,0 +1,18 @@
|
||||||
|
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Identifies the initial position of the cursor displayed in the area.
|
||||||
|
/// </summary>
|
||||||
|
enum InitialCursorPosition : uint
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Position the cursor at the beginning of the text
|
||||||
|
/// </summary>
|
||||||
|
Start,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Position the cursor at the end of the text
|
||||||
|
/// </summary>
|
||||||
|
End
|
||||||
|
}
|
||||||
|
}
|
18
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/InputFormMode.cs
Normal file
18
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/InputFormMode.cs
Normal file
|
@ -0,0 +1,18 @@
|
||||||
|
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Identifies the text entry mode.
|
||||||
|
/// </summary>
|
||||||
|
enum InputFormMode : uint
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Displays the text entry area as a single-line field.
|
||||||
|
/// </summary>
|
||||||
|
SingleLine,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Displays the text entry area as a multi-line field.
|
||||||
|
/// </summary>
|
||||||
|
MultiLine
|
||||||
|
}
|
||||||
|
}
|
56
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/InvalidCharFlags.cs
Normal file
56
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/InvalidCharFlags.cs
Normal file
|
@ -0,0 +1,56 @@
|
||||||
|
using System;
|
||||||
|
|
||||||
|
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Identifies prohibited character sets.
|
||||||
|
/// </summary>
|
||||||
|
[Flags]
|
||||||
|
enum InvalidCharFlags : uint
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// No characters are prohibited.
|
||||||
|
/// </summary>
|
||||||
|
None = 0 << 1,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits spaces.
|
||||||
|
/// </summary>
|
||||||
|
Space = 1 << 1,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits the at (@) symbol.
|
||||||
|
/// </summary>
|
||||||
|
AtSymbol = 1 << 2,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits the percent (%) symbol.
|
||||||
|
/// </summary>
|
||||||
|
Percent = 1 << 3,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits the forward slash (/) symbol.
|
||||||
|
/// </summary>
|
||||||
|
ForwardSlash = 1 << 4,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits the backward slash (\) symbol.
|
||||||
|
/// </summary>
|
||||||
|
BackSlash = 1 << 5,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits numbers.
|
||||||
|
/// </summary>
|
||||||
|
Numbers = 1 << 6,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits characters outside of those allowed in download codes.
|
||||||
|
/// </summary>
|
||||||
|
DownloadCode = 1 << 7,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Prohibits characters outside of those allowed in Mii Nicknames.
|
||||||
|
/// </summary>
|
||||||
|
Username = 1 << 8
|
||||||
|
}
|
||||||
|
}
|
28
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/KeyboardMode.cs
Normal file
28
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/KeyboardMode.cs
Normal file
|
@ -0,0 +1,28 @@
|
||||||
|
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Identifies the variant of keyboard displayed on screen.
|
||||||
|
/// </summary>
|
||||||
|
enum KeyboardMode : uint
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// A full alpha-numeric keyboard.
|
||||||
|
/// </summary>
|
||||||
|
Default,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Number pad.
|
||||||
|
/// </summary>
|
||||||
|
NumbersOnly,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// QWERTY (and variants) keyboard only.
|
||||||
|
/// </summary>
|
||||||
|
LettersOnly,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Unknown keyboard variant.
|
||||||
|
/// </summary>
|
||||||
|
Unknown
|
||||||
|
}
|
||||||
|
}
|
18
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/PasswordMode.cs
Normal file
18
Ryujinx.HLE/HOS/Applets/SoftwareKeyboard/PasswordMode.cs
Normal file
|
@ -0,0 +1,18 @@
|
||||||
|
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Identifies the display mode of text in a password field.
|
||||||
|
/// </summary>
|
||||||
|
enum PasswordMode : uint
|
||||||
|
{
|
||||||
|
/// <summary>
|
||||||
|
/// Display input characters.
|
||||||
|
/// </summary>
|
||||||
|
Disabled,
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Hide input characters.
|
||||||
|
/// </summary>
|
||||||
|
Enabled
|
||||||
|
}
|
||||||
|
}
|
|
@ -9,11 +9,11 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
{
|
{
|
||||||
internal class SoftwareKeyboardApplet : IApplet
|
internal class SoftwareKeyboardApplet : IApplet
|
||||||
{
|
{
|
||||||
private const string DEFAULT_NUMB = "1";
|
private const string DefaultNumb = "1";
|
||||||
private const string DEFAULT_TEXT = "Ryujinx";
|
private const string DefaultText = "Ryujinx";
|
||||||
|
|
||||||
private const int STANDARD_BUFFER_SIZE = 0x7D8;
|
private const int StandardBufferSize = 0x7D8;
|
||||||
private const int INTERACTIVE_BUFFER_SIZE = 0x7D4;
|
private const int InteractiveBufferSize = 0x7D4;
|
||||||
|
|
||||||
private SoftwareKeyboardState _state = SoftwareKeyboardState.Uninitialized;
|
private SoftwareKeyboardState _state = SoftwareKeyboardState.Uninitialized;
|
||||||
|
|
||||||
|
@ -22,7 +22,8 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
|
|
||||||
private SoftwareKeyboardConfig _keyboardConfig;
|
private SoftwareKeyboardConfig _keyboardConfig;
|
||||||
|
|
||||||
private string _textValue = DEFAULT_TEXT;
|
private string _textValue = DefaultText;
|
||||||
|
private Encoding _encoding = Encoding.Unicode;
|
||||||
|
|
||||||
public event EventHandler AppletStateChanged;
|
public event EventHandler AppletStateChanged;
|
||||||
|
|
||||||
|
@ -42,6 +43,11 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
|
|
||||||
_keyboardConfig = ReadStruct<SoftwareKeyboardConfig>(keyboardConfig);
|
_keyboardConfig = ReadStruct<SoftwareKeyboardConfig>(keyboardConfig);
|
||||||
|
|
||||||
|
if (_keyboardConfig.UseUtf8)
|
||||||
|
{
|
||||||
|
_encoding = Encoding.UTF8;
|
||||||
|
}
|
||||||
|
|
||||||
_state = SoftwareKeyboardState.Ready;
|
_state = SoftwareKeyboardState.Ready;
|
||||||
|
|
||||||
Execute();
|
Execute();
|
||||||
|
@ -58,9 +64,9 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
{
|
{
|
||||||
// If the keyboard type is numbers only, we swap to a default
|
// If the keyboard type is numbers only, we swap to a default
|
||||||
// text that only contains numbers.
|
// text that only contains numbers.
|
||||||
if (_keyboardConfig.Type == SoftwareKeyboardType.NumbersOnly)
|
if (_keyboardConfig.Mode == KeyboardMode.NumbersOnly)
|
||||||
{
|
{
|
||||||
_textValue = DEFAULT_NUMB;
|
_textValue = DefaultNumb;
|
||||||
}
|
}
|
||||||
|
|
||||||
// If the max string length is 0, we set it to a large default
|
// If the max string length is 0, we set it to a large default
|
||||||
|
@ -70,6 +76,15 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
_keyboardConfig.StringLengthMax = 100;
|
_keyboardConfig.StringLengthMax = 100;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
// If the game requests a string with a minimum length less
|
||||||
|
// than our default text, repeat our default text until we meet
|
||||||
|
// the minimum length requirement.
|
||||||
|
// This should always be done before the text truncation step.
|
||||||
|
while (_textValue.Length < _keyboardConfig.StringLengthMin)
|
||||||
|
{
|
||||||
|
_textValue = String.Join(" ", _textValue, _textValue);
|
||||||
|
}
|
||||||
|
|
||||||
// If our default text is longer than the allowed length,
|
// If our default text is longer than the allowed length,
|
||||||
// we truncate it.
|
// we truncate it.
|
||||||
if (_textValue.Length > _keyboardConfig.StringLengthMax)
|
if (_textValue.Length > _keyboardConfig.StringLengthMax)
|
||||||
|
@ -77,7 +92,18 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
_textValue = _textValue.Substring(0, (int)_keyboardConfig.StringLengthMax);
|
_textValue = _textValue.Substring(0, (int)_keyboardConfig.StringLengthMax);
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!_keyboardConfig.CheckText)
|
// Does the application want to validate the text itself?
|
||||||
|
if (_keyboardConfig.CheckText)
|
||||||
|
{
|
||||||
|
// The application needs to validate the response, so we
|
||||||
|
// submit it to the interactive output buffer, and poll it
|
||||||
|
// for validation. Once validated, the application will submit
|
||||||
|
// back a validation status, which is handled in OnInteractiveDataPushIn.
|
||||||
|
_state = SoftwareKeyboardState.ValidationPending;
|
||||||
|
|
||||||
|
_interactiveSession.Push(BuildResponse(_textValue, true));
|
||||||
|
}
|
||||||
|
else
|
||||||
{
|
{
|
||||||
// If the application doesn't need to validate the response,
|
// If the application doesn't need to validate the response,
|
||||||
// we push the data to the non-interactive output buffer
|
// we push the data to the non-interactive output buffer
|
||||||
|
@ -88,16 +114,6 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
|
|
||||||
AppletStateChanged?.Invoke(this, null);
|
AppletStateChanged?.Invoke(this, null);
|
||||||
}
|
}
|
||||||
else
|
|
||||||
{
|
|
||||||
// The application needs to validate the response, so we
|
|
||||||
// submit it to the interactive output buffer, and poll it
|
|
||||||
// for validation. Once validated, the application will submit
|
|
||||||
// back a validation status, which is handled in OnInteractiveDataPushIn.
|
|
||||||
_state = SoftwareKeyboardState.ValidationPending;
|
|
||||||
|
|
||||||
_interactiveSession.Push(BuildResponse(_textValue, true));
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
private void OnInteractiveData(object sender, EventArgs e)
|
private void OnInteractiveData(object sender, EventArgs e)
|
||||||
|
@ -136,12 +152,12 @@ namespace Ryujinx.HLE.HOS.Applets
|
||||||
|
|
||||||
private byte[] BuildResponse(string text, bool interactive)
|
private byte[] BuildResponse(string text, bool interactive)
|
||||||
{
|
{
|
||||||
int bufferSize = !interactive ? STANDARD_BUFFER_SIZE : INTERACTIVE_BUFFER_SIZE;
|
int bufferSize = interactive ? InteractiveBufferSize : StandardBufferSize;
|
||||||
|
|
||||||
using (MemoryStream stream = new MemoryStream(new byte[bufferSize]))
|
using (MemoryStream stream = new MemoryStream(new byte[bufferSize]))
|
||||||
using (BinaryWriter writer = new BinaryWriter(stream))
|
using (BinaryWriter writer = new BinaryWriter(stream))
|
||||||
{
|
{
|
||||||
byte[] output = Encoding.Unicode.GetBytes(text);
|
byte[] output = _encoding.GetBytes(text);
|
||||||
|
|
||||||
if (!interactive)
|
if (!interactive)
|
||||||
{
|
{
|
||||||
|
|
|
@ -2,32 +2,137 @@
|
||||||
|
|
||||||
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
||||||
{
|
{
|
||||||
// TODO(jduncanator): Define all fields
|
/// <summary>
|
||||||
[StructLayout(LayoutKind.Explicit)]
|
/// A structure that defines the configuration options of the software keyboard.
|
||||||
|
/// </summary>
|
||||||
|
[StructLayout(LayoutKind.Sequential, CharSet = CharSet.Unicode)]
|
||||||
struct SoftwareKeyboardConfig
|
struct SoftwareKeyboardConfig
|
||||||
{
|
{
|
||||||
|
private const int SubmitTextLength = 8;
|
||||||
|
private const int HeaderTextLength = 64;
|
||||||
|
private const int SubtitleTextLength = 128;
|
||||||
|
private const int GuideTextLength = 256;
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// Type of keyboard.
|
/// Type of keyboard.
|
||||||
/// </summary>
|
/// </summary>
|
||||||
[FieldOffset(0x0)]
|
public KeyboardMode Mode;
|
||||||
public SoftwareKeyboardType Type;
|
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// When non-zero, specifies the max string length. When the input is too long, swkbd will stop accepting more input until text is deleted via the B button (Backspace).
|
/// The string displayed in the Submit button.
|
||||||
/// </summary>
|
/// </summary>
|
||||||
[FieldOffset(0x3AC)]
|
[MarshalAs(UnmanagedType.ByValTStr, SizeConst = SubmitTextLength + 1)]
|
||||||
public uint StringLengthMax;
|
public string SubmitText;
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// When non-zero, specifies the max string length. When the input is too long, swkbd will display an icon and disable the ok-button.
|
/// The character displayed in the left button of the numeric keyboard.
|
||||||
|
/// This is ignored when Mode is not set to NumbersOnly.
|
||||||
/// </summary>
|
/// </summary>
|
||||||
[FieldOffset(0x3B0)]
|
public char LeftOptionalSymbolKey;
|
||||||
public uint StringLengthMaxExtended;
|
|
||||||
|
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// When set, the application will validate the entered text whilst the swkbd is still on screen.
|
/// The character displayed in the right button of the numeric keyboard.
|
||||||
|
/// This is ignored when Mode is not set to NumbersOnly.
|
||||||
/// </summary>
|
/// </summary>
|
||||||
[FieldOffset(0x3D0), MarshalAs(UnmanagedType.I1)]
|
public char RightOptionalSymbolKey;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When set, predictive typing is enabled making use of the system dictionary,
|
||||||
|
/// and any custom user dictionary.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.I1)]
|
||||||
|
public bool PredictionEnabled;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Specifies prohibited characters that cannot be input into the text entry area.
|
||||||
|
/// </summary>
|
||||||
|
public InvalidCharFlags InvalidCharFlag;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The initial position of the text cursor displayed in the text entry area.
|
||||||
|
/// </summary>
|
||||||
|
public InitialCursorPosition InitialCursorPosition;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The string displayed in the header area of the keyboard.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.ByValTStr, SizeConst = HeaderTextLength + 1)]
|
||||||
|
public string HeaderText;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The string displayed in the subtitle area of the keyboard.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.ByValTStr, SizeConst = SubtitleTextLength + 1)]
|
||||||
|
public string SubtitleText;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// The placeholder string displayed in the text entry area when no text is entered.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.ByValTStr, SizeConst = GuideTextLength + 1)]
|
||||||
|
public string GuideText;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When non-zero, specifies the maximum allowed length of the string entered into the text entry area.
|
||||||
|
/// </summary>
|
||||||
|
public int StringLengthMax;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When non-zero, specifies the minimum allowed length of the string entered into the text entry area.
|
||||||
|
/// </summary>
|
||||||
|
public int StringLengthMin;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When enabled, hides input characters as dots in the text entry area.
|
||||||
|
/// </summary>
|
||||||
|
public PasswordMode PasswordMode;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Specifies whether the text entry area is displayed as a single-line entry, or a multi-line entry field.
|
||||||
|
/// </summary>
|
||||||
|
public InputFormMode InputFormMode;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When set, enables or disables the return key. This value is ignored when single-line entry is specified as the InputFormMode.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.I1)]
|
||||||
|
public bool UseNewLine;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When set, the software keyboard will return a UTF-8 encoded string, rather than UTF-16.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.I1)]
|
||||||
|
public bool UseUtf8;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When set, the software keyboard will blur the game application rendered behind the keyboard.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.I1)]
|
||||||
|
public bool UseBlurBackground;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Offset into the work buffer of the initial text when the keyboard is first displayed.
|
||||||
|
/// </summary>
|
||||||
|
public int InitialStringOffset;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Length of the initial text.
|
||||||
|
/// </summary>
|
||||||
|
public int InitialStringLength;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Offset into the work buffer of the custom user dictionary.
|
||||||
|
/// </summary>
|
||||||
|
public int CustomDictionaryOffset;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// Number of entries in the custom user dictionary.
|
||||||
|
/// </summary>
|
||||||
|
public int CustomDictionaryCount;
|
||||||
|
|
||||||
|
/// <summary>
|
||||||
|
/// When set, the text entered will be validated on the application side after the keyboard has been submitted.
|
||||||
|
/// </summary>
|
||||||
|
[MarshalAs(UnmanagedType.I1)]
|
||||||
public bool CheckText;
|
public bool CheckText;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,6 +1,9 @@
|
||||||
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
||||||
{
|
{
|
||||||
internal enum SoftwareKeyboardState
|
/// <summary>
|
||||||
|
/// Identifies the software keyboard state.
|
||||||
|
/// </summary>
|
||||||
|
enum SoftwareKeyboardState
|
||||||
{
|
{
|
||||||
/// <summary>
|
/// <summary>
|
||||||
/// swkbd is uninitialized.
|
/// swkbd is uninitialized.
|
||||||
|
|
|
@ -1,20 +0,0 @@
|
||||||
namespace Ryujinx.HLE.HOS.Applets.SoftwareKeyboard
|
|
||||||
{
|
|
||||||
internal enum SoftwareKeyboardType : uint
|
|
||||||
{
|
|
||||||
/// <summary>
|
|
||||||
/// Normal keyboard.
|
|
||||||
/// </summary>
|
|
||||||
Default = 0,
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Number pad. The buttons at the bottom left/right are only available when they're set in the config by leftButtonText / rightButtonText.
|
|
||||||
/// </summary>
|
|
||||||
NumbersOnly = 1,
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// QWERTY (and variants) keyboard only.
|
|
||||||
/// </summary>
|
|
||||||
LettersOnly = 2
|
|
||||||
}
|
|
||||||
}
|
|
|
@ -8,6 +8,26 @@ namespace Ryujinx.HLE.HOS.Services.Lm.LogService
|
||||||
{
|
{
|
||||||
public ILogger() { }
|
public ILogger() { }
|
||||||
|
|
||||||
|
private static int ReadEncodedInt(BinaryReader reader)
|
||||||
|
{
|
||||||
|
int result = 0;
|
||||||
|
int position = 0;
|
||||||
|
|
||||||
|
byte encoded;
|
||||||
|
|
||||||
|
do
|
||||||
|
{
|
||||||
|
encoded = reader.ReadByte();
|
||||||
|
|
||||||
|
result += (encoded & 0x7F) << (7 * position);
|
||||||
|
|
||||||
|
position++;
|
||||||
|
|
||||||
|
} while ((encoded & 0x80) != 0);
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
[Command(0)]
|
[Command(0)]
|
||||||
// Log(buffer<unknown, 0x21>)
|
// Log(buffer<unknown, 0x21>)
|
||||||
public ResultCode Log(ServiceCtx context)
|
public ResultCode Log(ServiceCtx context)
|
||||||
|
@ -34,8 +54,8 @@ namespace Ryujinx.HLE.HOS.Services.Lm.LogService
|
||||||
|
|
||||||
while (ms.Position < ms.Length)
|
while (ms.Position < ms.Length)
|
||||||
{
|
{
|
||||||
byte type = reader.ReadByte();
|
int type = ReadEncodedInt(reader);
|
||||||
byte size = reader.ReadByte();
|
int size = ReadEncodedInt(reader);
|
||||||
|
|
||||||
LmLogField field = (LmLogField)type;
|
LmLogField field = (LmLogField)type;
|
||||||
|
|
||||||
|
|
|
@ -1,11 +1,12 @@
|
||||||
using Ryujinx.Common;
|
using Ryujinx.Common.Logging;
|
||||||
using Ryujinx.Common.Logging;
|
|
||||||
using Ryujinx.HLE.Utilities;
|
using Ryujinx.HLE.Utilities;
|
||||||
|
using System;
|
||||||
using System.Buffers.Binary;
|
using System.Buffers.Binary;
|
||||||
using System.Collections.Generic;
|
using System.Collections.Generic;
|
||||||
using System.Net;
|
using System.Net;
|
||||||
using System.Net.Sockets;
|
using System.Net.Sockets;
|
||||||
using System.Text;
|
using System.Text;
|
||||||
|
using System.Threading;
|
||||||
|
|
||||||
namespace Ryujinx.HLE.HOS.Services.Sockets.Bsd
|
namespace Ryujinx.HLE.HOS.Services.Sockets.Bsd
|
||||||
{
|
{
|
||||||
|
@ -379,13 +380,26 @@ namespace Ryujinx.HLE.HOS.Services.Sockets.Bsd
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
try
|
if (fdsCount != 0)
|
||||||
{
|
{
|
||||||
System.Net.Sockets.Socket.Select(readEvents, writeEvents, errorEvents, timeout);
|
try
|
||||||
|
{
|
||||||
|
System.Net.Sockets.Socket.Select(readEvents, writeEvents, errorEvents, timeout);
|
||||||
|
}
|
||||||
|
catch (SocketException exception)
|
||||||
|
{
|
||||||
|
return WriteWinSock2Error(context, (WsaError)exception.ErrorCode);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
catch (SocketException exception)
|
else if (timeout == -1)
|
||||||
{
|
{
|
||||||
return WriteWinSock2Error(context, (WsaError)exception.ErrorCode);
|
// FIXME: If we get a timeout of -1 and there is no fds to wait on, this should kill the KProces. (need to check that with re)
|
||||||
|
throw new InvalidOperationException();
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
// FIXME: We should make the KThread sleep but we can't do much about it yet.
|
||||||
|
Thread.Sleep(timeout);
|
||||||
}
|
}
|
||||||
|
|
||||||
for (int i = 0; i < fdsCount; i++)
|
for (int i = 0; i < fdsCount; i++)
|
||||||
|
|
|
@ -1,5 +1,7 @@
|
||||||
using Ryujinx.Common;
|
using Ryujinx.Common;
|
||||||
|
using Ryujinx.Configuration.Hid;
|
||||||
using Ryujinx.HLE.HOS;
|
using Ryujinx.HLE.HOS;
|
||||||
|
using System;
|
||||||
|
|
||||||
namespace Ryujinx.HLE.Input
|
namespace Ryujinx.HLE.Input
|
||||||
{
|
{
|
||||||
|
@ -47,18 +49,31 @@ namespace Ryujinx.HLE.Input
|
||||||
_keyboardOffset = HidPosition + HidKeyboardOffset;
|
_keyboardOffset = HidPosition + HidKeyboardOffset;
|
||||||
}
|
}
|
||||||
|
|
||||||
public void InitializePrimaryController(ControllerStatus controllerType)
|
private static ControllerStatus ConvertControllerTypeToState(ControllerType controllerType)
|
||||||
{
|
{
|
||||||
ControllerId controllerId = controllerType == ControllerStatus.Handheld ?
|
switch (controllerType)
|
||||||
|
{
|
||||||
|
case ControllerType.Handheld: return ControllerStatus.Handheld;
|
||||||
|
case ControllerType.NpadLeft: return ControllerStatus.NpadLeft;
|
||||||
|
case ControllerType.NpadRight: return ControllerStatus.NpadRight;
|
||||||
|
case ControllerType.NpadPair: return ControllerStatus.NpadPair;
|
||||||
|
case ControllerType.ProController: return ControllerStatus.ProController;
|
||||||
|
default: throw new NotImplementedException();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public void InitializePrimaryController(ControllerType controllerType)
|
||||||
|
{
|
||||||
|
ControllerId controllerId = controllerType == ControllerType.Handheld ?
|
||||||
ControllerId.ControllerHandheld : ControllerId.ControllerPlayer1;
|
ControllerId.ControllerHandheld : ControllerId.ControllerPlayer1;
|
||||||
|
|
||||||
if (controllerType == ControllerStatus.ProController)
|
if (controllerType == ControllerType.ProController)
|
||||||
{
|
{
|
||||||
PrimaryController = new ProController(_device, NpadColor.Black, NpadColor.Black);
|
PrimaryController = new ProController(_device, NpadColor.Black, NpadColor.Black);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
PrimaryController = new NpadController(controllerType,
|
PrimaryController = new NpadController(ConvertControllerTypeToState(controllerType),
|
||||||
_device,
|
_device,
|
||||||
(NpadColor.BodyNeonRed, NpadColor.BodyNeonRed),
|
(NpadColor.BodyNeonRed, NpadColor.BodyNeonRed),
|
||||||
(NpadColor.ButtonsNeonBlue, NpadColor.ButtonsNeonBlue));
|
(NpadColor.ButtonsNeonBlue, NpadColor.ButtonsNeonBlue));
|
||||||
|
@ -67,11 +82,6 @@ namespace Ryujinx.HLE.Input
|
||||||
PrimaryController.Connect(controllerId);
|
PrimaryController.Connect(controllerId);
|
||||||
}
|
}
|
||||||
|
|
||||||
public void InitializeKeyboard()
|
|
||||||
{
|
|
||||||
_device.Memory.FillWithZeros(HidPosition + HidKeyboardOffset, HidKeyboardSize);
|
|
||||||
}
|
|
||||||
|
|
||||||
public ControllerButtons UpdateStickButtons(
|
public ControllerButtons UpdateStickButtons(
|
||||||
JoystickPosition leftStick,
|
JoystickPosition leftStick,
|
||||||
JoystickPosition rightStick)
|
JoystickPosition rightStick)
|
||||||
|
|
|
@ -1,8 +1,12 @@
|
||||||
|
using LibHac.FsSystem;
|
||||||
using Ryujinx.Audio;
|
using Ryujinx.Audio;
|
||||||
|
using Ryujinx.Configuration;
|
||||||
using Ryujinx.Graphics;
|
using Ryujinx.Graphics;
|
||||||
using Ryujinx.Graphics.Gal;
|
using Ryujinx.Graphics.Gal;
|
||||||
using Ryujinx.HLE.FileSystem;
|
using Ryujinx.HLE.FileSystem;
|
||||||
using Ryujinx.HLE.HOS;
|
using Ryujinx.HLE.HOS;
|
||||||
|
using Ryujinx.HLE.HOS.Services;
|
||||||
|
using Ryujinx.HLE.HOS.SystemState;
|
||||||
using Ryujinx.HLE.Input;
|
using Ryujinx.HLE.Input;
|
||||||
using System;
|
using System;
|
||||||
using System.Threading;
|
using System.Threading;
|
||||||
|
@ -60,6 +64,29 @@ namespace Ryujinx.HLE
|
||||||
VsyncEvent = new AutoResetEvent(true);
|
VsyncEvent = new AutoResetEvent(true);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public void Initialize()
|
||||||
|
{
|
||||||
|
System.State.SetLanguage((SystemLanguage)ConfigurationState.Instance.System.Language.Value);
|
||||||
|
|
||||||
|
EnableDeviceVsync = ConfigurationState.Instance.Graphics.EnableVsync;
|
||||||
|
|
||||||
|
// TODO: Make this reloadable and implement Docking/Undocking logic.
|
||||||
|
System.State.DockedMode = ConfigurationState.Instance.System.EnableDockedMode;
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.System.EnableMulticoreScheduling)
|
||||||
|
{
|
||||||
|
System.EnableMultiCoreScheduling();
|
||||||
|
}
|
||||||
|
|
||||||
|
System.FsIntegrityCheckLevel = ConfigurationState.Instance.System.EnableFsIntegrityChecks
|
||||||
|
? IntegrityCheckLevel.ErrorOnInvalid
|
||||||
|
: IntegrityCheckLevel.None;
|
||||||
|
|
||||||
|
System.GlobalAccessLogMode = ConfigurationState.Instance.System.FsGlobalAccessLogMode;
|
||||||
|
|
||||||
|
ServiceConfiguration.IgnoreMissingServices = ConfigurationState.Instance.System.IgnoreMissingServices;
|
||||||
|
}
|
||||||
|
|
||||||
public void LoadCart(string exeFsDir, string romFsFile = null)
|
public void LoadCart(string exeFsDir, string romFsFile = null)
|
||||||
{
|
{
|
||||||
System.LoadCart(exeFsDir, romFsFile);
|
System.LoadCart(exeFsDir, romFsFile);
|
||||||
|
|
|
@ -1,4 +1,5 @@
|
||||||
{
|
{
|
||||||
|
"version": 1,
|
||||||
"graphics_shaders_dump_path": "",
|
"graphics_shaders_dump_path": "",
|
||||||
"logging_enable_debug": false,
|
"logging_enable_debug": false,
|
||||||
"logging_enable_stub": true,
|
"logging_enable_stub": true,
|
||||||
|
@ -7,9 +8,7 @@
|
||||||
"logging_enable_error": true,
|
"logging_enable_error": true,
|
||||||
"logging_enable_guest": true,
|
"logging_enable_guest": true,
|
||||||
"logging_enable_fs_access_log": false,
|
"logging_enable_fs_access_log": false,
|
||||||
"logging_filtered_classes": [
|
"logging_filtered_classes": [],
|
||||||
|
|
||||||
],
|
|
||||||
"enable_file_log": true,
|
"enable_file_log": true,
|
||||||
"system_language": "AmericanEnglish",
|
"system_language": "AmericanEnglish",
|
||||||
"docked_mode": false,
|
"docked_mode": false,
|
||||||
|
@ -32,9 +31,7 @@
|
||||||
"file_size_column": true,
|
"file_size_column": true,
|
||||||
"path_column": true
|
"path_column": true
|
||||||
},
|
},
|
||||||
"game_dirs": [
|
"game_dirs": [],
|
||||||
|
|
||||||
],
|
|
||||||
"enable_custom_theme": false,
|
"enable_custom_theme": false,
|
||||||
"custom_theme_path": "",
|
"custom_theme_path": "",
|
||||||
"enable_keyboard": false,
|
"enable_keyboard": false,
|
||||||
|
|
92
Ryujinx/Configuration/DiscordIntegrationModule.cs
Normal file
92
Ryujinx/Configuration/DiscordIntegrationModule.cs
Normal file
|
@ -0,0 +1,92 @@
|
||||||
|
using DiscordRPC;
|
||||||
|
using Ryujinx.Common;
|
||||||
|
using System;
|
||||||
|
using System.IO;
|
||||||
|
using System.Linq;
|
||||||
|
|
||||||
|
namespace Ryujinx.Configuration
|
||||||
|
{
|
||||||
|
static class DiscordIntegrationModule
|
||||||
|
{
|
||||||
|
private static DiscordRpcClient DiscordClient;
|
||||||
|
|
||||||
|
private static string LargeDescription = "Ryujinx is a Nintendo Switch emulator.";
|
||||||
|
|
||||||
|
public static RichPresence DiscordPresence { get; private set; }
|
||||||
|
|
||||||
|
public static void Initialize()
|
||||||
|
{
|
||||||
|
DiscordPresence = new RichPresence
|
||||||
|
{
|
||||||
|
Assets = new Assets
|
||||||
|
{
|
||||||
|
LargeImageKey = "ryujinx",
|
||||||
|
LargeImageText = LargeDescription
|
||||||
|
},
|
||||||
|
Details = "Main Menu",
|
||||||
|
State = "Idling",
|
||||||
|
Timestamps = new Timestamps(DateTime.UtcNow)
|
||||||
|
};
|
||||||
|
|
||||||
|
ConfigurationState.Instance.EnableDiscordIntegration.Event += Update;
|
||||||
|
}
|
||||||
|
|
||||||
|
private static void Update(object sender, ReactiveEventArgs<bool> e)
|
||||||
|
{
|
||||||
|
if (e.OldValue != e.NewValue)
|
||||||
|
{
|
||||||
|
// If the integration was active, disable it and unload everything
|
||||||
|
if (e.OldValue)
|
||||||
|
{
|
||||||
|
DiscordClient?.Dispose();
|
||||||
|
|
||||||
|
DiscordClient = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If we need to activate it and the client isn't active, initialize it
|
||||||
|
if (e.NewValue && DiscordClient == null)
|
||||||
|
{
|
||||||
|
DiscordClient = new DiscordRpcClient("568815339807309834");
|
||||||
|
|
||||||
|
DiscordClient.Initialize();
|
||||||
|
DiscordClient.SetPresence(DiscordPresence);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static void SwitchToPlayingState(string titleId, string titleName)
|
||||||
|
{
|
||||||
|
if (File.ReadAllLines(Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "RPsupported.dat")).Contains(titleId))
|
||||||
|
{
|
||||||
|
DiscordPresence.Assets.LargeImageKey = titleId;
|
||||||
|
}
|
||||||
|
|
||||||
|
string state = titleId;
|
||||||
|
|
||||||
|
if (state == null)
|
||||||
|
{
|
||||||
|
state = "Ryujinx";
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
state = state.ToUpper();
|
||||||
|
}
|
||||||
|
|
||||||
|
string details = "Idling";
|
||||||
|
|
||||||
|
if (titleName != null)
|
||||||
|
{
|
||||||
|
details = $"Playing {titleName}";
|
||||||
|
}
|
||||||
|
|
||||||
|
DiscordPresence.Details = details;
|
||||||
|
DiscordPresence.State = state;
|
||||||
|
DiscordPresence.Assets.LargeImageText = titleName;
|
||||||
|
DiscordPresence.Assets.SmallImageKey = "ryujinx";
|
||||||
|
DiscordPresence.Assets.SmallImageText = LargeDescription;
|
||||||
|
DiscordPresence.Timestamps = new Timestamps(DateTime.UtcNow);
|
||||||
|
|
||||||
|
DiscordClient?.SetPresence(DiscordPresence);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
|
@ -1,5 +1,6 @@
|
||||||
using Gtk;
|
using Gtk;
|
||||||
using Ryujinx.Common.Logging;
|
using Ryujinx.Common.Logging;
|
||||||
|
using Ryujinx.Configuration;
|
||||||
using Ryujinx.Profiler;
|
using Ryujinx.Profiler;
|
||||||
using Ryujinx.Ui;
|
using Ryujinx.Ui;
|
||||||
using System;
|
using System;
|
||||||
|
@ -16,9 +17,32 @@ namespace Ryujinx
|
||||||
string systemPath = Environment.GetEnvironmentVariable("Path", EnvironmentVariableTarget.Machine);
|
string systemPath = Environment.GetEnvironmentVariable("Path", EnvironmentVariableTarget.Machine);
|
||||||
Environment.SetEnvironmentVariable("Path", $"{Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "bin")};{systemPath}");
|
Environment.SetEnvironmentVariable("Path", $"{Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "bin")};{systemPath}");
|
||||||
|
|
||||||
AppDomain.CurrentDomain.UnhandledException += CurrentDomain_UnhandledException;
|
GLib.ExceptionManager.UnhandledException += Glib_UnhandledException;
|
||||||
AppDomain.CurrentDomain.ProcessExit += CurrentDomain_ProcessExit;
|
|
||||||
GLib.ExceptionManager.UnhandledException += Glib_UnhandledException;
|
// Initialize the configuration
|
||||||
|
ConfigurationState.Initialize();
|
||||||
|
|
||||||
|
// Initialize the logger system
|
||||||
|
LoggerModule.Initialize();
|
||||||
|
|
||||||
|
// Initialize Discord integration
|
||||||
|
DiscordIntegrationModule.Initialize();
|
||||||
|
|
||||||
|
string configurationPath = Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json");
|
||||||
|
|
||||||
|
// Now load the configuration as the other subsystems are now registered
|
||||||
|
if (File.Exists(configurationPath))
|
||||||
|
{
|
||||||
|
ConfigurationFileFormat configurationFileFormat = ConfigurationFileFormat.Load(configurationPath);
|
||||||
|
ConfigurationState.Instance.Load(configurationFileFormat);
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
// No configuration, we load the default values and save it on disk
|
||||||
|
ConfigurationState.Instance.LoadDefault();
|
||||||
|
ConfigurationState.Instance.ToFileFormat().SaveConfig(configurationPath);
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
Profile.Initialize();
|
Profile.Initialize();
|
||||||
|
|
||||||
|
@ -42,23 +66,6 @@ namespace Ryujinx
|
||||||
Application.Run();
|
Application.Run();
|
||||||
}
|
}
|
||||||
|
|
||||||
private static void CurrentDomain_ProcessExit(object sender, EventArgs e)
|
|
||||||
{
|
|
||||||
Logger.Shutdown();
|
|
||||||
}
|
|
||||||
|
|
||||||
private static void CurrentDomain_UnhandledException(object sender, UnhandledExceptionEventArgs e)
|
|
||||||
{
|
|
||||||
Exception exception = e.ExceptionObject as Exception;
|
|
||||||
|
|
||||||
Logger.PrintError(LogClass.Emulation, $"Unhandled exception caught: {exception}");
|
|
||||||
|
|
||||||
if (e.IsTerminating)
|
|
||||||
{
|
|
||||||
Logger.Shutdown();
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
private static void Glib_UnhandledException(GLib.UnhandledExceptionArgs e)
|
private static void Glib_UnhandledException(GLib.UnhandledExceptionArgs e)
|
||||||
{
|
{
|
||||||
Exception exception = e.ExceptionObject as Exception;
|
Exception exception = e.ExceptionObject as Exception;
|
||||||
|
|
|
@ -43,6 +43,7 @@
|
||||||
<None Remove="Ui\assets\PatreonLogo.png" />
|
<None Remove="Ui\assets\PatreonLogo.png" />
|
||||||
<None Remove="Ui\assets\Icon.png" />
|
<None Remove="Ui\assets\Icon.png" />
|
||||||
<None Remove="Ui\assets\TwitterLogo.png" />
|
<None Remove="Ui\assets\TwitterLogo.png" />
|
||||||
|
<None Remove="Ui\GameTableContextMenu.glade" />
|
||||||
<None Remove="Ui\MainWindow.glade" />
|
<None Remove="Ui\MainWindow.glade" />
|
||||||
<None Remove="Ui\SwitchSettings.glade" />
|
<None Remove="Ui\SwitchSettings.glade" />
|
||||||
</ItemGroup>
|
</ItemGroup>
|
||||||
|
@ -63,6 +64,7 @@
|
||||||
<EmbeddedResource Include="Ui\assets\PatreonLogo.png" />
|
<EmbeddedResource Include="Ui\assets\PatreonLogo.png" />
|
||||||
<EmbeddedResource Include="Ui\assets\Icon.png" />
|
<EmbeddedResource Include="Ui\assets\Icon.png" />
|
||||||
<EmbeddedResource Include="Ui\assets\TwitterLogo.png" />
|
<EmbeddedResource Include="Ui\assets\TwitterLogo.png" />
|
||||||
|
<EmbeddedResource Include="Ui\GameTableContextMenu.glade" />
|
||||||
<EmbeddedResource Include="Ui\MainWindow.glade" />
|
<EmbeddedResource Include="Ui\MainWindow.glade" />
|
||||||
<EmbeddedResource Include="Ui\SwitchSettings.glade" />
|
<EmbeddedResource Include="Ui\SwitchSettings.glade" />
|
||||||
</ItemGroup>
|
</ItemGroup>
|
||||||
|
@ -71,7 +73,6 @@
|
||||||
<PackageReference Include="DiscordRichPresence" Version="1.0.121" />
|
<PackageReference Include="DiscordRichPresence" Version="1.0.121" />
|
||||||
<PackageReference Include="GtkSharp" Version="3.22.25.24" />
|
<PackageReference Include="GtkSharp" Version="3.22.25.24" />
|
||||||
<PackageReference Include="GtkSharp.Dependencies" Version="1.1.0" Condition="'$(RuntimeIdentifier)' != 'linux-x64' AND '$(RuntimeIdentifier)' != 'osx-x64'" />
|
<PackageReference Include="GtkSharp.Dependencies" Version="1.1.0" Condition="'$(RuntimeIdentifier)' != 'linux-x64' AND '$(RuntimeIdentifier)' != 'osx-x64'" />
|
||||||
<PackageReference Include="JsonPrettyPrinter" Version="1.0.1.1" />
|
|
||||||
<PackageReference Include="OpenTK.NetStandard" Version="1.0.4" />
|
<PackageReference Include="OpenTK.NetStandard" Version="1.0.4" />
|
||||||
</ItemGroup>
|
</ItemGroup>
|
||||||
|
|
||||||
|
|
|
@ -1,10 +1,12 @@
|
||||||
using OpenTK;
|
using OpenTK;
|
||||||
using OpenTK.Graphics;
|
using OpenTK.Graphics;
|
||||||
using OpenTK.Input;
|
using OpenTK.Input;
|
||||||
|
using Ryujinx.Configuration;
|
||||||
using Ryujinx.Graphics.Gal;
|
using Ryujinx.Graphics.Gal;
|
||||||
using Ryujinx.HLE;
|
using Ryujinx.HLE;
|
||||||
using Ryujinx.HLE.Input;
|
using Ryujinx.HLE.Input;
|
||||||
using Ryujinx.Profiler.UI;
|
using Ryujinx.Profiler.UI;
|
||||||
|
using Ryujinx.Ui;
|
||||||
using System;
|
using System;
|
||||||
using System.Threading;
|
using System.Threading;
|
||||||
|
|
||||||
|
@ -29,6 +31,8 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
private MouseState? _mouse = null;
|
private MouseState? _mouse = null;
|
||||||
|
|
||||||
|
private Input.NpadController _primaryController;
|
||||||
|
|
||||||
private Thread _renderThread;
|
private Thread _renderThread;
|
||||||
|
|
||||||
private bool _resizeEvent;
|
private bool _resizeEvent;
|
||||||
|
@ -50,6 +54,8 @@ namespace Ryujinx.Ui
|
||||||
_device = device;
|
_device = device;
|
||||||
_renderer = renderer;
|
_renderer = renderer;
|
||||||
|
|
||||||
|
_primaryController = new Input.NpadController(ConfigurationState.Instance.Hid.JoystickControls);
|
||||||
|
|
||||||
Location = new Point(
|
Location = new Point(
|
||||||
(DisplayDevice.Default.Width / 2) - (Width / 2),
|
(DisplayDevice.Default.Width / 2) - (Width / 2),
|
||||||
(DisplayDevice.Default.Height / 2) - (Height / 2));
|
(DisplayDevice.Default.Height / 2) - (Height / 2));
|
||||||
|
@ -162,16 +168,16 @@ namespace Ryujinx.Ui
|
||||||
#endif
|
#endif
|
||||||
|
|
||||||
// Normal Input
|
// Normal Input
|
||||||
currentHotkeyButtons = Configuration.Instance.KeyboardControls.GetHotkeyButtons(keyboard);
|
currentHotkeyButtons = KeyboardControls.GetHotkeyButtons(ConfigurationState.Instance.Hid.KeyboardControls, keyboard);
|
||||||
currentButton = Configuration.Instance.KeyboardControls.GetButtons(keyboard);
|
currentButton = KeyboardControls.GetButtons(ConfigurationState.Instance.Hid.KeyboardControls, keyboard);
|
||||||
|
|
||||||
if (Configuration.Instance.EnableKeyboard)
|
if (ConfigurationState.Instance.Hid.EnableKeyboard)
|
||||||
{
|
{
|
||||||
hidKeyboard = Configuration.Instance.KeyboardControls.GetKeysDown(keyboard);
|
hidKeyboard = KeyboardControls.GetKeysDown(ConfigurationState.Instance.Hid.KeyboardControls, keyboard);
|
||||||
}
|
}
|
||||||
|
|
||||||
(leftJoystickDx, leftJoystickDy) = Configuration.Instance.KeyboardControls.GetLeftStick(keyboard);
|
(leftJoystickDx, leftJoystickDy) = KeyboardControls.GetLeftStick(ConfigurationState.Instance.Hid.KeyboardControls, keyboard);
|
||||||
(rightJoystickDx, rightJoystickDy) = Configuration.Instance.KeyboardControls.GetRightStick(keyboard);
|
(rightJoystickDx, rightJoystickDy) = KeyboardControls.GetRightStick(ConfigurationState.Instance.Hid.KeyboardControls, keyboard);
|
||||||
}
|
}
|
||||||
|
|
||||||
if (!hidKeyboard.HasValue)
|
if (!hidKeyboard.HasValue)
|
||||||
|
@ -183,17 +189,17 @@ namespace Ryujinx.Ui
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
currentButton |= Configuration.Instance.JoystickControls.GetButtons();
|
currentButton |= _primaryController.GetButtons();
|
||||||
|
|
||||||
// Keyboard has priority stick-wise
|
// Keyboard has priority stick-wise
|
||||||
if (leftJoystickDx == 0 && leftJoystickDy == 0)
|
if (leftJoystickDx == 0 && leftJoystickDy == 0)
|
||||||
{
|
{
|
||||||
(leftJoystickDx, leftJoystickDy) = Configuration.Instance.JoystickControls.GetLeftStick();
|
(leftJoystickDx, leftJoystickDy) = _primaryController.GetLeftStick();
|
||||||
}
|
}
|
||||||
|
|
||||||
if (rightJoystickDx == 0 && rightJoystickDy == 0)
|
if (rightJoystickDx == 0 && rightJoystickDy == 0)
|
||||||
{
|
{
|
||||||
(rightJoystickDx, rightJoystickDy) = Configuration.Instance.JoystickControls.GetRightStick();
|
(rightJoystickDx, rightJoystickDy) = _primaryController.GetRightStick();
|
||||||
}
|
}
|
||||||
|
|
||||||
leftJoystick = new JoystickPosition
|
leftJoystick = new JoystickPosition
|
||||||
|
@ -269,7 +275,7 @@ namespace Ryujinx.Ui
|
||||||
_device.Hid.SetTouchPoints();
|
_device.Hid.SetTouchPoints();
|
||||||
}
|
}
|
||||||
|
|
||||||
if (Configuration.Instance.EnableKeyboard && hidKeyboard.HasValue)
|
if (ConfigurationState.Instance.Hid.EnableKeyboard && hidKeyboard.HasValue)
|
||||||
{
|
{
|
||||||
_device.Hid.WriteKeyboard(hidKeyboard.Value);
|
_device.Hid.WriteKeyboard(hidKeyboard.Value);
|
||||||
}
|
}
|
||||||
|
|
75
Ryujinx/Ui/GameTableContextMenu.cs
Normal file
75
Ryujinx/Ui/GameTableContextMenu.cs
Normal file
|
@ -0,0 +1,75 @@
|
||||||
|
using Gtk;
|
||||||
|
using Ryujinx.HLE.FileSystem;
|
||||||
|
using System;
|
||||||
|
using System.Diagnostics;
|
||||||
|
using System.IO;
|
||||||
|
using System.Reflection;
|
||||||
|
|
||||||
|
using GUI = Gtk.Builder.ObjectAttribute;
|
||||||
|
|
||||||
|
namespace Ryujinx.Ui
|
||||||
|
{
|
||||||
|
public class GameTableContextMenu : Menu
|
||||||
|
{
|
||||||
|
private static ListStore _gameTableStore;
|
||||||
|
private static TreeIter _rowIter;
|
||||||
|
|
||||||
|
#pragma warning disable CS0649
|
||||||
|
#pragma warning disable IDE0044
|
||||||
|
[GUI] MenuItem _openSaveDir;
|
||||||
|
#pragma warning restore CS0649
|
||||||
|
#pragma warning restore IDE0044
|
||||||
|
|
||||||
|
public GameTableContextMenu(ListStore gameTableStore, TreeIter rowIter) : this(new Builder("Ryujinx.Ui.GameTableContextMenu.glade"), gameTableStore, rowIter) { }
|
||||||
|
|
||||||
|
private GameTableContextMenu(Builder builder, ListStore gameTableStore, TreeIter rowIter) : base(builder.GetObject("_contextMenu").Handle)
|
||||||
|
{
|
||||||
|
builder.Autoconnect(this);
|
||||||
|
|
||||||
|
_openSaveDir.Activated += OpenSaveDir_Clicked;
|
||||||
|
|
||||||
|
_gameTableStore = gameTableStore;
|
||||||
|
_rowIter = rowIter;
|
||||||
|
}
|
||||||
|
|
||||||
|
//Events
|
||||||
|
private void OpenSaveDir_Clicked(object sender, EventArgs args)
|
||||||
|
{
|
||||||
|
string titleName = _gameTableStore.GetValue(_rowIter, 2).ToString().Split("\n")[0];
|
||||||
|
string titleId = _gameTableStore.GetValue(_rowIter, 2).ToString().Split("\n")[1].ToLower();
|
||||||
|
string saveDir = System.IO.Path.Combine(new VirtualFileSystem().GetNandPath(), "user", "save", "0000000000000000", "00000000000000000000000000000001", titleId, "0");
|
||||||
|
|
||||||
|
if (!Directory.Exists(saveDir))
|
||||||
|
{
|
||||||
|
MessageDialog messageDialog = new MessageDialog(null, DialogFlags.Modal, MessageType.Question, ButtonsType.YesNo, null)
|
||||||
|
{
|
||||||
|
Title = "Ryujinx",
|
||||||
|
Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.Icon.png"),
|
||||||
|
Text = $"Could not find save directory for {titleName} [{titleId}]",
|
||||||
|
SecondaryText = "Would you like to create the directory?",
|
||||||
|
WindowPosition = WindowPosition.Center
|
||||||
|
};
|
||||||
|
|
||||||
|
if (messageDialog.Run() == (int)ResponseType.Yes)
|
||||||
|
{
|
||||||
|
Directory.CreateDirectory(saveDir);
|
||||||
|
}
|
||||||
|
else
|
||||||
|
{
|
||||||
|
messageDialog.Dispose();
|
||||||
|
|
||||||
|
return;
|
||||||
|
}
|
||||||
|
|
||||||
|
messageDialog.Dispose();
|
||||||
|
}
|
||||||
|
|
||||||
|
Process.Start(new ProcessStartInfo()
|
||||||
|
{
|
||||||
|
FileName = saveDir,
|
||||||
|
UseShellExecute = true,
|
||||||
|
Verb = "open"
|
||||||
|
});
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
18
Ryujinx/Ui/GameTableContextMenu.glade
Normal file
18
Ryujinx/Ui/GameTableContextMenu.glade
Normal file
|
@ -0,0 +1,18 @@
|
||||||
|
<?xml version="1.0" encoding="UTF-8"?>
|
||||||
|
<!-- Generated with glade 3.22.1 -->
|
||||||
|
<interface>
|
||||||
|
<requires lib="gtk+" version="3.20"/>
|
||||||
|
<object class="GtkMenu" id="_contextMenu">
|
||||||
|
<property name="visible">True</property>
|
||||||
|
<property name="can_focus">False</property>
|
||||||
|
<child>
|
||||||
|
<object class="GtkMenuItem" id="_openSaveDir">
|
||||||
|
<property name="visible">True</property>
|
||||||
|
<property name="can_focus">False</property>
|
||||||
|
<property name="tooltip_text" translatable="yes">Open the folder where saves for the application is loaded</property>
|
||||||
|
<property name="label" translatable="yes">Open Save Directory</property>
|
||||||
|
<property name="use_underline">True</property>
|
||||||
|
</object>
|
||||||
|
</child>
|
||||||
|
</object>
|
||||||
|
</interface>
|
|
@ -1,118 +1,67 @@
|
||||||
using OpenTK.Input;
|
using OpenTK.Input;
|
||||||
using Ryujinx.HLE.Input;
|
using Ryujinx.HLE.Input;
|
||||||
|
using Ryujinx.UI.Input;
|
||||||
|
|
||||||
namespace Ryujinx.Ui.Input
|
namespace Ryujinx.Ui
|
||||||
{
|
{
|
||||||
public struct NpadKeyboardLeft
|
public static class KeyboardControls
|
||||||
{
|
{
|
||||||
public Key StickUp;
|
public static ControllerButtons GetButtons(NpadKeyboard npad, KeyboardState keyboard)
|
||||||
public Key StickDown;
|
|
||||||
public Key StickLeft;
|
|
||||||
public Key StickRight;
|
|
||||||
public Key StickButton;
|
|
||||||
public Key DPadUp;
|
|
||||||
public Key DPadDown;
|
|
||||||
public Key DPadLeft;
|
|
||||||
public Key DPadRight;
|
|
||||||
public Key ButtonMinus;
|
|
||||||
public Key ButtonL;
|
|
||||||
public Key ButtonZl;
|
|
||||||
}
|
|
||||||
|
|
||||||
public struct NpadKeyboardRight
|
|
||||||
{
|
|
||||||
public Key StickUp;
|
|
||||||
public Key StickDown;
|
|
||||||
public Key StickLeft;
|
|
||||||
public Key StickRight;
|
|
||||||
public Key StickButton;
|
|
||||||
public Key ButtonA;
|
|
||||||
public Key ButtonB;
|
|
||||||
public Key ButtonX;
|
|
||||||
public Key ButtonY;
|
|
||||||
public Key ButtonPlus;
|
|
||||||
public Key ButtonR;
|
|
||||||
public Key ButtonZr;
|
|
||||||
}
|
|
||||||
|
|
||||||
public struct KeyboardHotkeys
|
|
||||||
{
|
|
||||||
public Key ToggleVsync;
|
|
||||||
}
|
|
||||||
|
|
||||||
public class NpadKeyboard
|
|
||||||
{
|
|
||||||
/// <summary>
|
|
||||||
/// Left JoyCon Keyboard Bindings
|
|
||||||
/// </summary>
|
|
||||||
public NpadKeyboardLeft LeftJoycon { get; set; }
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Right JoyCon Keyboard Bindings
|
|
||||||
/// </summary>
|
|
||||||
public NpadKeyboardRight RightJoycon { get; set; }
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Hotkey Keyboard Bindings
|
|
||||||
/// </summary>
|
|
||||||
public KeyboardHotkeys Hotkeys { get; private set; }
|
|
||||||
|
|
||||||
public ControllerButtons GetButtons(KeyboardState keyboard)
|
|
||||||
{
|
{
|
||||||
ControllerButtons buttons = 0;
|
ControllerButtons buttons = 0;
|
||||||
|
|
||||||
if (keyboard[(Key)LeftJoycon.StickButton]) buttons |= ControllerButtons.StickLeft;
|
if (keyboard[(Key)npad.LeftJoycon.StickButton]) buttons |= ControllerButtons.StickLeft;
|
||||||
if (keyboard[(Key)LeftJoycon.DPadUp]) buttons |= ControllerButtons.DpadUp;
|
if (keyboard[(Key)npad.LeftJoycon.DPadUp]) buttons |= ControllerButtons.DpadUp;
|
||||||
if (keyboard[(Key)LeftJoycon.DPadDown]) buttons |= ControllerButtons.DpadDown;
|
if (keyboard[(Key)npad.LeftJoycon.DPadDown]) buttons |= ControllerButtons.DpadDown;
|
||||||
if (keyboard[(Key)LeftJoycon.DPadLeft]) buttons |= ControllerButtons.DpadLeft;
|
if (keyboard[(Key)npad.LeftJoycon.DPadLeft]) buttons |= ControllerButtons.DpadLeft;
|
||||||
if (keyboard[(Key)LeftJoycon.DPadRight]) buttons |= ControllerButtons.DPadRight;
|
if (keyboard[(Key)npad.LeftJoycon.DPadRight]) buttons |= ControllerButtons.DPadRight;
|
||||||
if (keyboard[(Key)LeftJoycon.ButtonMinus]) buttons |= ControllerButtons.Minus;
|
if (keyboard[(Key)npad.LeftJoycon.ButtonMinus]) buttons |= ControllerButtons.Minus;
|
||||||
if (keyboard[(Key)LeftJoycon.ButtonL]) buttons |= ControllerButtons.L;
|
if (keyboard[(Key)npad.LeftJoycon.ButtonL]) buttons |= ControllerButtons.L;
|
||||||
if (keyboard[(Key)LeftJoycon.ButtonZl]) buttons |= ControllerButtons.Zl;
|
if (keyboard[(Key)npad.LeftJoycon.ButtonZl]) buttons |= ControllerButtons.Zl;
|
||||||
|
|
||||||
if (keyboard[(Key)RightJoycon.StickButton]) buttons |= ControllerButtons.StickRight;
|
if (keyboard[(Key)npad.RightJoycon.StickButton]) buttons |= ControllerButtons.StickRight;
|
||||||
if (keyboard[(Key)RightJoycon.ButtonA]) buttons |= ControllerButtons.A;
|
if (keyboard[(Key)npad.RightJoycon.ButtonA]) buttons |= ControllerButtons.A;
|
||||||
if (keyboard[(Key)RightJoycon.ButtonB]) buttons |= ControllerButtons.B;
|
if (keyboard[(Key)npad.RightJoycon.ButtonB]) buttons |= ControllerButtons.B;
|
||||||
if (keyboard[(Key)RightJoycon.ButtonX]) buttons |= ControllerButtons.X;
|
if (keyboard[(Key)npad.RightJoycon.ButtonX]) buttons |= ControllerButtons.X;
|
||||||
if (keyboard[(Key)RightJoycon.ButtonY]) buttons |= ControllerButtons.Y;
|
if (keyboard[(Key)npad.RightJoycon.ButtonY]) buttons |= ControllerButtons.Y;
|
||||||
if (keyboard[(Key)RightJoycon.ButtonPlus]) buttons |= ControllerButtons.Plus;
|
if (keyboard[(Key)npad.RightJoycon.ButtonPlus]) buttons |= ControllerButtons.Plus;
|
||||||
if (keyboard[(Key)RightJoycon.ButtonR]) buttons |= ControllerButtons.R;
|
if (keyboard[(Key)npad.RightJoycon.ButtonR]) buttons |= ControllerButtons.R;
|
||||||
if (keyboard[(Key)RightJoycon.ButtonZr]) buttons |= ControllerButtons.Zr;
|
if (keyboard[(Key)npad.RightJoycon.ButtonZr]) buttons |= ControllerButtons.Zr;
|
||||||
|
|
||||||
return buttons;
|
return buttons;
|
||||||
}
|
}
|
||||||
|
|
||||||
public (short, short) GetLeftStick(KeyboardState keyboard)
|
public static (short, short) GetLeftStick(NpadKeyboard npad, KeyboardState keyboard)
|
||||||
{
|
{
|
||||||
short dx = 0;
|
short dx = 0;
|
||||||
short dy = 0;
|
short dy = 0;
|
||||||
|
|
||||||
if (keyboard[(Key)LeftJoycon.StickUp]) dy = short.MaxValue;
|
if (keyboard[(Key)npad.LeftJoycon.StickUp]) dy = short.MaxValue;
|
||||||
if (keyboard[(Key)LeftJoycon.StickDown]) dy = -short.MaxValue;
|
if (keyboard[(Key)npad.LeftJoycon.StickDown]) dy = -short.MaxValue;
|
||||||
if (keyboard[(Key)LeftJoycon.StickLeft]) dx = -short.MaxValue;
|
if (keyboard[(Key)npad.LeftJoycon.StickLeft]) dx = -short.MaxValue;
|
||||||
if (keyboard[(Key)LeftJoycon.StickRight]) dx = short.MaxValue;
|
if (keyboard[(Key)npad.LeftJoycon.StickRight]) dx = short.MaxValue;
|
||||||
|
|
||||||
return (dx, dy);
|
return (dx, dy);
|
||||||
}
|
}
|
||||||
|
|
||||||
public (short, short) GetRightStick(KeyboardState keyboard)
|
public static (short, short) GetRightStick(NpadKeyboard npad, KeyboardState keyboard)
|
||||||
{
|
{
|
||||||
short dx = 0;
|
short dx = 0;
|
||||||
short dy = 0;
|
short dy = 0;
|
||||||
|
|
||||||
if (keyboard[(Key)RightJoycon.StickUp]) dy = short.MaxValue;
|
if (keyboard[(Key)npad.RightJoycon.StickUp]) dy = short.MaxValue;
|
||||||
if (keyboard[(Key)RightJoycon.StickDown]) dy = -short.MaxValue;
|
if (keyboard[(Key)npad.RightJoycon.StickDown]) dy = -short.MaxValue;
|
||||||
if (keyboard[(Key)RightJoycon.StickLeft]) dx = -short.MaxValue;
|
if (keyboard[(Key)npad.RightJoycon.StickLeft]) dx = -short.MaxValue;
|
||||||
if (keyboard[(Key)RightJoycon.StickRight]) dx = short.MaxValue;
|
if (keyboard[(Key)npad.RightJoycon.StickRight]) dx = short.MaxValue;
|
||||||
|
|
||||||
return (dx, dy);
|
return (dx, dy);
|
||||||
}
|
}
|
||||||
|
|
||||||
public HotkeyButtons GetHotkeyButtons(KeyboardState keyboard)
|
public static HotkeyButtons GetHotkeyButtons(NpadKeyboard npad, KeyboardState keyboard)
|
||||||
{
|
{
|
||||||
HotkeyButtons buttons = 0;
|
HotkeyButtons buttons = 0;
|
||||||
|
|
||||||
if (keyboard[(Key)Hotkeys.ToggleVsync]) buttons |= HotkeyButtons.ToggleVSync;
|
if (keyboard[(Key)npad.Hotkeys.ToggleVsync]) buttons |= HotkeyButtons.ToggleVSync;
|
||||||
|
|
||||||
return buttons;
|
return buttons;
|
||||||
}
|
}
|
||||||
|
@ -267,7 +216,7 @@ namespace Ryujinx.Ui.Input
|
||||||
new KeyMappingEntry { TargetKey = Key.NumLock, Target = 10 },
|
new KeyMappingEntry { TargetKey = Key.NumLock, Target = 10 },
|
||||||
};
|
};
|
||||||
|
|
||||||
public HLE.Input.Keyboard GetKeysDown(KeyboardState keyboard)
|
public static HLE.Input.Keyboard GetKeysDown(NpadKeyboard npad, KeyboardState keyboard)
|
||||||
{
|
{
|
||||||
HLE.Input.Keyboard hidKeyboard = new HLE.Input.Keyboard
|
HLE.Input.Keyboard hidKeyboard = new HLE.Input.Keyboard
|
||||||
{
|
{
|
|
@ -1,20 +1,19 @@
|
||||||
using DiscordRPC;
|
|
||||||
using Gtk;
|
using Gtk;
|
||||||
using JsonPrettyPrinterPlus;
|
using JsonPrettyPrinterPlus;
|
||||||
using Ryujinx.Audio;
|
using Ryujinx.Audio;
|
||||||
using Ryujinx.Common.Logging;
|
using Ryujinx.Common.Logging;
|
||||||
using Ryujinx.Graphics.Gal.OpenGL;
|
using Ryujinx.Configuration;
|
||||||
using Ryujinx.Graphics.Gal;
|
using Ryujinx.Graphics.Gal;
|
||||||
|
using Ryujinx.Graphics.Gal.OpenGL;
|
||||||
using Ryujinx.HLE.FileSystem;
|
using Ryujinx.HLE.FileSystem;
|
||||||
using Ryujinx.Profiler;
|
using Ryujinx.Profiler;
|
||||||
using System;
|
using System;
|
||||||
using System.Diagnostics;
|
using System.Diagnostics;
|
||||||
using System.IO;
|
using System.IO;
|
||||||
using System.Linq;
|
|
||||||
using System.Reflection;
|
using System.Reflection;
|
||||||
using System.Text;
|
using System.Text;
|
||||||
using System.Threading.Tasks;
|
|
||||||
using System.Threading;
|
using System.Threading;
|
||||||
|
using System.Threading.Tasks;
|
||||||
using Utf8Json;
|
using Utf8Json;
|
||||||
using Utf8Json.Resolvers;
|
using Utf8Json.Resolvers;
|
||||||
|
|
||||||
|
@ -38,24 +37,8 @@ namespace Ryujinx.Ui
|
||||||
private static bool _gameLoaded;
|
private static bool _gameLoaded;
|
||||||
private static bool _ending;
|
private static bool _ending;
|
||||||
|
|
||||||
private static TreeViewColumn _favColumn;
|
|
||||||
private static TreeViewColumn _appColumn;
|
|
||||||
private static TreeViewColumn _devColumn;
|
|
||||||
private static TreeViewColumn _versionColumn;
|
|
||||||
private static TreeViewColumn _timePlayedColumn;
|
|
||||||
private static TreeViewColumn _lastPlayedColumn;
|
|
||||||
private static TreeViewColumn _fileExtColumn;
|
|
||||||
private static TreeViewColumn _fileSizeColumn;
|
|
||||||
private static TreeViewColumn _pathColumn;
|
|
||||||
|
|
||||||
private static TreeView _treeView;
|
private static TreeView _treeView;
|
||||||
|
|
||||||
public static bool DiscordIntegrationEnabled { get; set; }
|
|
||||||
|
|
||||||
public static DiscordRpcClient DiscordClient;
|
|
||||||
|
|
||||||
public static RichPresence DiscordPresence;
|
|
||||||
|
|
||||||
#pragma warning disable CS0649
|
#pragma warning disable CS0649
|
||||||
#pragma warning disable IDE0044
|
#pragma warning disable IDE0044
|
||||||
[GUI] Window _mainWin;
|
[GUI] Window _mainWin;
|
||||||
|
@ -72,6 +55,7 @@ namespace Ryujinx.Ui
|
||||||
[GUI] CheckMenuItem _fileSizeToggle;
|
[GUI] CheckMenuItem _fileSizeToggle;
|
||||||
[GUI] CheckMenuItem _pathToggle;
|
[GUI] CheckMenuItem _pathToggle;
|
||||||
[GUI] TreeView _gameTable;
|
[GUI] TreeView _gameTable;
|
||||||
|
[GUI] TreeSelection _gameTableSelection;
|
||||||
[GUI] Label _progressLabel;
|
[GUI] Label _progressLabel;
|
||||||
[GUI] LevelBar _progressBar;
|
[GUI] LevelBar _progressBar;
|
||||||
#pragma warning restore CS0649
|
#pragma warning restore CS0649
|
||||||
|
@ -87,6 +71,8 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
ApplicationLibrary.ApplicationAdded += Application_Added;
|
ApplicationLibrary.ApplicationAdded += Application_Added;
|
||||||
|
|
||||||
|
_gameTable.ButtonReleaseEvent += Row_Clicked;
|
||||||
|
|
||||||
bool continueWithStartup = Migration.PromptIfMigrationNeededForStartup(this, out bool migrationNeeded);
|
bool continueWithStartup = Migration.PromptIfMigrationNeededForStartup(this, out bool migrationNeeded);
|
||||||
if (!continueWithStartup)
|
if (!continueWithStartup)
|
||||||
{
|
{
|
||||||
|
@ -97,7 +83,8 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
_audioOut = InitializeAudioEngine();
|
_audioOut = InitializeAudioEngine();
|
||||||
|
|
||||||
_device = new HLE.Switch(_renderer, _audioOut);
|
// TODO: Initialization and dispose of HLE.Switch when starting/stoping emulation.
|
||||||
|
_device = InitializeSwitchInstance();
|
||||||
|
|
||||||
if (migrationNeeded)
|
if (migrationNeeded)
|
||||||
{
|
{
|
||||||
|
@ -111,43 +98,21 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
_treeView = _gameTable;
|
_treeView = _gameTable;
|
||||||
|
|
||||||
Configuration.Load(System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
Configuration.InitialConfigure(_device);
|
|
||||||
|
|
||||||
ApplyTheme();
|
ApplyTheme();
|
||||||
|
|
||||||
if (DiscordIntegrationEnabled)
|
|
||||||
{
|
|
||||||
DiscordClient = new DiscordRpcClient("568815339807309834");
|
|
||||||
DiscordPresence = new RichPresence
|
|
||||||
{
|
|
||||||
Assets = new Assets
|
|
||||||
{
|
|
||||||
LargeImageKey = "ryujinx",
|
|
||||||
LargeImageText = "Ryujinx is an emulator for the Nintendo Switch"
|
|
||||||
},
|
|
||||||
Details = "Main Menu",
|
|
||||||
State = "Idling",
|
|
||||||
Timestamps = new Timestamps(DateTime.UtcNow)
|
|
||||||
};
|
|
||||||
|
|
||||||
DiscordClient.Initialize();
|
|
||||||
DiscordClient.SetPresence(DiscordPresence);
|
|
||||||
}
|
|
||||||
|
|
||||||
_mainWin.Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.Icon.png");
|
_mainWin.Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.Icon.png");
|
||||||
_stopEmulation.Sensitive = false;
|
_stopEmulation.Sensitive = false;
|
||||||
|
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FavColumn) { _favToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.FavColumn) _favToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.IconColumn) { _iconToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.IconColumn) _iconToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.AppColumn) { _appToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.AppColumn) _appToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.DevColumn) { _developerToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.DevColumn) _developerToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.VersionColumn) { _versionToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.VersionColumn) _versionToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.TimePlayedColumn) { _timePlayedToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.TimePlayedColumn) _timePlayedToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.LastPlayedColumn) { _lastPlayedToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.LastPlayedColumn) _lastPlayedToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FileExtColumn) { _fileExtToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.FileExtColumn) _fileExtToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FileSizeColumn) { _fileSizeToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.FileSizeColumn) _fileSizeToggle.Active = true;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.PathColumn) { _pathToggle.Active = true; }
|
if (ConfigurationState.Instance.Ui.GuiColumns.PathColumn) _pathToggle.Active = true;
|
||||||
|
|
||||||
_gameTable.Model = _tableStore = new ListStore(
|
_gameTable.Model = _tableStore = new ListStore(
|
||||||
typeof(bool),
|
typeof(bool),
|
||||||
|
@ -174,22 +139,22 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
internal static void ApplyTheme()
|
internal static void ApplyTheme()
|
||||||
{
|
{
|
||||||
if (!SwitchSettings.SwitchConfig.EnableCustomTheme)
|
if (!ConfigurationState.Instance.Ui.EnableCustomTheme)
|
||||||
{
|
{
|
||||||
return;
|
return;
|
||||||
}
|
}
|
||||||
|
|
||||||
if (File.Exists(SwitchSettings.SwitchConfig.CustomThemePath) && (System.IO.Path.GetExtension(SwitchSettings.SwitchConfig.CustomThemePath) == ".css"))
|
if (File.Exists(ConfigurationState.Instance.Ui.CustomThemePath) && (System.IO.Path.GetExtension(ConfigurationState.Instance.Ui.CustomThemePath) == ".css"))
|
||||||
{
|
{
|
||||||
CssProvider cssProvider = new CssProvider();
|
CssProvider cssProvider = new CssProvider();
|
||||||
|
|
||||||
cssProvider.LoadFromPath(SwitchSettings.SwitchConfig.CustomThemePath);
|
cssProvider.LoadFromPath(ConfigurationState.Instance.Ui.CustomThemePath);
|
||||||
|
|
||||||
StyleContext.AddProviderForScreen(Gdk.Screen.Default, cssProvider, 800);
|
StyleContext.AddProviderForScreen(Gdk.Screen.Default, cssProvider, 800);
|
||||||
}
|
}
|
||||||
else
|
else
|
||||||
{
|
{
|
||||||
Logger.PrintWarning(LogClass.Application, $"The \"custom_theme_path\" section in \"Config.json\" contains an invalid path: \"{SwitchSettings.SwitchConfig.CustomThemePath}\".");
|
Logger.PrintWarning(LogClass.Application, $"The \"custom_theme_path\" section in \"Config.json\" contains an invalid path: \"{ConfigurationState.Instance.Ui.CustomThemePath}\".");
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -203,39 +168,38 @@ namespace Ryujinx.Ui
|
||||||
CellRendererToggle favToggle = new CellRendererToggle();
|
CellRendererToggle favToggle = new CellRendererToggle();
|
||||||
favToggle.Toggled += FavToggle_Toggled;
|
favToggle.Toggled += FavToggle_Toggled;
|
||||||
|
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FavColumn) { _gameTable.AppendColumn("Fav", favToggle, "active", 0); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.FavColumn) _gameTable.AppendColumn("Fav", favToggle, "active", 0);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.IconColumn) { _gameTable.AppendColumn("Icon", new CellRendererPixbuf(), "pixbuf", 1); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.IconColumn) _gameTable.AppendColumn("Icon", new CellRendererPixbuf(), "pixbuf", 1);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.AppColumn) { _gameTable.AppendColumn("Application", new CellRendererText(), "text", 2); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.AppColumn) _gameTable.AppendColumn("Application", new CellRendererText(), "text", 2);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.DevColumn) { _gameTable.AppendColumn("Developer", new CellRendererText(), "text", 3); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.DevColumn) _gameTable.AppendColumn("Developer", new CellRendererText(), "text", 3);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.VersionColumn) { _gameTable.AppendColumn("Version", new CellRendererText(), "text", 4); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.VersionColumn) _gameTable.AppendColumn("Version", new CellRendererText(), "text", 4);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.TimePlayedColumn) { _gameTable.AppendColumn("Time Played", new CellRendererText(), "text", 5); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.TimePlayedColumn) _gameTable.AppendColumn("Time Played", new CellRendererText(), "text", 5);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.LastPlayedColumn) { _gameTable.AppendColumn("Last Played", new CellRendererText(), "text", 6); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.LastPlayedColumn) _gameTable.AppendColumn("Last Played", new CellRendererText(), "text", 6);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FileExtColumn) { _gameTable.AppendColumn("File Ext", new CellRendererText(), "text", 7); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.FileExtColumn) _gameTable.AppendColumn("File Ext", new CellRendererText(), "text", 7);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FileSizeColumn) { _gameTable.AppendColumn("File Size", new CellRendererText(), "text", 8); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.FileSizeColumn) _gameTable.AppendColumn("File Size", new CellRendererText(), "text", 8);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.PathColumn) { _gameTable.AppendColumn("Path", new CellRendererText(), "text", 9); }
|
if (ConfigurationState.Instance.Ui.GuiColumns.PathColumn) _gameTable.AppendColumn("Path", new CellRendererText(), "text", 9);
|
||||||
|
|
||||||
foreach (TreeViewColumn column in _gameTable.Columns)
|
foreach (TreeViewColumn column in _gameTable.Columns)
|
||||||
{
|
{
|
||||||
if (column.Title == "Fav") { _favColumn = column; }
|
if (column.Title == "Fav" && ConfigurationState.Instance.Ui.GuiColumns.FavColumn) column.SortColumnId = 0;
|
||||||
else if (column.Title == "Application") { _appColumn = column; }
|
else if (column.Title == "Application" && ConfigurationState.Instance.Ui.GuiColumns.AppColumn) column.SortColumnId = 2;
|
||||||
else if (column.Title == "Developer") { _devColumn = column; }
|
else if (column.Title == "Developer" && ConfigurationState.Instance.Ui.GuiColumns.DevColumn) column.SortColumnId = 3;
|
||||||
else if (column.Title == "Version") { _versionColumn = column; }
|
else if (column.Title == "Version" && ConfigurationState.Instance.Ui.GuiColumns.VersionColumn) column.SortColumnId = 4;
|
||||||
else if (column.Title == "Time Played") { _timePlayedColumn = column; }
|
else if (column.Title == "Time Played" && ConfigurationState.Instance.Ui.GuiColumns.TimePlayedColumn) column.SortColumnId = 5;
|
||||||
else if (column.Title == "Last Played") { _lastPlayedColumn = column; }
|
else if (column.Title == "Last Played" && ConfigurationState.Instance.Ui.GuiColumns.LastPlayedColumn) column.SortColumnId = 6;
|
||||||
else if (column.Title == "File Ext") { _fileExtColumn = column; }
|
else if (column.Title == "File Ext" && ConfigurationState.Instance.Ui.GuiColumns.FileExtColumn) column.SortColumnId = 7;
|
||||||
else if (column.Title == "File Size") { _fileSizeColumn = column; }
|
else if (column.Title == "File Size" && ConfigurationState.Instance.Ui.GuiColumns.FileSizeColumn) column.SortColumnId = 8;
|
||||||
else if (column.Title == "Path") { _pathColumn = column; }
|
else if (column.Title == "Path" && ConfigurationState.Instance.Ui.GuiColumns.PathColumn) column.SortColumnId = 9;
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FavColumn) { _favColumn.SortColumnId = 0; }
|
private HLE.Switch InitializeSwitchInstance()
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.IconColumn) { _appColumn.SortColumnId = 2; }
|
{
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.AppColumn) { _devColumn.SortColumnId = 3; }
|
HLE.Switch instance = new HLE.Switch(_renderer, _audioOut);
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.DevColumn) { _versionColumn.SortColumnId = 4; }
|
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.TimePlayedColumn) { _timePlayedColumn.SortColumnId = 5; }
|
instance.Initialize();
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.LastPlayedColumn) { _lastPlayedColumn.SortColumnId = 6; }
|
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FileExtColumn) { _fileExtColumn.SortColumnId = 7; }
|
return instance;
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.FileSizeColumn) { _fileSizeColumn.SortColumnId = 8; }
|
|
||||||
if (SwitchSettings.SwitchConfig.GuiColumns.PathColumn) { _pathColumn.SortColumnId = 9; }
|
|
||||||
}
|
}
|
||||||
|
|
||||||
internal static async Task UpdateGameTable()
|
internal static async Task UpdateGameTable()
|
||||||
|
@ -249,7 +213,7 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
_tableStore.Clear();
|
_tableStore.Clear();
|
||||||
|
|
||||||
await Task.Run(() => ApplicationLibrary.LoadApplications(SwitchSettings.SwitchConfig.GameDirs,
|
await Task.Run(() => ApplicationLibrary.LoadApplications(ConfigurationState.Instance.Ui.GameDirs,
|
||||||
_device.System.KeySet, _device.System.State.DesiredTitleLanguage, _device.System.FsClient,
|
_device.System.KeySet, _device.System.State.DesiredTitleLanguage, _device.System.FsClient,
|
||||||
_device.FileSystem));
|
_device.FileSystem));
|
||||||
|
|
||||||
|
@ -266,6 +230,9 @@ namespace Ryujinx.Ui
|
||||||
{
|
{
|
||||||
Logger.RestartTime();
|
Logger.RestartTime();
|
||||||
|
|
||||||
|
// TODO: Move this somewhere else + reloadable?
|
||||||
|
GraphicsConfig.ShadersDumpPath = ConfigurationState.Instance.Graphics.ShadersDumpPath;
|
||||||
|
|
||||||
if (Directory.Exists(path))
|
if (Directory.Exists(path))
|
||||||
{
|
{
|
||||||
string[] romFsFiles = Directory.GetFiles(path, "*.istorage");
|
string[] romFsFiles = Directory.GetFiles(path, "*.istorage");
|
||||||
|
@ -331,40 +298,7 @@ namespace Ryujinx.Ui
|
||||||
_gameLoaded = true;
|
_gameLoaded = true;
|
||||||
_stopEmulation.Sensitive = true;
|
_stopEmulation.Sensitive = true;
|
||||||
|
|
||||||
if (DiscordIntegrationEnabled)
|
DiscordIntegrationModule.SwitchToPlayingState(_device.System.TitleId, _device.System.TitleName);
|
||||||
{
|
|
||||||
if (File.ReadAllLines(System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "RPsupported.dat")).Contains(_device.System.TitleId))
|
|
||||||
{
|
|
||||||
DiscordPresence.Assets.LargeImageKey = _device.System.TitleId;
|
|
||||||
}
|
|
||||||
|
|
||||||
string state = _device.System.TitleId;
|
|
||||||
|
|
||||||
if (state == null)
|
|
||||||
{
|
|
||||||
state = "Ryujinx";
|
|
||||||
}
|
|
||||||
else
|
|
||||||
{
|
|
||||||
state = state.ToUpper();
|
|
||||||
}
|
|
||||||
|
|
||||||
string details = "Idling";
|
|
||||||
|
|
||||||
if (_device.System.TitleName != null)
|
|
||||||
{
|
|
||||||
details = $"Playing {_device.System.TitleName}";
|
|
||||||
}
|
|
||||||
|
|
||||||
DiscordPresence.Details = details;
|
|
||||||
DiscordPresence.State = state;
|
|
||||||
DiscordPresence.Assets.LargeImageText = _device.System.TitleName;
|
|
||||||
DiscordPresence.Assets.SmallImageKey = "ryujinx";
|
|
||||||
DiscordPresence.Assets.SmallImageText = "Ryujinx is an emulator for the Nintendo Switch";
|
|
||||||
DiscordPresence.Timestamps = new Timestamps(DateTime.UtcNow);
|
|
||||||
|
|
||||||
DiscordClient.SetPresence(DiscordPresence);
|
|
||||||
}
|
|
||||||
|
|
||||||
string metadataFolder = System.IO.Path.Combine(new VirtualFileSystem().GetBasePath(), "games", _device.System.TitleId, "gui");
|
string metadataFolder = System.IO.Path.Combine(new VirtualFileSystem().GetBasePath(), "games", _device.System.TitleId, "gui");
|
||||||
string metadataFile = System.IO.Path.Combine(metadataFolder, "metadata.json");
|
string metadataFile = System.IO.Path.Combine(metadataFolder, "metadata.json");
|
||||||
|
@ -402,7 +336,7 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
private static void CreateGameWindow()
|
private static void CreateGameWindow()
|
||||||
{
|
{
|
||||||
Configuration.ConfigureHid(_device, SwitchSettings.SwitchConfig);
|
_device.Hid.InitializePrimaryController(ConfigurationState.Instance.Hid.ControllerType);
|
||||||
|
|
||||||
using (_screen = new GlScreen(_device, _renderer))
|
using (_screen = new GlScreen(_device, _renderer))
|
||||||
{
|
{
|
||||||
|
@ -462,7 +396,6 @@ namespace Ryujinx.Ui
|
||||||
Profile.FinishProfiling();
|
Profile.FinishProfiling();
|
||||||
_device?.Dispose();
|
_device?.Dispose();
|
||||||
_audioOut?.Dispose();
|
_audioOut?.Dispose();
|
||||||
DiscordClient?.Dispose();
|
|
||||||
Logger.Shutdown();
|
Logger.Shutdown();
|
||||||
Environment.Exit(0);
|
Environment.Exit(0);
|
||||||
}
|
}
|
||||||
|
@ -488,24 +421,24 @@ namespace Ryujinx.Ui
|
||||||
}
|
}
|
||||||
|
|
||||||
//Events
|
//Events
|
||||||
private void Application_Added(object sender, ApplicationAddedEventArgs e)
|
private void Application_Added(object sender, ApplicationAddedEventArgs args)
|
||||||
{
|
{
|
||||||
Application.Invoke(delegate
|
Application.Invoke(delegate
|
||||||
{
|
{
|
||||||
_tableStore.AppendValues(
|
_tableStore.AppendValues(
|
||||||
e.AppData.Favorite,
|
args.AppData.Favorite,
|
||||||
new Gdk.Pixbuf(e.AppData.Icon, 75, 75),
|
new Gdk.Pixbuf(args.AppData.Icon, 75, 75),
|
||||||
$"{e.AppData.TitleName}\n{e.AppData.TitleId.ToUpper()}",
|
$"{args.AppData.TitleName}\n{args.AppData.TitleId.ToUpper()}",
|
||||||
e.AppData.Developer,
|
args.AppData.Developer,
|
||||||
e.AppData.Version,
|
args.AppData.Version,
|
||||||
e.AppData.TimePlayed,
|
args.AppData.TimePlayed,
|
||||||
e.AppData.LastPlayed,
|
args.AppData.LastPlayed,
|
||||||
e.AppData.FileExtension,
|
args.AppData.FileExtension,
|
||||||
e.AppData.FileSize,
|
args.AppData.FileSize,
|
||||||
e.AppData.Path);
|
args.AppData.Path);
|
||||||
|
|
||||||
_progressLabel.Text = $"{e.NumAppsLoaded}/{e.NumAppsFound} Games Loaded";
|
_progressLabel.Text = $"{args.NumAppsLoaded}/{args.NumAppsFound} Games Loaded";
|
||||||
_progressBar.Value = (float)e.NumAppsLoaded / e.NumAppsFound;
|
_progressBar.Value = (float)args.NumAppsLoaded / args.NumAppsFound;
|
||||||
});
|
});
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -544,12 +477,25 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
private void Row_Activated(object sender, RowActivatedArgs args)
|
private void Row_Activated(object sender, RowActivatedArgs args)
|
||||||
{
|
{
|
||||||
_tableStore.GetIter(out TreeIter treeIter, new TreePath(args.Path.ToString()));
|
_gameTableSelection.GetSelected(out TreeIter treeIter);
|
||||||
string path = (string)_tableStore.GetValue(treeIter, 9);
|
string path = (string)_tableStore.GetValue(treeIter, 9);
|
||||||
|
|
||||||
LoadApplication(path);
|
LoadApplication(path);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private void Row_Clicked(object sender, ButtonReleaseEventArgs args)
|
||||||
|
{
|
||||||
|
if (args.Event.Button != 3) return;
|
||||||
|
|
||||||
|
_gameTableSelection.GetSelected(out TreeIter treeIter);
|
||||||
|
|
||||||
|
if (treeIter.UserData == IntPtr.Zero) return;
|
||||||
|
|
||||||
|
GameTableContextMenu contextMenu = new GameTableContextMenu(_tableStore, treeIter);
|
||||||
|
contextMenu.ShowAll();
|
||||||
|
contextMenu.PopupAtPointer(null);
|
||||||
|
}
|
||||||
|
|
||||||
private void Load_Application_File(object sender, EventArgs args)
|
private void Load_Application_File(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
FileChooserDialog fileChooser = new FileChooserDialog("Choose the file to open", this, FileChooserAction.Open, "Cancel", ResponseType.Cancel, "Open", ResponseType.Accept);
|
FileChooserDialog fileChooser = new FileChooserDialog("Choose the file to open", this, FileChooserAction.Open, "Cancel", ResponseType.Cancel, "Open", ResponseType.Accept);
|
||||||
|
@ -625,7 +571,7 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
private void Settings_Pressed(object sender, EventArgs args)
|
private void Settings_Pressed(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
SwitchSettings settingsWin = new SwitchSettings(_device);
|
SwitchSettings settingsWin = new SwitchSettings();
|
||||||
settingsWin.Show();
|
settingsWin.Show();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -658,121 +604,81 @@ namespace Ryujinx.Ui
|
||||||
|
|
||||||
private void Fav_Toggled(object sender, EventArgs args)
|
private void Fav_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.FavColumn.Value = _favToggle.Active;
|
||||||
|
|
||||||
updatedColumns.FavColumn = _favToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void Icon_Toggled(object sender, EventArgs args)
|
private void Icon_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.IconColumn.Value = _iconToggle.Active;
|
||||||
|
|
||||||
updatedColumns.IconColumn = _iconToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void Title_Toggled(object sender, EventArgs args)
|
private void Title_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.AppColumn.Value = _appToggle.Active;
|
||||||
|
|
||||||
updatedColumns.AppColumn = _appToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void Developer_Toggled(object sender, EventArgs args)
|
private void Developer_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.DevColumn.Value = _developerToggle.Active;
|
||||||
|
|
||||||
updatedColumns.DevColumn = _developerToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void Version_Toggled(object sender, EventArgs args)
|
private void Version_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.VersionColumn.Value = _versionToggle.Active;
|
||||||
|
|
||||||
updatedColumns.VersionColumn = _versionToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void TimePlayed_Toggled(object sender, EventArgs args)
|
private void TimePlayed_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.TimePlayedColumn.Value = _timePlayedToggle.Active;
|
||||||
|
|
||||||
updatedColumns.TimePlayedColumn = _timePlayedToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void LastPlayed_Toggled(object sender, EventArgs args)
|
private void LastPlayed_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.LastPlayedColumn.Value = _lastPlayedToggle.Active;
|
||||||
|
|
||||||
updatedColumns.LastPlayedColumn = _lastPlayedToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void FileExt_Toggled(object sender, EventArgs args)
|
private void FileExt_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.FileExtColumn.Value = _fileExtToggle.Active;
|
||||||
|
|
||||||
updatedColumns.FileExtColumn = _fileExtToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void FileSize_Toggled(object sender, EventArgs args)
|
private void FileSize_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.FileSizeColumn.Value = _fileSizeToggle.Active;
|
||||||
|
|
||||||
updatedColumns.FileSizeColumn = _fileSizeToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void Path_Toggled(object sender, EventArgs args)
|
private void Path_Toggled(object sender, EventArgs args)
|
||||||
{
|
{
|
||||||
GuiColumns updatedColumns = SwitchSettings.SwitchConfig.GuiColumns;
|
ConfigurationState.Instance.Ui.GuiColumns.PathColumn.Value = _pathToggle.Active;
|
||||||
|
|
||||||
updatedColumns.PathColumn = _pathToggle.Active;
|
|
||||||
SwitchSettings.SwitchConfig.GuiColumns = updatedColumns;
|
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchSettings.SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
|
|
||||||
|
SaveConfig();
|
||||||
UpdateColumns();
|
UpdateColumns();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@ -890,5 +796,10 @@ namespace Ryujinx.Ui
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public static void SaveConfig()
|
||||||
|
{
|
||||||
|
ConfigurationState.Instance.ToFileFormat().SaveConfig(System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
|
@ -346,7 +346,7 @@
|
||||||
<property name="hover_selection">True</property>
|
<property name="hover_selection">True</property>
|
||||||
<signal name="row-activated" handler="Row_Activated" swapped="no"/>
|
<signal name="row-activated" handler="Row_Activated" swapped="no"/>
|
||||||
<child internal-child="selection">
|
<child internal-child="selection">
|
||||||
<object class="GtkTreeSelection"/>
|
<object class="GtkTreeSelection" id="_gameTableSelection"/>
|
||||||
</child>
|
</child>
|
||||||
</object>
|
</object>
|
||||||
</child>
|
</child>
|
||||||
|
|
|
@ -1,160 +1,57 @@
|
||||||
using OpenTK;
|
using OpenTK;
|
||||||
using OpenTK.Input;
|
using OpenTK.Input;
|
||||||
|
using Ryujinx.Common.Configuration.Hid;
|
||||||
using Ryujinx.HLE.Input;
|
using Ryujinx.HLE.Input;
|
||||||
using System;
|
using System;
|
||||||
|
|
||||||
|
using InnerNpadController = Ryujinx.Common.Configuration.Hid.NpadController;
|
||||||
|
|
||||||
namespace Ryujinx.Ui.Input
|
namespace Ryujinx.Ui.Input
|
||||||
{
|
{
|
||||||
public enum ControllerInputId
|
|
||||||
{
|
|
||||||
Button0,
|
|
||||||
Button1,
|
|
||||||
Button2,
|
|
||||||
Button3,
|
|
||||||
Button4,
|
|
||||||
Button5,
|
|
||||||
Button6,
|
|
||||||
Button7,
|
|
||||||
Button8,
|
|
||||||
Button9,
|
|
||||||
Button10,
|
|
||||||
Button11,
|
|
||||||
Button12,
|
|
||||||
Button13,
|
|
||||||
Button14,
|
|
||||||
Button15,
|
|
||||||
Button16,
|
|
||||||
Button17,
|
|
||||||
Button18,
|
|
||||||
Button19,
|
|
||||||
Button20,
|
|
||||||
Axis0,
|
|
||||||
Axis1,
|
|
||||||
Axis2,
|
|
||||||
Axis3,
|
|
||||||
Axis4,
|
|
||||||
Axis5,
|
|
||||||
Hat0Up,
|
|
||||||
Hat0Down,
|
|
||||||
Hat0Left,
|
|
||||||
Hat0Right,
|
|
||||||
Hat1Up,
|
|
||||||
Hat1Down,
|
|
||||||
Hat1Left,
|
|
||||||
Hat1Right,
|
|
||||||
Hat2Up,
|
|
||||||
Hat2Down,
|
|
||||||
Hat2Left,
|
|
||||||
Hat2Right,
|
|
||||||
}
|
|
||||||
|
|
||||||
public struct NpadControllerLeft
|
|
||||||
{
|
|
||||||
public ControllerInputId Stick;
|
|
||||||
public ControllerInputId StickButton;
|
|
||||||
public ControllerInputId ButtonMinus;
|
|
||||||
public ControllerInputId ButtonL;
|
|
||||||
public ControllerInputId ButtonZl;
|
|
||||||
public ControllerInputId DPadUp;
|
|
||||||
public ControllerInputId DPadDown;
|
|
||||||
public ControllerInputId DPadLeft;
|
|
||||||
public ControllerInputId DPadRight;
|
|
||||||
}
|
|
||||||
|
|
||||||
public struct NpadControllerRight
|
|
||||||
{
|
|
||||||
public ControllerInputId Stick;
|
|
||||||
public ControllerInputId StickButton;
|
|
||||||
public ControllerInputId ButtonA;
|
|
||||||
public ControllerInputId ButtonB;
|
|
||||||
public ControllerInputId ButtonX;
|
|
||||||
public ControllerInputId ButtonY;
|
|
||||||
public ControllerInputId ButtonPlus;
|
|
||||||
public ControllerInputId ButtonR;
|
|
||||||
public ControllerInputId ButtonZr;
|
|
||||||
}
|
|
||||||
|
|
||||||
public class NpadController
|
public class NpadController
|
||||||
{
|
{
|
||||||
/// <summary>
|
private InnerNpadController _inner;
|
||||||
/// Enables or disables controller support
|
|
||||||
/// </summary>
|
|
||||||
public bool Enabled { get; private set; }
|
|
||||||
|
|
||||||
/// <summary>
|
// NOTE: This should be initialized AFTER GTK for compat reasons with OpenTK SDL2 backend and GTK on Linux.
|
||||||
/// Controller Device Index
|
// BODY: Usage of Joystick.GetState must be defer to after GTK full initialization. Otherwise, GTK will segfault because SDL2 was already init *sighs*
|
||||||
/// </summary>
|
public NpadController(InnerNpadController inner)
|
||||||
public int Index { get; private set; }
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Controller Analog Stick Deadzone
|
|
||||||
/// </summary>
|
|
||||||
public float Deadzone { get; private set; }
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Controller Trigger Threshold
|
|
||||||
/// </summary>
|
|
||||||
public float TriggerThreshold { get; private set; }
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Left JoyCon Controller Bindings
|
|
||||||
/// </summary>
|
|
||||||
public NpadControllerLeft LeftJoycon { get; private set; }
|
|
||||||
|
|
||||||
/// <summary>
|
|
||||||
/// Right JoyCon Controller Bindings
|
|
||||||
/// </summary>
|
|
||||||
public NpadControllerRight RightJoycon { get; private set; }
|
|
||||||
|
|
||||||
public NpadController(
|
|
||||||
bool enabled,
|
|
||||||
int index,
|
|
||||||
float deadzone,
|
|
||||||
float triggerThreshold,
|
|
||||||
NpadControllerLeft leftJoycon,
|
|
||||||
NpadControllerRight rightJoycon)
|
|
||||||
{
|
{
|
||||||
Enabled = enabled;
|
_inner = inner;
|
||||||
Index = index;
|
|
||||||
Deadzone = deadzone;
|
|
||||||
TriggerThreshold = triggerThreshold;
|
|
||||||
LeftJoycon = leftJoycon;
|
|
||||||
RightJoycon = rightJoycon;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
public void SetEnabled(bool enabled)
|
private bool IsEnabled()
|
||||||
{
|
{
|
||||||
Enabled = enabled;
|
return _inner.Enabled && Joystick.GetState(_inner.Index).IsConnected;
|
||||||
}
|
}
|
||||||
|
|
||||||
public ControllerButtons GetButtons()
|
public ControllerButtons GetButtons()
|
||||||
{
|
{
|
||||||
if (!Enabled)
|
if (!IsEnabled())
|
||||||
{
|
{
|
||||||
return 0;
|
return 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
JoystickState joystickState = Joystick.GetState(Index);
|
JoystickState joystickState = Joystick.GetState(_inner.Index);
|
||||||
|
|
||||||
ControllerButtons buttons = 0;
|
ControllerButtons buttons = 0;
|
||||||
|
|
||||||
if (IsActivated(joystickState, LeftJoycon.DPadUp)) buttons |= ControllerButtons.DpadUp;
|
if (IsActivated(joystickState, _inner.LeftJoycon.DPadUp)) buttons |= ControllerButtons.DpadUp;
|
||||||
if (IsActivated(joystickState, LeftJoycon.DPadDown)) buttons |= ControllerButtons.DpadDown;
|
if (IsActivated(joystickState, _inner.LeftJoycon.DPadDown)) buttons |= ControllerButtons.DpadDown;
|
||||||
if (IsActivated(joystickState, LeftJoycon.DPadLeft)) buttons |= ControllerButtons.DpadLeft;
|
if (IsActivated(joystickState, _inner.LeftJoycon.DPadLeft)) buttons |= ControllerButtons.DpadLeft;
|
||||||
if (IsActivated(joystickState, LeftJoycon.DPadRight)) buttons |= ControllerButtons.DPadRight;
|
if (IsActivated(joystickState, _inner.LeftJoycon.DPadRight)) buttons |= ControllerButtons.DPadRight;
|
||||||
if (IsActivated(joystickState, LeftJoycon.StickButton)) buttons |= ControllerButtons.StickLeft;
|
if (IsActivated(joystickState, _inner.LeftJoycon.StickButton)) buttons |= ControllerButtons.StickLeft;
|
||||||
if (IsActivated(joystickState, LeftJoycon.ButtonMinus)) buttons |= ControllerButtons.Minus;
|
if (IsActivated(joystickState, _inner.LeftJoycon.ButtonMinus)) buttons |= ControllerButtons.Minus;
|
||||||
if (IsActivated(joystickState, LeftJoycon.ButtonL)) buttons |= ControllerButtons.L;
|
if (IsActivated(joystickState, _inner.LeftJoycon.ButtonL)) buttons |= ControllerButtons.L;
|
||||||
if (IsActivated(joystickState, LeftJoycon.ButtonZl)) buttons |= ControllerButtons.Zl;
|
if (IsActivated(joystickState, _inner.LeftJoycon.ButtonZl)) buttons |= ControllerButtons.Zl;
|
||||||
|
|
||||||
if (IsActivated(joystickState, RightJoycon.ButtonA)) buttons |= ControllerButtons.A;
|
if (IsActivated(joystickState, _inner.RightJoycon.ButtonA)) buttons |= ControllerButtons.A;
|
||||||
if (IsActivated(joystickState, RightJoycon.ButtonB)) buttons |= ControllerButtons.B;
|
if (IsActivated(joystickState, _inner.RightJoycon.ButtonB)) buttons |= ControllerButtons.B;
|
||||||
if (IsActivated(joystickState, RightJoycon.ButtonX)) buttons |= ControllerButtons.X;
|
if (IsActivated(joystickState, _inner.RightJoycon.ButtonX)) buttons |= ControllerButtons.X;
|
||||||
if (IsActivated(joystickState, RightJoycon.ButtonY)) buttons |= ControllerButtons.Y;
|
if (IsActivated(joystickState, _inner.RightJoycon.ButtonY)) buttons |= ControllerButtons.Y;
|
||||||
if (IsActivated(joystickState, RightJoycon.StickButton)) buttons |= ControllerButtons.StickRight;
|
if (IsActivated(joystickState, _inner.RightJoycon.StickButton)) buttons |= ControllerButtons.StickRight;
|
||||||
if (IsActivated(joystickState, RightJoycon.ButtonPlus)) buttons |= ControllerButtons.Plus;
|
if (IsActivated(joystickState, _inner.RightJoycon.ButtonPlus)) buttons |= ControllerButtons.Plus;
|
||||||
if (IsActivated(joystickState, RightJoycon.ButtonR)) buttons |= ControllerButtons.R;
|
if (IsActivated(joystickState, _inner.RightJoycon.ButtonR)) buttons |= ControllerButtons.R;
|
||||||
if (IsActivated(joystickState, RightJoycon.ButtonZr)) buttons |= ControllerButtons.Zr;
|
if (IsActivated(joystickState, _inner.RightJoycon.ButtonZr)) buttons |= ControllerButtons.Zr;
|
||||||
|
|
||||||
return buttons;
|
return buttons;
|
||||||
}
|
}
|
||||||
|
@ -169,7 +66,7 @@ namespace Ryujinx.Ui.Input
|
||||||
{
|
{
|
||||||
int axis = controllerInputId - ControllerInputId.Axis0;
|
int axis = controllerInputId - ControllerInputId.Axis0;
|
||||||
|
|
||||||
return joystickState.GetAxis(axis) > TriggerThreshold;
|
return joystickState.GetAxis(axis) > _inner.TriggerThreshold;
|
||||||
}
|
}
|
||||||
else if (controllerInputId <= ControllerInputId.Hat2Right)
|
else if (controllerInputId <= ControllerInputId.Hat2Right)
|
||||||
{
|
{
|
||||||
|
@ -190,22 +87,22 @@ namespace Ryujinx.Ui.Input
|
||||||
|
|
||||||
public (short, short) GetLeftStick()
|
public (short, short) GetLeftStick()
|
||||||
{
|
{
|
||||||
if (!Enabled)
|
if (!IsEnabled())
|
||||||
{
|
{
|
||||||
return (0, 0);
|
return (0, 0);
|
||||||
}
|
}
|
||||||
|
|
||||||
return GetStick(LeftJoycon.Stick);
|
return GetStick(_inner.LeftJoycon.Stick);
|
||||||
}
|
}
|
||||||
|
|
||||||
public (short, short) GetRightStick()
|
public (short, short) GetRightStick()
|
||||||
{
|
{
|
||||||
if (!Enabled)
|
if (!IsEnabled())
|
||||||
{
|
{
|
||||||
return (0, 0);
|
return (0, 0);
|
||||||
}
|
}
|
||||||
|
|
||||||
return GetStick(RightJoycon.Stick);
|
return GetStick(_inner.RightJoycon.Stick);
|
||||||
}
|
}
|
||||||
|
|
||||||
private (short, short) GetStick(ControllerInputId stickInputId)
|
private (short, short) GetStick(ControllerInputId stickInputId)
|
||||||
|
@ -215,7 +112,7 @@ namespace Ryujinx.Ui.Input
|
||||||
return (0, 0);
|
return (0, 0);
|
||||||
}
|
}
|
||||||
|
|
||||||
JoystickState jsState = Joystick.GetState(Index);
|
JoystickState jsState = Joystick.GetState(_inner.Index);
|
||||||
|
|
||||||
int xAxis = stickInputId - ControllerInputId.Axis0;
|
int xAxis = stickInputId - ControllerInputId.Axis0;
|
||||||
|
|
||||||
|
@ -227,8 +124,8 @@ namespace Ryujinx.Ui.Input
|
||||||
|
|
||||||
private (short, short) ApplyDeadzone(Vector2 axis)
|
private (short, short) ApplyDeadzone(Vector2 axis)
|
||||||
{
|
{
|
||||||
return (ClampAxis(MathF.Abs(axis.X) > Deadzone ? axis.X : 0f),
|
return (ClampAxis(MathF.Abs(axis.X) > _inner.Deadzone ? axis.X : 0f),
|
||||||
ClampAxis(MathF.Abs(axis.Y) > Deadzone ? axis.Y : 0f));
|
ClampAxis(MathF.Abs(axis.Y) > _inner.Deadzone ? axis.Y : 0f));
|
||||||
}
|
}
|
||||||
|
|
||||||
private static short ClampAxis(float value)
|
private static short ClampAxis(float value)
|
||||||
|
|
|
@ -1,7 +1,7 @@
|
||||||
using Gtk;
|
using Gtk;
|
||||||
using Ryujinx.HLE.HOS.SystemState;
|
using Ryujinx.Configuration;
|
||||||
using Ryujinx.HLE.Input;
|
using Ryujinx.Configuration.Hid;
|
||||||
using Ryujinx.Ui.Input;
|
using Ryujinx.Configuration.System;
|
||||||
using System;
|
using System;
|
||||||
using System.Collections.Generic;
|
using System.Collections.Generic;
|
||||||
using System.IO;
|
using System.IO;
|
||||||
|
@ -14,10 +14,6 @@ namespace Ryujinx.Ui
|
||||||
{
|
{
|
||||||
public class SwitchSettings : Window
|
public class SwitchSettings : Window
|
||||||
{
|
{
|
||||||
internal static Configuration SwitchConfig { get; set; }
|
|
||||||
|
|
||||||
private readonly HLE.Switch _device;
|
|
||||||
|
|
||||||
private static ListStore _gameDirsBoxStore;
|
private static ListStore _gameDirsBoxStore;
|
||||||
|
|
||||||
private static bool _listeningForKeypress;
|
private static bool _listeningForKeypress;
|
||||||
|
@ -83,16 +79,12 @@ namespace Ryujinx.Ui
|
||||||
#pragma warning restore CS0649
|
#pragma warning restore CS0649
|
||||||
#pragma warning restore IDE0044
|
#pragma warning restore IDE0044
|
||||||
|
|
||||||
public static void ConfigureSettings(Configuration instance) { SwitchConfig = instance; }
|
public SwitchSettings() : this(new Builder("Ryujinx.Ui.SwitchSettings.glade")) { }
|
||||||
|
|
||||||
public SwitchSettings(HLE.Switch device) : this(new Builder("Ryujinx.Ui.SwitchSettings.glade"), device) { }
|
private SwitchSettings(Builder builder) : base(builder.GetObject("_settingsWin").Handle)
|
||||||
|
|
||||||
private SwitchSettings(Builder builder, HLE.Switch device) : base(builder.GetObject("_settingsWin").Handle)
|
|
||||||
{
|
{
|
||||||
builder.Autoconnect(this);
|
builder.Autoconnect(this);
|
||||||
|
|
||||||
_device = device;
|
|
||||||
|
|
||||||
_settingsWin.Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.Icon.png");
|
_settingsWin.Icon = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.Icon.png");
|
||||||
_controller1Image.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.JoyCon.png", 500, 500);
|
_controller1Image.Pixbuf = new Gdk.Pixbuf(Assembly.GetExecutingAssembly(), "Ryujinx.Ui.assets.JoyCon.png", 500, 500);
|
||||||
|
|
||||||
|
@ -124,60 +116,123 @@ namespace Ryujinx.Ui
|
||||||
_controller1Type.Changed += (sender, args) => Controller_Changed(sender, args, _controller1Type.ActiveId, _controller1Image);
|
_controller1Type.Changed += (sender, args) => Controller_Changed(sender, args, _controller1Type.ActiveId, _controller1Image);
|
||||||
|
|
||||||
//Setup Currents
|
//Setup Currents
|
||||||
if (SwitchConfig.EnableFileLog) _fileLogToggle.Click();
|
if (ConfigurationState.Instance.Logger.EnableFileLog)
|
||||||
if (SwitchConfig.LoggingEnableError) _errorLogToggle.Click();
|
{
|
||||||
if (SwitchConfig.LoggingEnableWarn) _warningLogToggle.Click();
|
_fileLogToggle.Click();
|
||||||
if (SwitchConfig.LoggingEnableInfo) _infoLogToggle.Click();
|
}
|
||||||
if (SwitchConfig.LoggingEnableStub) _stubLogToggle.Click();
|
|
||||||
if (SwitchConfig.LoggingEnableDebug) _debugLogToggle.Click();
|
|
||||||
if (SwitchConfig.LoggingEnableGuest) _guestLogToggle.Click();
|
|
||||||
if (SwitchConfig.LoggingEnableFsAccessLog) _fsAccessLogToggle.Click();
|
|
||||||
if (SwitchConfig.DockedMode) _dockedModeToggle.Click();
|
|
||||||
if (SwitchConfig.EnableDiscordIntegration) _discordToggle.Click();
|
|
||||||
if (SwitchConfig.EnableVsync) _vSyncToggle.Click();
|
|
||||||
if (SwitchConfig.EnableMulticoreScheduling) _multiSchedToggle.Click();
|
|
||||||
if (SwitchConfig.EnableFsIntegrityChecks) _fsicToggle.Click();
|
|
||||||
if (SwitchConfig.IgnoreMissingServices) _ignoreToggle.Click();
|
|
||||||
if (SwitchConfig.EnableKeyboard) _directKeyboardAccess.Click();
|
|
||||||
if (SwitchConfig.EnableCustomTheme) _custThemeToggle.Click();
|
|
||||||
|
|
||||||
_systemLanguageSelect.SetActiveId(SwitchConfig.SystemLanguage.ToString());
|
if (ConfigurationState.Instance.Logger.EnableError)
|
||||||
_controller1Type .SetActiveId(SwitchConfig.ControllerType.ToString());
|
{
|
||||||
|
_errorLogToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Logger.EnableWarn)
|
||||||
|
{
|
||||||
|
_warningLogToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Logger.EnableInfo)
|
||||||
|
{
|
||||||
|
_infoLogToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Logger.EnableStub)
|
||||||
|
{
|
||||||
|
_stubLogToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Logger.EnableDebug)
|
||||||
|
{
|
||||||
|
_debugLogToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Logger.EnableGuest)
|
||||||
|
{
|
||||||
|
_guestLogToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Logger.EnableFsAccessLog)
|
||||||
|
{
|
||||||
|
_fsAccessLogToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.System.EnableDockedMode)
|
||||||
|
{
|
||||||
|
_dockedModeToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.EnableDiscordIntegration)
|
||||||
|
{
|
||||||
|
_discordToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Graphics.EnableVsync)
|
||||||
|
{
|
||||||
|
_vSyncToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.System.EnableMulticoreScheduling)
|
||||||
|
{
|
||||||
|
_multiSchedToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.System.EnableFsIntegrityChecks)
|
||||||
|
{
|
||||||
|
_fsicToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.System.IgnoreMissingServices)
|
||||||
|
{
|
||||||
|
_ignoreToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Hid.EnableKeyboard)
|
||||||
|
{
|
||||||
|
_directKeyboardAccess.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (ConfigurationState.Instance.Ui.EnableCustomTheme)
|
||||||
|
{
|
||||||
|
_custThemeToggle.Click();
|
||||||
|
}
|
||||||
|
|
||||||
|
_systemLanguageSelect.SetActiveId(ConfigurationState.Instance.System.Language.Value.ToString());
|
||||||
|
_controller1Type .SetActiveId(ConfigurationState.Instance.Hid.ControllerType.Value.ToString());
|
||||||
Controller_Changed(null, null, _controller1Type.ActiveId, _controller1Image);
|
Controller_Changed(null, null, _controller1Type.ActiveId, _controller1Image);
|
||||||
|
|
||||||
_lStickUp1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickUp.ToString();
|
_lStickUp1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.StickUp.ToString();
|
||||||
_lStickDown1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickDown.ToString();
|
_lStickDown1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.StickDown.ToString();
|
||||||
_lStickLeft1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickLeft.ToString();
|
_lStickLeft1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.StickLeft.ToString();
|
||||||
_lStickRight1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickRight.ToString();
|
_lStickRight1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.StickRight.ToString();
|
||||||
_lStickButton1.Label = SwitchConfig.KeyboardControls.LeftJoycon.StickButton.ToString();
|
_lStickButton1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.StickButton.ToString();
|
||||||
_dpadUp1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadUp.ToString();
|
_dpadUp1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.DPadUp.ToString();
|
||||||
_dpadDown1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadDown.ToString();
|
_dpadDown1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.DPadDown.ToString();
|
||||||
_dpadLeft1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadLeft.ToString();
|
_dpadLeft1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.DPadLeft.ToString();
|
||||||
_dpadRight1.Label = SwitchConfig.KeyboardControls.LeftJoycon.DPadRight.ToString();
|
_dpadRight1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.DPadRight.ToString();
|
||||||
_minus1.Label = SwitchConfig.KeyboardControls.LeftJoycon.ButtonMinus.ToString();
|
_minus1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.ButtonMinus.ToString();
|
||||||
_l1.Label = SwitchConfig.KeyboardControls.LeftJoycon.ButtonL.ToString();
|
_l1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.ButtonL.ToString();
|
||||||
_zL1.Label = SwitchConfig.KeyboardControls.LeftJoycon.ButtonZl.ToString();
|
_zL1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon.ButtonZl.ToString();
|
||||||
_rStickUp1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickUp.ToString();
|
_rStickUp1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.StickUp.ToString();
|
||||||
_rStickDown1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickDown.ToString();
|
_rStickDown1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.StickDown.ToString();
|
||||||
_rStickLeft1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickLeft.ToString();
|
_rStickLeft1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.StickLeft.ToString();
|
||||||
_rStickRight1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickRight.ToString();
|
_rStickRight1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.StickRight.ToString();
|
||||||
_rStickButton1.Label = SwitchConfig.KeyboardControls.RightJoycon.StickButton.ToString();
|
_rStickButton1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.StickButton.ToString();
|
||||||
_a1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonA.ToString();
|
_a1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.ButtonA.ToString();
|
||||||
_b1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonB.ToString();
|
_b1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.ButtonB.ToString();
|
||||||
_x1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonX.ToString();
|
_x1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.ButtonX.ToString();
|
||||||
_y1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonY.ToString();
|
_y1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.ButtonY.ToString();
|
||||||
_plus1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonPlus.ToString();
|
_plus1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.ButtonPlus.ToString();
|
||||||
_r1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonR.ToString();
|
_r1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.ButtonR.ToString();
|
||||||
_zR1.Label = SwitchConfig.KeyboardControls.RightJoycon.ButtonZr.ToString();
|
_zR1.Label = ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon.ButtonZr.ToString();
|
||||||
|
|
||||||
_custThemePath.Buffer.Text = SwitchConfig.CustomThemePath;
|
_custThemePath.Buffer.Text = ConfigurationState.Instance.Ui.CustomThemePath;
|
||||||
_graphicsShadersDumpPath.Buffer.Text = SwitchConfig.GraphicsShadersDumpPath;
|
_graphicsShadersDumpPath.Buffer.Text = ConfigurationState.Instance.Graphics.ShadersDumpPath;
|
||||||
_fsLogSpinAdjustment.Value = SwitchConfig.FsGlobalAccessLogMode;
|
_fsLogSpinAdjustment.Value = ConfigurationState.Instance.System.FsGlobalAccessLogMode;
|
||||||
|
|
||||||
_gameDirsBox.AppendColumn("", new CellRendererText(), "text", 0);
|
_gameDirsBox.AppendColumn("", new CellRendererText(), "text", 0);
|
||||||
_gameDirsBoxStore = new ListStore(typeof(string));
|
_gameDirsBoxStore = new ListStore(typeof(string));
|
||||||
_gameDirsBox.Model = _gameDirsBoxStore;
|
_gameDirsBox.Model = _gameDirsBoxStore;
|
||||||
foreach (string gameDir in SwitchConfig.GameDirs)
|
foreach (string gameDir in ConfigurationState.Instance.Ui.GameDirs.Value)
|
||||||
{
|
{
|
||||||
_gameDirsBoxStore.AppendValues(gameDir);
|
_gameDirsBoxStore.AppendValues(gameDir);
|
||||||
}
|
}
|
||||||
|
@ -208,7 +263,7 @@ namespace Ryujinx.Ui
|
||||||
string key = keyPressed.Event.Key.ToString();
|
string key = keyPressed.Event.Key.ToString();
|
||||||
string capKey = key.First().ToString().ToUpper() + key.Substring(1);
|
string capKey = key.First().ToString().ToUpper() + key.Substring(1);
|
||||||
|
|
||||||
if (Enum.IsDefined(typeof(OpenTK.Input.Key), capKey))
|
if (Enum.IsDefined(typeof(Configuration.Hid.Key), capKey))
|
||||||
{
|
{
|
||||||
button.Label = capKey;
|
button.Label = capKey;
|
||||||
}
|
}
|
||||||
|
@ -325,65 +380,63 @@ namespace Ryujinx.Ui
|
||||||
_gameDirsBoxStore.IterNext(ref treeIter);
|
_gameDirsBoxStore.IterNext(ref treeIter);
|
||||||
}
|
}
|
||||||
|
|
||||||
SwitchConfig.LoggingEnableError = _errorLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableError.Value = _errorLogToggle.Active;
|
||||||
SwitchConfig.LoggingEnableWarn = _warningLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableWarn.Value = _warningLogToggle.Active;
|
||||||
SwitchConfig.LoggingEnableInfo = _infoLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableInfo.Value = _infoLogToggle.Active;
|
||||||
SwitchConfig.LoggingEnableStub = _stubLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableStub.Value = _stubLogToggle.Active;
|
||||||
SwitchConfig.LoggingEnableDebug = _debugLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableDebug.Value = _debugLogToggle.Active;
|
||||||
SwitchConfig.LoggingEnableGuest = _guestLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableGuest.Value = _guestLogToggle.Active;
|
||||||
SwitchConfig.LoggingEnableFsAccessLog = _fsAccessLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableFsAccessLog.Value = _fsAccessLogToggle.Active;
|
||||||
SwitchConfig.EnableFileLog = _fileLogToggle.Active;
|
ConfigurationState.Instance.Logger.EnableFileLog.Value = _fileLogToggle.Active;
|
||||||
SwitchConfig.DockedMode = _dockedModeToggle.Active;
|
ConfigurationState.Instance.System.EnableDockedMode.Value = _dockedModeToggle.Active;
|
||||||
SwitchConfig.EnableDiscordIntegration = _discordToggle.Active;
|
ConfigurationState.Instance.EnableDiscordIntegration.Value = _discordToggle.Active;
|
||||||
SwitchConfig.EnableVsync = _vSyncToggle.Active;
|
ConfigurationState.Instance.Graphics.EnableVsync.Value = _vSyncToggle.Active;
|
||||||
SwitchConfig.EnableMulticoreScheduling = _multiSchedToggle.Active;
|
ConfigurationState.Instance.System.EnableMulticoreScheduling.Value = _multiSchedToggle.Active;
|
||||||
SwitchConfig.EnableFsIntegrityChecks = _fsicToggle.Active;
|
ConfigurationState.Instance.System.EnableFsIntegrityChecks.Value = _fsicToggle.Active;
|
||||||
SwitchConfig.IgnoreMissingServices = _ignoreToggle.Active;
|
ConfigurationState.Instance.System.IgnoreMissingServices.Value = _ignoreToggle.Active;
|
||||||
SwitchConfig.EnableKeyboard = _directKeyboardAccess.Active;
|
ConfigurationState.Instance.Hid.EnableKeyboard.Value = _directKeyboardAccess.Active;
|
||||||
SwitchConfig.EnableCustomTheme = _custThemeToggle.Active;
|
ConfigurationState.Instance.Ui.EnableCustomTheme.Value = _custThemeToggle.Active;
|
||||||
|
|
||||||
SwitchConfig.KeyboardControls.LeftJoycon = new NpadKeyboardLeft()
|
ConfigurationState.Instance.Hid.KeyboardControls.Value.LeftJoycon = new NpadKeyboardLeft()
|
||||||
{
|
{
|
||||||
StickUp = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickUp1.Label),
|
StickUp = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _lStickUp1.Label),
|
||||||
StickDown = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickDown1.Label),
|
StickDown = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _lStickDown1.Label),
|
||||||
StickLeft = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickLeft1.Label),
|
StickLeft = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _lStickLeft1.Label),
|
||||||
StickRight = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickRight1.Label),
|
StickRight = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _lStickRight1.Label),
|
||||||
StickButton = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _lStickButton1.Label),
|
StickButton = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _lStickButton1.Label),
|
||||||
DPadUp = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadUp1.Label),
|
DPadUp = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _dpadUp1.Label),
|
||||||
DPadDown = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadDown1.Label),
|
DPadDown = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _dpadDown1.Label),
|
||||||
DPadLeft = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadLeft1.Label),
|
DPadLeft = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _dpadLeft1.Label),
|
||||||
DPadRight = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _dpadRight1.Label),
|
DPadRight = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _dpadRight1.Label),
|
||||||
ButtonMinus = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _minus1.Label),
|
ButtonMinus = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _minus1.Label),
|
||||||
ButtonL = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _l1.Label),
|
ButtonL = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _l1.Label),
|
||||||
ButtonZl = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _zL1.Label),
|
ButtonZl = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _zL1.Label),
|
||||||
};
|
};
|
||||||
|
|
||||||
SwitchConfig.KeyboardControls.RightJoycon = new NpadKeyboardRight()
|
ConfigurationState.Instance.Hid.KeyboardControls.Value.RightJoycon = new NpadKeyboardRight()
|
||||||
{
|
{
|
||||||
StickUp = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickUp1.Label),
|
StickUp = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _rStickUp1.Label),
|
||||||
StickDown = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickDown1.Label),
|
StickDown = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _rStickDown1.Label),
|
||||||
StickLeft = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickLeft1.Label),
|
StickLeft = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _rStickLeft1.Label),
|
||||||
StickRight = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickRight1.Label),
|
StickRight = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _rStickRight1.Label),
|
||||||
StickButton = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _rStickButton1.Label),
|
StickButton = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _rStickButton1.Label),
|
||||||
ButtonA = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _a1.Label),
|
ButtonA = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _a1.Label),
|
||||||
ButtonB = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _b1.Label),
|
ButtonB = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _b1.Label),
|
||||||
ButtonX = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _x1.Label),
|
ButtonX = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _x1.Label),
|
||||||
ButtonY = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _y1.Label),
|
ButtonY = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _y1.Label),
|
||||||
ButtonPlus = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _plus1.Label),
|
ButtonPlus = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _plus1.Label),
|
||||||
ButtonR = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _r1.Label),
|
ButtonR = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _r1.Label),
|
||||||
ButtonZr = (OpenTK.Input.Key)Enum.Parse(typeof(OpenTK.Input.Key), _zR1.Label),
|
ButtonZr = (Configuration.Hid.Key)Enum.Parse(typeof(Configuration.Hid.Key), _zR1.Label),
|
||||||
};
|
};
|
||||||
|
|
||||||
SwitchConfig.SystemLanguage = (SystemLanguage)Enum.Parse(typeof(SystemLanguage), _systemLanguageSelect.ActiveId);
|
ConfigurationState.Instance.System.Language.Value = (Language)Enum.Parse(typeof(Language), _systemLanguageSelect.ActiveId);
|
||||||
SwitchConfig.ControllerType = (ControllerStatus)Enum.Parse(typeof(ControllerStatus), _controller1Type.ActiveId);
|
ConfigurationState.Instance.Hid.ControllerType.Value = (ControllerType)Enum.Parse(typeof(ControllerType), _controller1Type.ActiveId);
|
||||||
SwitchConfig.CustomThemePath = _custThemePath.Buffer.Text;
|
ConfigurationState.Instance.Ui.CustomThemePath.Value = _custThemePath.Buffer.Text;
|
||||||
SwitchConfig.GraphicsShadersDumpPath = _graphicsShadersDumpPath.Buffer.Text;
|
ConfigurationState.Instance.Graphics.ShadersDumpPath.Value = _graphicsShadersDumpPath.Buffer.Text;
|
||||||
SwitchConfig.GameDirs = gameDirs;
|
ConfigurationState.Instance.Ui.GameDirs.Value = gameDirs;
|
||||||
SwitchConfig.FsGlobalAccessLogMode = (int)_fsLogSpinAdjustment.Value;
|
ConfigurationState.Instance.System.FsGlobalAccessLogMode.Value = (int)_fsLogSpinAdjustment.Value;
|
||||||
|
|
||||||
Configuration.SaveConfig(SwitchConfig, System.IO.Path.Combine(AppDomain.CurrentDomain.BaseDirectory, "Config.json"));
|
|
||||||
Configuration.Configure(_device, SwitchConfig);
|
|
||||||
|
|
||||||
|
MainWindow.SaveConfig();
|
||||||
MainWindow.ApplyTheme();
|
MainWindow.ApplyTheme();
|
||||||
#pragma warning disable CS4014
|
#pragma warning disable CS4014
|
||||||
MainWindow.UpdateGameTable();
|
MainWindow.UpdateGameTable();
|
||||||
|
|
Loading…
Add table
Add a link
Reference in a new issue